NPASS Compound

Natural Product: NPC478545

Natural Product ID	NPC478545
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	BUNAGSSJQFDKPO-IFDRREKCSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 86 92 0 0 0 0 0 0 0 0999 V2000 -4.8476 -0.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3498 -0.4244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2313 -0.9596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0796 -1.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7062 -2.6807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4086 -3.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8351 -3.2209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1470 -1.7537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0323 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2458 0.1317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7130 -0.1802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4630 1.1188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4593 2.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0890 1.6235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7187 2.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3943 1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2760 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3943 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0323 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6772 3.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1149 2.5779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6122 2.6674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2833 4.0089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3484 4.3474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5619 3.7253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8084 4.3355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6729 3.1152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5161 4.6070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4555 5.6678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7296 5.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5728 6.9805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7863 7.8622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1566 7.2521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3134 5.7603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0999 4.8786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9548 1.2756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9419 -0.4816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4410 -0.5340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1328 -3.1443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5593 -3.6078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8712 -5.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3242 -0.0787 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2894 -1.7760 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9294 -1.8403 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0860 1.0523 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4512 1.0722 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6721 -1.9193 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3602 -3.3326 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1128 -5.0089 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6521 -4.7451 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3342 -3.2733 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0439 -4.7063 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3605 -2.6354 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7342 -1.2866 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6085 -1.6765 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1854 0.1062 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2248 3.7151 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2719 3.1123 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0283 2.5730 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3907 1.0037 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6004 -0.7041 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8615 -1.5254 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4231 1.3118 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4727 3.8998 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7412 4.0306 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2591 5.1481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5330 3.1792 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2716 5.1163 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3757 5.4893 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1787 4.9456 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1983 5.7058 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5810 3.0497 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2025 7.5906 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6295 9.3539 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3702 8.1337 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6838 5.1502 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4374 3.4171 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5649 2.6460 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8828 -0.9475 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8545 0.9079 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2063 -2.0155 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8466 -4.6167 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9277 -1.8722 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1831 -6.5422 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3384 -4.7632 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4040 -5.3869 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 9 8 1 6 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 16 19 1 0 15 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 20 24 1 0 15 25 1 1 25 26 1 0 13 27 1 0 27 28 1 0 28 29 2 0 28 30 1 0 30 31 2 0 31 32 1 0 32 33 2 0 33 34 1 0 34 35 2 0 12 36 1 1 8 37 1 0 37 38 1 0 5 39 1 6 39 40 1 0 40 41 1 0 19 3 1 0 35 30 1 0 18 5 1 0 18 9 1 0 19 9 1 0 14 10 1 0 21 12 1 0 1 42 1 0 1 43 1 0 1 44 1 0 2 45 1 0 2 46 1 0 4 47 1 0 4 48 1 0 6 49 1 0 6 50 1 0 7 51 1 0 7 52 1 0 8 53 1 1 10 54 1 1 11 55 1 0 11 56 1 0 13 57 1 1 14 58 1 1 16 59 1 6 17 60 1 0 17 61 1 0 18 62 1 1 19 63 1 1 20 64 1 1 21 65 1 6 23 66 1 0 23 67 1 0 23 68 1 0 24 69 1 0 26 70 1 0 26 71 1 0 26 72 1 0 31 73 1 0 32 74 1 0 33 75 1 0 34 76 1 0 35 77 1 0 36 78 1 0 38 79 1 0 38 80 1 0 38 81 1 0 39 82 1 0 39 83 1 0 41 84 1 0 41 85 1 0 41 86 1 0 M END

Standard InCHIKey	BUNAGSSJQFDKPO-IFDRREKCSA-N
Standard InCHI	InChI=1S/C32H45NO8/c1-6-33-16-29(17-37-2)13-12-22(38-3)31-20-15-30(36)26(41-28(35)18-10-8-7-9-11-18)23(20)32(40-5,25(34)27(30)39-4)19(24(31)33)14-21(29)31/h7-11,19-27,34,36H,6,12-17H2,1-5H3/t19-,20+,21+,22-,23+,24-,25-,26+,27-,29-,30+,31+,32-/m0/s1
SMILES	CCN1C[C@@]2(CC[C@@H]([C@@]34[C@@H]5C[C@]6([C@@H]([C@@H]5[C@@]([C@@H](C[C@H]23)[C@H]14)([C@H]([C@@H]6OC)O)OC)OC(=O)c1ccccc1)O)OC)COC

Calculated Properties

Physi-Chem Properties

Molecular Weight:	571.31	Volume:	572.906 ? Van der Waals volume.
Dense:	0.997	LogP:	1.797 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.087 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.07 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	31.0
TPSA:	106.92 ? Topological Polar Surface Area.	H-Bond Acceptor:	9.0
H-Bond Donor:	2.0	Rings:	7.0
Heavy Atoms:	9.0

MedChem Properties

QED Drug-Likeness Score:	0.454	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.086	Fsp³:	0.781
MCE-18:	208.421 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.426	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.015 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.002	Promiscuous compounds:	0.373

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.351	MDCK Permeability:	-5.119
Pgp-inhibitor:	0.099	Pgp-substrate:	0.924
PAMPA:	0.14 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.014	30% Bioavailability (F30%):	0.038
50% Bioavailability (F50%):	0.707

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.907	MRP1:	0.994
Plasma Protein Binding (PPB):	57.373%	Volume Distribution (VD):	0.062
Fu:	45.033% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.888
OATP1B3 inhibitor:	0.924	BCRP inhibitor:	0.011
BSEP inhibitor:	0.798

ADMET: Metabolism

CYP1A2-inhibitor:	0.98	CYP1A2-substrate:	0.218
CYP2C19-inhibitor:	0.996	CYP2C19-substrate:	0.179
CYP2C9-inhibitor:	0.26	CYP2C9-substrate:	0.796
CYP2D6-inhibitor:	0.151	CYP2D6-substrate:	0.317
CYP3A4-inhibitor:	0.923	CYP3A4-substrate:	0.977
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.978
HLM stability:	0.431 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

7.973

Half-life (T1/2):

1.529

ADMET: Toxicity

hERG Blockers:	0.151	hERG Blockers (10um):	0.444
Human Hepatotoxicity (H-HT):	0.222	Drug-induced Liver Injury (DILI):	0.111
AMES Toxicity:	0.495	Rat Oral Acute Toxicity:	0.44
Maximum Recommended Daily Dose:	0.427	Skin Sensitization:	0.995
Carcinogencity:	0.463	Eye Corrosion:	0.003
Eye Irritation:	0.172	Respiratory Toxicity:	0.889
Drug-induced Neurotoxicity:	0.465	Ototoxicity:	0.642
Hematotoxicity:	0.615	Drug-induced Nephrotoxicity:	0.94
Genotoxicity:	0.656	RPMI-8226 Immunitoxicity:	0.107
A549 Cytotoxicity:	0.419	Hek293 Cytotoxicity:	0.434
BCF:	0.745 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.283 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.417 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.93 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO4902	Aconitum carmichaelii	Species	Ranunculaceae	Eukaryota	n.a.	tuber	n.a.	PMID[12913245]
NPO4902	Aconitum carmichaelii	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[1293938]
NPO4902	Aconitum carmichaelii	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[16181762]
NPO4902	Aconitum carmichaelii	Species	Ranunculaceae	Eukaryota	n.a.	root	n.a.	PMID[22223386]
NPO4902	Aconitum carmichaelii	Species	Ranunculaceae	Eukaryota	Lateral roots	n.a.	n.a.	PMID[22607495]
NPO4902	Aconitum carmichaelii	Species	Ranunculaceae	Eukaryota	n.a.	root	n.a.	PMID[22628040]
NPO4902	Aconitum carmichaelii	Species	Ranunculaceae	Eukaryota	n.a.	root	n.a.	PMID[22907155]
NPO4902	Aconitum carmichaelii	Species	Ranunculaceae	Eukaryota	n.a.	root	n.a.	PMID[23225552]
NPO4902	Aconitum carmichaelii	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[23707213]
NPO4902	Aconitum carmichaelii	Species	Ranunculaceae	Eukaryota	n.a.	root	n.a.	PMID[23707213]
NPO4902	Aconitum carmichaelii	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24793215]
NPO4902	Aconitum carmichaelii	Species	Ranunculaceae	Eukaryota	n.a.	root	n.a.	PMID[27761113]
NPO4902	Aconitum carmichaelii	Species	Ranunculaceae	Eukaryota	Roots	n.a.	n.a.	PMID[30892884]
NPO4902	Aconitum carmichaelii	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO4902	Aconitum carmichaelii	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1635	Cell line	H9c2	Rattus norvegicus	IC50	>	100000.0	nM	PMID[30892884]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC478545 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	11366
0.1-0.2	36782
0.2-0.3	1532
0.3-0.4	142
0.4-0.5	11
0.5-0.6	11
0.6-0.7	10
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7831	Intermediate Similarity	NPC478541
0.747	Intermediate Similarity	NPC478544
0.7356	Intermediate Similarity	NPC172769
0.7111	Intermediate Similarity	NPC478537
0.6818	Remote Similarity	NPC478534
0.6667	Remote Similarity	NPC488604
0.6667	Remote Similarity	NPC281470
0.6556	Remote Similarity	NPC478540
0.6489	Remote Similarity	NPC476496
0.617	Remote Similarity	NPC298772
0.617	Remote Similarity	NPC108276
0.617	Remote Similarity	NPC163578
0.6044	Remote Similarity	NPC166521
0.6022	Remote Similarity	NPC488596
0.5979	Remote Similarity	NPC478538
0.5914	Remote Similarity	NPC488583
0.5914	Remote Similarity	NPC478535
0.5789	Remote Similarity	NPC184195
0.5789	Remote Similarity	NPC205
0.5773	Remote Similarity	NPC476495
0.5625	Remote Similarity	NPC40539
0.5612	Remote Similarity	NPC478539
0.5446	Remote Similarity	NPC94687
0.54	Remote Similarity	NPC326895
0.5204	Remote Similarity	NPC124690

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC478545 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3104
0.1-0.2	5885
0.2-0.3	160
0.3-0.4	0
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data