NPASS Compound

Natural Product: NPC481047

Natural Product ID	NPC481047
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	AGDIWSDYRLWGIC-RSWYGVMDSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000264] Organic acids and derivatives [CHEMONTID:0000265] Carboxylic acids and derivatives [CHEMONTID:0002995] Pentacarboxylic acids and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 79 82 0 0 0 0 0 0 0 0999 V2000 -3.8025 -0.6101 -0.6209 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9617 -0.2550 0.6078 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.0445 1.2035 0.8009 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9320 2.0326 0.2748 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6671 1.3625 0.7899 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5783 0.0587 0.0656 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7998 0.3357 -1.4041 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8138 -0.4603 0.1783 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9565 -1.9485 -0.0582 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1768 -2.6450 0.6289 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5007 -2.1904 -0.0504 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6387 -0.9182 0.6139 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2390 -1.1092 1.9503 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4648 -2.2451 2.0211 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3559 -3.3459 2.6250 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7226 -2.1383 2.9233 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2759 -3.2485 -0.0327 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7840 -4.1452 -0.8830 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3975 -3.8845 -2.0246 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6722 -5.2839 -0.5505 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8057 -2.3108 -1.4297 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7755 -2.9794 -2.1364 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8558 -3.3093 -1.6050 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5390 -3.3166 -3.5539 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7481 0.2972 -0.5250 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9030 0.8638 -0.0875 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1391 0.6453 1.1046 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7980 1.6598 -0.9257 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9474 2.1998 -0.4117 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8383 2.9601 -1.1400 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5143 3.1709 -2.4818 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3649 2.6424 -3.0339 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5046 1.8814 -2.2423 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4173 2.1916 0.8454 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9751 2.7011 2.0202 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4155 2.3478 3.0691 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1497 3.5956 1.9640 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0300 3.3132 0.9082 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0909 4.4988 0.2115 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0598 4.4658 -1.0340 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1916 5.8033 0.8920 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7534 -1.0640 -0.2551 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1504 0.3221 -1.1560 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3443 -1.3424 -1.2759 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4991 -0.6521 1.5312 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9893 1.5912 0.3135 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1973 1.5201 1.8796 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9204 2.2351 -0.7931 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9366 1.1261 1.8658 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3082 -0.3763 -2.0771 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8288 0.4416 -1.7179 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2913 1.3118 -1.5927 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1389 -0.3606 1.2257 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9190 -2.2671 0.3377 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0225 -3.7326 0.4982 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1987 -2.0225 -1.1082 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4278 -3.0883 2.5092 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0931 -4.3356 2.2157 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1854 -3.4212 3.7284 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7865 -1.1533 3.4595 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7146 -2.8890 3.7707 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6951 -2.3738 2.3993 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6073 -4.8220 -0.1164 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2596 -5.9210 0.2443 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9747 -5.8008 -1.4595 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7875 -2.6282 -4.0312 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4840 -3.1587 -4.1240 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2223 -4.3713 -3.6963 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1490 1.9998 0.6500 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7478 3.3783 -0.7036 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2222 3.7718 -3.0498 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1418 2.8278 -4.0905 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6282 1.4953 -2.7188 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9786 4.4941 2.6080 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0130 3.0614 2.4344 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4101 3.8500 0.9315 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2448 6.1376 0.9790 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6630 6.5726 0.2664 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6633 5.7576 1.8546 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 6 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 1 13 14 1 0 14 15 1 0 14 16 1 0 11 17 1 0 17 18 1 0 18 19 2 0 18 20 1 0 9 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 8 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 28 29 2 0 29 30 1 0 30 31 2 0 31 32 1 0 32 33 2 0 5 34 1 0 34 35 1 0 35 36 2 0 35 37 1 0 4 38 1 0 38 39 1 0 39 40 2 0 39 41 1 0 12 2 1 0 33 28 1 0 12 6 1 0 14 10 1 0 1 42 1 0 1 43 1 0 1 44 1 0 2 45 1 1 3 46 1 0 3 47 1 0 4 48 1 6 5 49 1 1 7 50 1 0 7 51 1 0 7 52 1 0 8 53 1 1 9 54 1 1 10 55 1 1 11 56 1 6 15 57 1 0 15 58 1 0 15 59 1 0 16 60 1 0 16 61 1 0 16 62 1 0 20 63 1 0 20 64 1 0 20 65 1 0 24 66 1 0 24 67 1 0 24 68 1 0 29 69 1 0 30 70 1 0 31 71 1 0 32 72 1 0 33 73 1 0 37 74 1 0 37 75 1 0 37 76 1 0 41 77 1 0 41 78 1 0 41 79 1 0 M END

Standard InCHIKey	AGDIWSDYRLWGIC-RSWYGVMDSA-N
Standard InCHI	InChI=1S/C30H38O11/c1-15-14-21(36-16(2)31)24(38-18(4)33)29(8)26(40-27(35)20-12-10-9-11-13-20)23(37-17(3)32)22-25(39-19(5)34)30(15,29)41-28(22,6)7/h9-13,15,21-26H,14H2,1-8H3/t15-,21-,22-,23-,24+,25-,26-,29+,30-/m1/s1
SMILES	C[C@@H]1C[C@H]([C@@H]([C@@]2(C)[C@@H]([C@@H]([C@@H]3[C@H]([C@]12OC3(C)C)OC(=O)C)OC(=O)C)OC(=O)c1ccccc1)OC(=O)C)OC(=O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	574.24	Volume:	568.811 ? Van der Waals volume.
Dense:	1.01	LogP:	2.925 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.923 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.668 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	25.0
TPSA:	140.73 ? Topological Polar Surface Area.	H-Bond Acceptor:	11.0
H-Bond Donor:	0.0	Rings:	4.0
Heavy Atoms:	11.0

MedChem Properties

QED Drug-Likeness Score:	0.365	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.868	Fsp³:	0.633
MCE-18:	151.265 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.381	Fluc inhibitor:	0.024 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.005 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.286	Promiscuous compounds:	0.134

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.074	MDCK Permeability:	-4.762
Pgp-inhibitor:	1.0	Pgp-substrate:	0.467
PAMPA:	0.298 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.005
20% Bioavailability (F20%):	0.483	30% Bioavailability (F30%):	0.982
50% Bioavailability (F50%):	0.994

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.056	MRP1:	0.999
Plasma Protein Binding (PPB):	70.381%	Volume Distribution (VD):	-0.456
Fu:	25.238% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.962	BCRP inhibitor:	0.046
BSEP inhibitor:	0.96

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.042
CYP2C19-inhibitor:	0.003	CYP2C19-substrate:	0.019
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.716
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.27
CYP3A4-inhibitor:	0.003	CYP3A4-substrate:	0.037
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.998 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.931

Half-life (T1/2):

0.524

ADMET: Toxicity

hERG Blockers:	0.018	hERG Blockers (10um):	0.159
Human Hepatotoxicity (H-HT):	0.167	Drug-induced Liver Injury (DILI):	0.916
AMES Toxicity:	0.777	Rat Oral Acute Toxicity:	0.337
Maximum Recommended Daily Dose:	0.138	Skin Sensitization:	0.998
Carcinogencity:	0.754	Eye Corrosion:	0.053
Eye Irritation:	0.571	Respiratory Toxicity:	0.071
Drug-induced Neurotoxicity:	0.153	Ototoxicity:	0.179
Hematotoxicity:	0.275	Drug-induced Nephrotoxicity:	0.663
Genotoxicity:	0.806	RPMI-8226 Immunitoxicity:	0.071
A549 Cytotoxicity:	0.265	Hek293 Cytotoxicity:	0.258
BCF:	0.575 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.471 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.858 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.43 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO25406	Celastrus monospermus	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28006915]
NPO25406	Celastrus monospermus	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO25406	Celastrus monospermus	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Ratio IC50	4
IC50	4
Inhibition	4

Activity Type	# Activity
Unchecked	4
Individual protein	8

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	Ratio IC50	=	3.4	n.a.	PMID[33683135]
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	Ratio IC50	=	35.6	n.a.	PMID[33683135]
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	IC50	=	150.0	nM	PMID[33683135]
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	IC50	=	22.0	nM	PMID[33683135]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT28438	Unchecked	Unchecked	n.a.	Inhibition	=	2.7	%	PMID[33683135]
NPT28438	Unchecked	Unchecked	n.a.	Inhibition	=	-1.5	%	PMID[33683135]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC481047 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19195
0.1-0.2	28859
0.2-0.3	1284
0.3-0.4	348
0.4-0.5	85
0.5-0.6	55
0.6-0.7	16
0.7-0.8	0
0.8-0.85	3
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC481045
0.8413	Intermediate Similarity	NPC609924
0.803	Intermediate Similarity	NPC481050
0.803	Intermediate Similarity	NPC609221
0.7619	Intermediate Similarity	NPC473060
0.7536	Intermediate Similarity	NPC608007
0.7385	Intermediate Similarity	NPC147217
0.7231	Intermediate Similarity	NPC147880
0.7143	Intermediate Similarity	NPC483887
0.7143	Intermediate Similarity	NPC158020
0.7143	Intermediate Similarity	NPC66761
0.7143	Intermediate Similarity	NPC483843
0.7143	Intermediate Similarity	NPC476094
0.7121	Intermediate Similarity	NPC148062
0.6984	Remote Similarity	NPC195647
0.6719	Remote Similarity	NPC200592
0.6719	Remote Similarity	NPC610542
0.6667	Remote Similarity	NPC483862
0.6618	Remote Similarity	NPC137718
0.6615	Remote Similarity	NPC475429
0.6615	Remote Similarity	NPC211137
0.6571	Remote Similarity	NPC479043
0.6567	Remote Similarity	NPC51314
0.6462	Remote Similarity	NPC473081
0.6212	Remote Similarity	NPC270498
0.6176	Remote Similarity	NPC90614
0.6087	Remote Similarity	NPC483886
0.6056	Remote Similarity	NPC473758
0.6	Remote Similarity	NPC90257
0.6	Remote Similarity	NPC69357
0.5915	Remote Similarity	NPC43241
0.5857	Remote Similarity	NPC281717
0.5844	Remote Similarity	NPC479040
0.5775	Remote Similarity	NPC479047
0.5775	Remote Similarity	NPC291638
0.5733	Remote Similarity	NPC473112
0.5733	Remote Similarity	NPC607428
0.5714	Remote Similarity	NPC241951
0.5714	Remote Similarity	NPC603877
0.5694	Remote Similarity	NPC177340
0.5676	Remote Similarity	NPC16912
0.5634	Remote Similarity	NPC472577
0.5616	Remote Similarity	NPC254558
0.5616	Remote Similarity	NPC471107
0.5616	Remote Similarity	NPC471100
0.5616	Remote Similarity	NPC605884
0.5588	Remote Similarity	NPC481066
0.5556	Remote Similarity	NPC163719
0.5556	Remote Similarity	NPC483845
0.5556	Remote Similarity	NPC200471
0.5556	Remote Similarity	NPC95810
0.5556	Remote Similarity	NPC472575
0.5541	Remote Similarity	NPC472574
0.5541	Remote Similarity	NPC483844
0.5526	Remote Similarity	NPC473613
0.5526	Remote Similarity	NPC473085
0.5513	Remote Similarity	NPC212768
0.5513	Remote Similarity	NPC14499
0.5513	Remote Similarity	NPC4421
0.5479	Remote Similarity	NPC139067
0.5467	Remote Similarity	NPC472569
0.5467	Remote Similarity	NPC472570
0.5455	Remote Similarity	NPC481489
0.5443	Remote Similarity	NPC605086
0.5432	Remote Similarity	NPC483864
0.5405	Remote Similarity	NPC473088
0.5405	Remote Similarity	NPC471104
0.5405	Remote Similarity	NPC473673
0.5395	Remote Similarity	NPC481071
0.5342	Remote Similarity	NPC4341
0.5333	Remote Similarity	NPC479044
0.5325	Remote Similarity	NPC483848
0.5278	Remote Similarity	NPC481067
0.527	Remote Similarity	NPC67777
0.5263	Remote Similarity	NPC252314
0.5263	Remote Similarity	NPC11685
0.5205	Remote Similarity	NPC483902
0.519	Remote Similarity	NPC481488
0.5143	Remote Similarity	NPC474608
0.5135	Remote Similarity	NPC191082
0.5125	Remote Similarity	NPC88593
0.5067	Remote Similarity	NPC472572
0.5065	Remote Similarity	NPC57628
0.5063	Remote Similarity	NPC483849
0.5059	Remote Similarity	NPC30171

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC481047 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4447
0.1-0.2	4563
0.2-0.3	140
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data