NPASS Compound

Natural Product: NPC476493

Natural Product ID	NPC476493
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	QNWBBGISMLEXSK-FHTKVFLTSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3299035
PubChem CID	90683388
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000279] Alkaloids and derivatives [CHEMONTID:0001140] Harmala alkaloids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 174190 0 0 0 0 0 0 0 0999 V2000 5.6222 -6.1148 -0.3539 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1428 -5.2753 -1.3066 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0629 -4.3115 -0.9590 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7276 -2.9389 -1.1142 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9111 -1.7974 -0.6497 C 0 0 2 0 0 0 0 0 0 0 0 0 4.4993 -0.5427 -1.1543 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4156 0.1570 -0.4451 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7346 -0.3009 0.9033 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9462 -1.0755 1.1014 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0746 -1.9904 2.2776 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8334 -2.5507 2.6459 N 0 0 0 0 0 0 0 0 0 0 0 0 5.9079 -3.5530 3.7123 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1875 -4.8144 3.1904 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9176 -5.2556 1.9285 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9772 -5.9785 0.9899 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9142 -1.4764 2.9259 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4929 -0.8438 1.6070 C 0 0 1 0 0 0 0 0 0 0 0 0 3.6097 0.3469 1.8868 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1636 -0.1028 1.7919 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6848 -0.3278 3.2381 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3285 0.1788 3.5683 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8022 -0.1705 2.6744 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7263 -1.7252 2.6106 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0396 -2.0886 1.3355 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4229 -2.4109 1.4539 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2453 -1.3101 1.0699 N 0 0 0 0 0 0 0 0 0 0 0 0 3.6122 -1.7139 0.8249 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.0436 -2.2421 2.5805 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9761 0.2645 1.4752 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6003 1.3784 1.0138 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0592 2.6947 1.5243 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1682 3.4696 0.6439 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1459 3.0084 0.2671 C 0 0 2 0 0 0 0 0 0 0 0 0 1.4474 1.5264 0.1852 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7418 0.9718 -0.9939 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6483 1.3913 -1.2753 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6730 1.2351 -0.3699 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.9652 0.9643 -0.8719 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8894 1.5194 0.1039 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0923 1.4157 1.3832 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1015 2.9846 -0.3223 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9810 2.7987 -1.5160 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.8934 3.8065 -2.4791 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1623 3.5614 -3.8988 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4324 3.0122 -4.3590 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7657 1.5813 -4.1933 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9834 0.6693 -5.0637 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1491 -0.2784 -4.7209 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9078 -0.5122 -3.2801 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4514 -0.3367 -2.9277 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2719 -0.3952 -1.3932 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4585 -1.0193 -0.8735 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4251 -0.4713 -0.1709 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2164 0.9048 0.3437 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.3994 1.7791 0.0785 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3013 2.8880 -0.8804 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6855 -1.2358 -0.0384 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6797 -1.0620 0.8367 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8944 -1.7571 0.7703 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0557 -2.6620 -0.2451 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0267 -2.8618 -1.1660 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9069 -2.1599 -1.0329 N 0 0 0 0 0 0 0 0 0 0 0 0 -9.7206 -1.4139 1.8001 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9903 -1.7582 2.2138 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.5766 -1.2089 3.3320 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8440 -0.2715 4.0616 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5719 0.0719 3.6463 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0041 -0.4866 2.5271 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7977 -0.3004 1.9330 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.2085 -1.2906 -1.2178 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4390 0.9251 1.3552 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1833 3.5333 1.0811 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7942 1.3979 -1.1020 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9704 2.0644 -1.0539 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1377 3.3643 -1.5534 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0655 4.0162 -2.1310 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8713 3.3304 -2.1823 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7534 2.0882 -1.6910 N 0 0 0 0 0 0 0 0 0 0 0 0 8.4433 3.7709 -1.4213 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1734 4.8941 -1.7135 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5261 4.9924 -1.4439 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1547 3.9221 -0.8627 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4202 2.7717 -0.5592 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0829 2.6977 -0.8348 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1819 1.7087 -0.6350 N 0 0 0 0 0 0 0 0 0 0 0 0 2.6485 -1.9835 -1.2781 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3948 -6.7972 -0.5934 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5909 -5.3677 -2.2766 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2646 -4.4450 -1.7129 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7722 -4.3835 0.0549 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6850 -3.0466 -0.5623 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0079 -2.8581 -2.1813 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1851 -0.1643 -2.1420 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8941 0.6831 1.4923 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3622 -1.5871 0.2110 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7934 -0.3117 1.3314 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4858 -1.4378 3.1826 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8689 -2.7382 2.0443 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9374 -3.8092 3.8861 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3791 -3.2410 4.6176 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1749 -4.5052 2.8901 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2049 -5.5678 3.9591 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7252 -5.9563 2.2242 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3604 -4.4389 1.3642 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9922 -7.1071 1.3467 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9591 -5.7477 1.0183 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1002 -1.9099 3.5021 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4329 -0.7259 3.5617 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8845 1.1849 1.2604 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8536 0.6746 2.9372 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8338 -1.3794 3.5632 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3823 0.2511 3.8861 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0815 -0.4364 4.5179 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3061 1.1835 4.0370 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7342 -0.0233 3.3160 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2479 -2.1470 3.4878 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1584 -1.3003 0.5670 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6113 -2.9659 0.8849 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6027 -3.1771 0.6267 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7093 -2.9668 2.3523 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7086 -2.7474 1.2189 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1042 -3.0089 1.9733 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9177 3.4197 1.7498 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5746 2.6413 2.5039 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0241 4.4339 1.2510 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8300 3.9225 -0.1569 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4019 3.4109 -0.7633 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5492 1.5453 -0.1275 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3224 1.3215 -1.9290 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7787 -0.1090 -1.1186 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6061 2.3674 -1.8516 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9584 0.7175 -2.1598 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9697 1.6348 -1.8115 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4128 0.4980 1.8819 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3603 2.2609 2.0205 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5652 3.5922 0.4440 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1429 3.3428 -0.6986 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8777 4.3097 -2.3587 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5902 4.6656 -2.1686 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0142 4.5540 -4.4355 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2750 2.9683 -4.2997 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2567 3.6858 -3.9510 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5152 3.2223 -5.4740 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9696 1.2133 -3.1890 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8274 1.4988 -4.6658 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1266 0.8208 -6.1449 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6663 -0.8537 -5.5060 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4647 0.1917 -2.7013 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1397 -1.5818 -3.1124 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8834 -1.1210 -3.4450 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0529 0.6378 -3.3112 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5560 -2.1161 -1.1034 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2500 0.7189 1.4855 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7365 2.2223 1.0659 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2696 1.1455 -0.2467 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3308 3.9049 -0.3953 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0584 2.9133 -1.6627 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9483 -3.2492 -0.3810 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1816 -3.5935 -1.9650 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5613 -2.4833 1.6531 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5672 -1.4481 3.6843 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2508 0.1899 4.9478 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0018 0.8044 4.2192 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0880 0.3382 2.3385 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4846 -2.1445 -0.8331 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9099 4.4678 1.3513 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1476 5.0211 -2.5249 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0403 3.8592 -2.6435 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6973 5.7508 -2.1675 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1270 5.8717 -1.6638 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1988 3.9511 -0.6415 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9173 1.9300 -0.1010 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4342 0.7891 -0.2516 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5872 -1.4133 -2.0823 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 11 16 1 0 16 17 1 0 17 18 1 1 19 18 1 1 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 23 28 1 0 22 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 1 39 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 2 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 2 0 53 54 1 0 54 55 1 0 55 56 1 0 53 57 1 0 57 58 2 0 58 59 1 0 59 60 2 0 60 61 1 0 61 62 2 0 59 63 1 0 63 64 2 0 64 65 1 0 65 66 2 0 66 67 1 0 67 68 2 0 68 69 1 0 51 70 1 6 34 71 1 0 33 72 1 0 7 73 1 0 73 74 2 0 74 75 1 0 75 76 2 0 76 77 1 0 77 78 2 0 75 79 1 0 79 80 2 0 80 81 1 0 81 82 2 0 82 83 1 0 83 84 2 0 84 85 1 0 5 86 1 6 15 1 1 0 27 17 1 0 30 40 1 1 56 42 1 0 62 57 1 0 68 63 1 0 78 73 1 0 84 79 1 0 27 5 1 0 37 30 1 0 51 38 1 0 69 58 1 0 85 74 1 0 17 8 1 0 26 19 1 0 54 39 1 0 71 19 1 0 1 87 1 0 2 88 1 0 3 89 1 0 3 90 1 0 4 91 1 0 4 92 1 0 6 93 1 0 8 94 1 1 9 95 1 0 9 96 1 0 10 97 1 0 10 98 1 0 12 99 1 0 12100 1 0 13101 1 0 13102 1 0 14103 1 0 14104 1 0 15105 1 0 15106 1 0 16107 1 0 16108 1 0 18109 1 0 18110 1 0 20111 1 0 20112 1 0 21113 1 0 21114 1 0 22115 1 1 23116 1 1 24117 1 0 24118 1 0 25119 1 0 25120 1 0 27121 1 1 28122 1 0 31123 1 0 31124 1 0 32125 1 0 32126 1 0 33127 1 6 34128 1 6 35129 1 0 35130 1 0 36131 1 0 36132 1 0 38133 1 6 40134 1 0 40135 1 0 41136 1 0 41137 1 0 43138 1 0 43139 1 0 44140 1 0 44141 1 0 45142 1 0 45143 1 0 46144 1 0 46145 1 0 47146 1 0 48147 1 0 49148 1 0 49149 1 0 50150 1 0 50151 1 0 52152 1 0 54153 1 1 55154 1 0 55155 1 0 56156 1 0 56157 1 0 60158 1 0 61159 1 0 64160 1 0 65161 1 0 66162 1 0 67163 1 0 69164 1 0 70165 1 0 72166 1 0 76167 1 0 77168 1 0 80169 1 0 81170 1 0 82171 1 0 83172 1 0 85173 1 0 86174 1 0 M END

Standard InCHIKey	QNWBBGISMLEXSK-FHTKVFLTSA-N
Standard InCHI	InChI=1S/C72H88N8O6/c81-57-21-31-71-43-67-45-77-35-15-7-4-2-6-14-30-70(84,42-52(53(67)25-37-77)62-64-50(24-34-74-62)48-18-10-12-20-56(48)76-64)66(67)80(71)40-28-60(57)86-72-32-22-59(85-71)58(82)27-39-79(72)65-68(44-72)46-78-36-16-8-3-1-5-13-29-69(65,83)41-51(54(68)26-38-78)61-63-49(23-33-73-61)47-17-9-11-19-55(47)75-63/h1-2,5-6,9-12,17-20,23-24,33-34,41-42,53-54,57-60,65-66,75-76,81-84H,3-4,7-8,13-16,21-22,25-32,35-40,43-46H2/b5-1-,6-2-/t53-,54-,57+,58-,59+,60-,65+,66+,67-,68-,69-,70-,71+,72+/m0/s1
SMILES	C1=CCC[C@@]2(C=C([C@@H]3CCN(CCCC1)C[C@]13C[C@]34CC[C@H]([C@H](CCN3[C@@H]21)O)O[C@]12CC[C@H]([C@H](CCN2[C@@H]2[C@@]3(C1)CN1CCCC/C=CCC[C@@]2(C=C([C@@H]3CC1)c1c2c(ccn1)c1ccccc1[nH]2)O)O4)O)c1c2c(ccn1)c1ccccc1[nH]2)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1160.68	Volume:	1206.94 ? Van der Waals volume.
Dense:	0.962	LogP:	5.256 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.915 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-6.603 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	2.0	Rigid Bonds:	96.0
TPSA:	169.7 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	6.0	Rings:	18.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.091	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	8.694	Fsp³:	0.583
MCE-18:	440.526 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.928	Fluc inhibitor:	0.021 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.849 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.566 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.001	Promiscuous compounds:	0.728

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.726	MDCK Permeability:	-5.16
Pgp-inhibitor:	0.0	Pgp-substrate:	0.357
PAMPA:	0.001 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.002	30% Bioavailability (F30%):	0.353
50% Bioavailability (F50%):	0.969

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.908	MRP1:	1.0
Plasma Protein Binding (PPB):	89.096%	Volume Distribution (VD):	-0.158
Fu:	11.388% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.011
OATP1B3 inhibitor:	0.024	BCRP inhibitor:	0.172
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.164	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.981	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.999
CYP2D6-inhibitor:	0.623	CYP2D6-substrate:	0.002
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.002
HLM stability:	0.099 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

7.783

Half-life (T1/2):

1.527

ADMET: Toxicity

hERG Blockers:	0.995	hERG Blockers (10um):	0.342
Human Hepatotoxicity (H-HT):	0.661	Drug-induced Liver Injury (DILI):	0.129
AMES Toxicity:	0.323	Rat Oral Acute Toxicity:	0.998
Maximum Recommended Daily Dose:	1.0	Skin Sensitization:	1.0
Carcinogencity:	0.339	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.999
Drug-induced Neurotoxicity:	0.909	Ototoxicity:	0.994
Hematotoxicity:	0.328	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.998	RPMI-8226 Immunitoxicity:	0.852
A549 Cytotoxicity:	1.0	Hek293 Cytotoxicity:	1.0
BCF:	1.342 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.935 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.185 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.8 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33280	Acanthostrongylophora sp.	Species	Petrosiidae	Eukaryota	n.a.	n.a.	n.a.	PMID[15332848]
NPO33280	Acanthostrongylophora sp.	Species	Petrosiidae	Eukaryota	n.a.	collected from vertical slopes between 33 and 40 m from Knife Cape Manado, Indonesia	n.a.	PMID[16872140]
NPO33280	Acanthostrongylophora sp.	Species	Petrosiidae	Eukaryota	n.a.	collected from vertical slopes between 33 and 40 m from Knife Cape Manado, Indonesia	2004-Mar	PMID[16872140]
NPO33280	Acanthostrongylophora sp.	Species	Petrosiidae	Eukaryota	n.a.	Indonesian	n.a.	PMID[16872140]
NPO33280	Acanthostrongylophora sp.	Species	Petrosiidae	Eukaryota	n.a.	collected from vertical slopes between 33 and 40 m from Knife Cape Manado, Indonesia	2002-May	PMID[16872140]
NPO33663	Acanthostrongylophora ingens	Species	Petrosiidae	Eukaryota	n.a.	Indonesia	n.a.	PMID[24902064]
NPO33663	Acanthostrongylophora ingens	Species	Petrosiidae	Eukaryota	n.a.	n.a.	n.a.	PMID[27933894]
NPO33280	Acanthostrongylophora sp.	Species	Petrosiidae	Eukaryota	n.a.	n.a.	n.a.	PMID[28452477]
NPO33663	Acanthostrongylophora ingens	Species	Petrosiidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO33280	Acanthostrongylophora sp.	Species	Petrosiidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	3
Inhibition	1
MIC	5

Activity Type	# Activity
Cell line	1
Organism	5
Protein complex	1
Others	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2890	Protein complex	Sodium/potassium-transporting ATPase	Homo sapiens	IC50	>	150000.0	nM	PMID[28452477]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT165	Cell line	HeLa	Homo sapiens	IC50	=	5400.0	nM	PMID[24902064]
NPT566	Organism	Salmonella typhimurium	Salmonella enterica subsp. enterica serovar Typhimurium	MIC	=	0.00078	ug.mL-1	PMID[28452477]
NPT25245	Organism	Proteus hauseri	Proteus hauseri	MIC	>	0.1	ug.mL-1	PMID[28452477]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	>	0.1	ug.mL-1	PMID[28452477]
NPT19	Organism	Escherichia coli	Escherichia coli	MIC	>	0.1	ug.mL-1	PMID[28452477]
NPT2	Others	Unspecified	n.a.	IC50	=	130.0	nM	PMID[24902064]
NPT2	Others	Unspecified	n.a.	Inhibition	=	92.0	%	PMID[24902064]
NPT3147	Organism	Kocuria rhizophila	Kocuria rhizophila	MIC	=	0.0016	ug.mL-1	PMID[28452477]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC476493 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	31879
0.1-0.2	17688
0.2-0.3	250
0.3-0.4	10
0.4-0.5	6
0.5-0.6	15
0.6-0.7	6
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9333	High Similarity	NPC476492
0.8571	High Similarity	NPC471564
0.7946	Intermediate Similarity	NPC471506
0.7034	Intermediate Similarity	NPC479688
0.6777	Remote Similarity	NPC81175
0.6356	Remote Similarity	NPC189202
0.6356	Remote Similarity	NPC479685
0.6348	Remote Similarity	NPC166492
0.6293	Remote Similarity	NPC473362
0.6066	Remote Similarity	NPC473310
0.5691	Remote Similarity	NPC607194
0.5574	Remote Similarity	NPC473757
0.5547	Remote Similarity	NPC909
0.5547	Remote Similarity	NPC475338
0.5403	Remote Similarity	NPC487892
0.5403	Remote Similarity	NPC6215
0.5238	Remote Similarity	NPC476451
0.5238	Remote Similarity	NPC253069
0.5238	Remote Similarity	NPC607417
0.5234	Remote Similarity	NPC265576
0.5191	Remote Similarity	NPC41679
0.5115	Remote Similarity	NPC479681
0.5111	Remote Similarity	NPC476491
0.5038	Remote Similarity	NPC473312
0.5038	Remote Similarity	NPC160752

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC476493 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5547
0.1-0.2	3570
0.2-0.3	33
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data