NPASS Compound

Natural Product: NPC480905

Natural Product ID	NPC480905
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	GKDVSIXIYJAZEN-HWIBFZOPSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 84 90 0 0 0 0 0 0 0 0999 V2000 7.7759 1.0126 -2.2083 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3089 0.7276 -2.1396 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9659 -0.7447 -2.1997 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4341 -1.2722 -0.9064 C 0 0 1 0 0 0 0 0 0 0 0 0 6.4942 -1.2085 0.1557 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7035 -2.0025 -0.1023 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8370 -2.7465 -1.0848 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7830 -1.9316 0.8012 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2879 -0.3977 -0.4835 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3906 1.0012 -1.0553 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7179 1.3703 -1.0481 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5681 1.8095 -0.3133 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2704 1.3575 -0.4477 C 0 0 2 0 0 0 0 0 0 0 0 0 1.4063 2.0707 0.6089 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0194 1.6374 0.4620 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9089 2.4137 1.3653 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3924 2.0317 1.1019 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4154 0.5545 1.4305 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6349 -0.1150 0.3372 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.0538 -1.5274 0.1463 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4744 -1.4473 -0.3805 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4168 -0.7330 0.5174 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3870 -1.7601 1.0642 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1847 0.3842 -0.0998 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.6905 1.1982 1.1107 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7935 0.8315 2.2501 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7318 -0.0567 1.6993 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.5339 -1.0946 2.6340 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3397 0.0497 -0.9362 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8098 -1.1019 -1.3459 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0012 -0.9108 -2.1680 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6790 -1.8528 -2.7089 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2260 0.4407 -2.2319 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2334 1.0985 -1.4980 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1747 0.1339 0.5678 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6982 -0.5169 -0.4804 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1119 -0.1079 -0.1829 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0452 -0.8833 -0.8825 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2524 -0.3831 1.8876 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4637 -1.1878 2.4736 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2767 -0.3096 0.9053 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9942 -2.5817 -1.1185 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3385 0.2528 -2.7805 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1644 1.1247 -1.1752 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9503 2.0239 -2.6806 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8244 1.2031 -3.0379 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2657 -0.9613 -3.0531 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8934 -1.2713 -2.4626 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8133 -0.1379 0.3453 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0685 -1.4989 1.1694 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7387 -2.0934 0.5120 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9826 1.0026 -2.1023 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8849 1.6263 -1.4401 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8472 1.8291 1.5863 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4616 3.1567 0.4554 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3089 1.9010 -0.5978 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7085 2.1359 2.4087 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7519 3.4762 1.2000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9782 2.6698 1.7487 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5377 2.1587 0.0144 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8573 0.5240 2.4134 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8618 0.3971 -0.6493 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0122 -2.1640 1.0479 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4336 -1.9538 -0.6831 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4040 -0.8747 -1.3447 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8214 -2.4597 -0.6798 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1923 -2.7900 0.6790 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4355 -1.4445 1.0513 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1738 -1.8846 2.1787 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4558 1.0303 -0.6371 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7427 0.9920 1.3378 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6069 2.2791 0.8471 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3950 0.2783 3.0395 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4104 1.7096 2.8166 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2504 -0.6402 3.4826 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4353 -2.1072 -1.1697 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7380 1.5827 -0.6227 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6673 1.8407 -2.0994 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5545 -1.6168 -0.4390 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4196 -0.0902 -1.4586 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3608 -0.2661 0.8832 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1705 -0.1052 2.4019 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0870 -1.1964 1.3134 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5956 -2.8881 -0.2699 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 4 9 1 0 9 10 1 0 10 11 1 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 1 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 1 24 29 1 0 29 30 2 0 30 31 1 0 31 32 2 0 31 33 1 0 33 34 1 0 19 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 35 39 1 1 39 40 2 0 9 41 1 1 4 42 1 6 11 2 1 0 37 13 1 0 38 9 1 0 35 15 1 0 27 18 1 0 34 29 1 0 27 22 1 0 1 43 1 0 1 44 1 0 1 45 1 0 2 46 1 6 3 47 1 0 3 48 1 0 5 49 1 0 5 50 1 0 8 51 1 0 10 52 1 6 13 53 1 6 14 54 1 0 14 55 1 0 15 56 1 6 16 57 1 0 16 58 1 0 17 59 1 0 17 60 1 0 18 61 1 1 19 62 1 6 20 63 1 0 20 64 1 0 21 65 1 0 21 66 1 0 23 67 1 0 23 68 1 0 23 69 1 0 24 70 1 6 25 71 1 0 25 72 1 0 26 73 1 0 26 74 1 0 28 75 1 0 30 76 1 0 34 77 1 0 34 78 1 0 36 79 1 0 36 80 1 0 37 81 1 1 39 82 1 0 41 83 1 0 42 84 1 0 M END

Standard InCHIKey	GKDVSIXIYJAZEN-HWIBFZOPSA-N
Standard InCHI	InChI=1S/C31H42O11/c1-16-11-29(36,13-24(33)34)31(38)26(40-16)41-22-10-18-3-4-21-20(28(18,15-32)12-23(22)42-31)5-7-27(2)19(6-8-30(21,27)37)17-9-25(35)39-14-17/h9,15-16,18-23,26,36-38H,3-8,10-14H2,1-2H3,(H,33,34)/t16-,18-,19+,20-,21+,22+,23+,26+,27+,28+,29+,30-,31+/m0/s1
SMILES	C[C@H]1C[C@@](CC(=O)O)([C@]2([C@H](O1)O[C@@H]1C[C@@H]3CC[C@@H]4[C@H](CC[C@]5(C)[C@H](CC[C@]45O)C4=CC(=O)OC4)[C@]3(C[C@H]1O2)C=O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	590.27	Volume:	570.983 ? Van der Waals volume.
Dense:	1.034	LogP:	0.751 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.437 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.58 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	4.0	Rigid Bonds:	38.0
TPSA:	169.05 ? Topological Polar Surface Area.	H-Bond Acceptor:	11.0
H-Bond Donor:	4.0	Rings:	7.0
Heavy Atoms:	11.0

MedChem Properties

QED Drug-Likeness Score:	0.214	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.783	Fsp³:	0.839
MCE-18:	131.93 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.26	Fluc inhibitor:	0.003 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.009 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.224	Promiscuous compounds:	0.642

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.148	MDCK Permeability:	-4.842
Pgp-inhibitor:	0.0	Pgp-substrate:	0.508
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.003
20% Bioavailability (F20%):	0.192	30% Bioavailability (F30%):	0.161
50% Bioavailability (F50%):	0.858

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.827
Plasma Protein Binding (PPB):	76.046%	Volume Distribution (VD):	-0.139
Fu:	21.026% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.011
BSEP inhibitor:	0.885

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.002	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.357	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.935	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.013
HLM stability:	0.03 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.878

Half-life (T1/2):

3.924

ADMET: Toxicity

hERG Blockers:	0.01	hERG Blockers (10um):	0.055
Human Hepatotoxicity (H-HT):	0.725	Drug-induced Liver Injury (DILI):	0.787
AMES Toxicity:	0.954	Rat Oral Acute Toxicity:	0.993
Maximum Recommended Daily Dose:	1.0	Skin Sensitization:	1.0
Carcinogencity:	0.952	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.972
Drug-induced Neurotoxicity:	0.007	Ototoxicity:	0.721
Hematotoxicity:	0.801	Drug-induced Nephrotoxicity:	0.997
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.887
A549 Cytotoxicity:	0.026	Hek293 Cytotoxicity:	0.908
BCF:	0.495 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.218 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.838 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.944 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO30295	Calotropis gigantea	Species	Apocynaceae	Eukaryota	leaves	n.a.	n.a.	PMID[16933890]
NPO30295	Calotropis gigantea	Species	Apocynaceae	Eukaryota	n.a.	root	n.a.	PMID[19052526]
NPO30295	Calotropis gigantea	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28817274]
NPO30295	Calotropis gigantea	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[31967821]
NPO30295	Calotropis gigantea	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32649211]
NPO30295	Calotropis gigantea	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[9548837]
NPO30295	Calotropis gigantea	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT165	Cell line	HeLa	Homo sapiens	IC50	=	1600.0	nM	PMID[31967821]
NPT461	Cell line	PANC-1	Homo sapiens	IC50	=	1000.0	nM	PMID[31967821]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC480905 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	14291
0.1-0.2	33759
0.2-0.3	1577
0.3-0.4	119
0.4-0.5	83
0.5-0.6	16
0.6-0.7	13
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.6966	Remote Similarity	NPC253456
0.6966	Remote Similarity	NPC159338
0.6966	Remote Similarity	NPC171619
0.6774	Remote Similarity	NPC163365
0.6739	Remote Similarity	NPC91
0.6703	Remote Similarity	NPC277374
0.6667	Remote Similarity	NPC85369
0.6559	Remote Similarity	NPC488161
0.6559	Remote Similarity	NPC16569
0.6327	Remote Similarity	NPC470094
0.6263	Remote Similarity	NPC473040
0.6078	Remote Similarity	NPC476221
0.6078	Remote Similarity	NPC477709
0.5789	Remote Similarity	NPC104585
0.5714	Remote Similarity	NPC488162
0.5714	Remote Similarity	NPC93416
0.5657	Remote Similarity	NPC157817
0.5612	Remote Similarity	NPC42670
0.5612	Remote Similarity	NPC19124
0.56	Remote Similarity	NPC33934
0.5556	Remote Similarity	NPC298783
0.5556	Remote Similarity	NPC329905
0.5545	Remote Similarity	NPC142756
0.534	Remote Similarity	NPC225385
0.5294	Remote Similarity	NPC488158
0.5294	Remote Similarity	NPC488159
0.5253	Remote Similarity	NPC88668
0.5056	Remote Similarity	NPC196931
0.505	Remote Similarity	NPC488160

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC480905 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4718
0.1-0.2	4356
0.2-0.3	62
0.3-0.4	10
0.4-0.5	3
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5631	Remote Similarity	NPD7625	Phase 1

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data