NPASS Compound

Natural Product: NPC475995

Natural Product ID	NPC475995
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Sarcotin F
IUPAC Name	(2S)-3-hydroxy-2-[(2Z,6S,7E,9E)-13-(2-methoxy-5-oxo-2H-furan-4-yl)-2,6,10-trimethyltrideca-2,7,9-trienyl]-4-methyl-2H-furan-5-one
Synonyms	Sarcotin F
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL520806
PubChem CID	54704221
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001283] Terpene lactones [CHEMONTID:0001538] Diterpene lactones

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 68 69 0 0 0 0 0 0 0 0999 V2000 -7.2509 3.9416 0.1367 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0434 4.1002 -0.7298 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8283 4.5142 -0.3918 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9937 4.4726 -1.5976 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8579 4.4010 -2.6762 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0860 4.0054 -2.2112 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1233 3.6191 -2.8388 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8600 5.3720 -1.7115 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6832 5.2256 -0.8438 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3059 4.3541 0.0024 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8283 3.0825 0.5353 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0382 1.9250 -0.0503 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4385 1.9442 0.4616 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3537 1.7167 1.9278 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0740 0.9470 -0.3858 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5193 -0.2398 -0.1677 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5456 -1.0254 1.0122 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0668 -2.2453 1.0502 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0024 -2.9388 2.4242 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7039 -2.9938 0.0072 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1765 -3.3223 0.3615 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7134 -4.1676 -0.7539 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1368 -5.5416 -0.8249 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3249 -6.0871 0.0579 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9609 -7.4742 -0.3517 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5487 -7.6251 -1.5786 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3309 -6.5001 -1.9296 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0288 -6.3622 -2.9595 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5908 -8.4409 0.5073 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6352 -9.1131 1.2211 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6493 6.3803 -1.0579 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4710 4.9122 0.8626 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0693 3.1485 0.8845 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4475 4.8907 0.6599 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1284 3.6255 -0.4557 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5322 3.3731 -1.6173 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5249 5.3743 -2.8066 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2093 6.4686 -1.6171 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2987 4.5876 0.5052 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8560 2.8861 0.3730 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6685 3.0905 1.6655 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3974 0.9370 0.2814 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9539 2.0601 -1.1384 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8832 2.9507 0.2197 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3738 1.5005 2.3261 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0978 2.6838 2.4688 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4249 1.0103 2.2430 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1886 1.3256 -1.4607 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9220 -0.7240 -1.1269 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1432 -0.7019 1.9839 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9625 -4.0152 2.3223 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0802 -2.5860 2.9419 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8809 -2.5732 2.9680 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2353 -3.9476 -0.2824 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8261 -2.4133 -0.9584 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7185 -2.3656 0.4205 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1819 -3.8648 1.3491 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5432 -3.6421 -1.7072 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8249 -4.2557 -0.5242 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9521 -5.6513 0.9935 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8670 -7.6315 -0.2545 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0694 -8.3634 1.8496 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8253 -9.5728 0.5870 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0558 -9.9071 1.8609 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1389 7.3379 -0.8931 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1932 6.1772 -0.3934 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2766 6.2593 -2.1105 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0303 5.8413 0.9351 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 4 8 1 0 8 9 1 0 9 10 2 3 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 13 15 1 0 15 16 2 3 16 17 1 0 17 18 2 3 18 19 1 0 18 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 2 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 25 29 1 0 29 30 1 0 9 31 1 0 3 32 1 0 6 2 1 0 27 23 1 0 1 33 1 0 1 34 1 0 1 35 1 0 4 36 1 0 8 37 1 0 8 38 1 0 10 39 1 0 11 40 1 0 11 41 1 0 12 42 1 0 12 43 1 0 13 44 1 0 14 45 1 0 14 46 1 0 14 47 1 0 15 48 1 0 16 49 1 0 17 50 1 0 19 51 1 0 19 52 1 0 19 53 1 0 20 54 1 0 20 55 1 0 21 56 1 0 21 57 1 0 22 58 1 0 22 59 1 0 24 60 1 0 25 61 1 0 30 62 1 0 30 63 1 0 30 64 1 0 31 65 1 0 31 66 1 0 31 67 1 0 32 68 1 0 M END

Standard InCHIKey	RUXYPSKOCAEMCR-LRVBKTLQSA-N
Standard InCHI	InChI=1S/C26H36O6/c1-17(11-7-13-19(3)15-22-24(27)20(4)25(28)31-22)9-6-10-18(2)12-8-14-21-16-23(30-5)32-26(21)29/h6,9-10,13,16-17,22-23,27H,7-8,11-12,14-15H2,1-5H3/b9-6+,18-10+,19-13-/t17-,22+,23?/m1/s1
SMILES	CC1=C(C(OC1=O)CC(=CCCC(C)C=CC=C(C)CCCC2=CC(OC2=O)OC)C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	444.25	Volume:	475.425 ? Van der Waals volume.
Dense:	0.934	LogP:	5.572 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.314 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.961 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	15.0
TPSA:	82.06 ? Topological Polar Surface Area.	H-Bond Acceptor:	6.0
H-Bond Donor:	1.0	Rings:	2.0
Heavy Atoms:	6.0

MedChem Properties

QED Drug-Likeness Score:	0.239	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.706	Fsp³:	0.538
MCE-18:	33.6 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.674	Fluc inhibitor:	0.005 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.063 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.618 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.61	Promiscuous compounds:	0.017

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.971	MDCK Permeability:	-4.772
Pgp-inhibitor:	0.096	Pgp-substrate:	0.04
PAMPA:	0.37 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.002
20% Bioavailability (F20%):	0.044	30% Bioavailability (F30%):	0.139
50% Bioavailability (F50%):	0.221

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.852	MRP1:	0.996
Plasma Protein Binding (PPB):	96.816%	Volume Distribution (VD):	-0.257
Fu:	2.878% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.411
OATP1B3 inhibitor:	0.37	BCRP inhibitor:	0.001
BSEP inhibitor:	0.943

ADMET: Metabolism

CYP1A2-inhibitor:	0.996	CYP1A2-substrate:	0.729
CYP2C19-inhibitor:	0.648	CYP2C19-substrate:	0.822
CYP2C9-inhibitor:	0.898	CYP2C9-substrate:	0.005
CYP2D6-inhibitor:	0.235	CYP2D6-substrate:	0.136
CYP3A4-inhibitor:	0.185	CYP3A4-substrate:	0.016
CYP2B6-substrate:	0.995	CYP2C8-inhibitor:	0.913
HLM stability:	0.912 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

5.955

Half-life (T1/2):

0.634

ADMET: Toxicity

hERG Blockers:	0.046	hERG Blockers (10um):	0.299
Human Hepatotoxicity (H-HT):	0.685	Drug-induced Liver Injury (DILI):	0.465
AMES Toxicity:	0.449	Rat Oral Acute Toxicity:	0.263
Maximum Recommended Daily Dose:	0.603	Skin Sensitization:	1.0
Carcinogencity:	0.465	Eye Corrosion:	0.009
Eye Irritation:	0.584	Respiratory Toxicity:	0.185
Drug-induced Neurotoxicity:	0.223	Ototoxicity:	0.468
Hematotoxicity:	0.384	Drug-induced Nephrotoxicity:	0.943
Genotoxicity:	0.337	RPMI-8226 Immunitoxicity:	0.072
A549 Cytotoxicity:	0.039	Hek293 Cytotoxicity:	0.144
BCF:	1.711 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.886 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.394 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.97 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33064	sarcotragus sp.	Species	Irciniidae	Eukaryota	n.a.	n.a.	n.a.	PMID[11678655]
NPO33064	sarcotragus sp.	Species	Irciniidae	Eukaryota	n.a.	n.a.	n.a.	PMID[12350153]
NPO33064	sarcotragus sp.	Species	Irciniidae	Eukaryota	n.a.	n.a.	n.a.	PMID[18341287]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	5

Activity Type	# Activity
Cell line	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT81	Cell line	A549	Homo sapiens	ED50	=	24.1	ug ml-1	PMID[16124762]
NPT146	Cell line	SK-OV-3	Homo sapiens	ED50	=	15.2	ug ml-1	PMID[20566771]
NPT147	Cell line	SK-MEL-2	Homo sapiens	ED50	=	7.6	ug ml-1	PMID[19113968]
NPT574	Cell line	XF498	Homo sapiens	ED50	=	20.1	ug ml-1	PMID[19216517]
NPT148	Cell line	HCT-15	Homo sapiens	ED50	=	10.5	ug ml-1	PMID[19216517]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC475995 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	16589
0.1-0.2	30608
0.2-0.3	2598
0.3-0.4	42
0.4-0.5	6
0.5-0.6	9
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC474098
0.6418	Remote Similarity	NPC52820
0.6269	Remote Similarity	NPC68001
0.6269	Remote Similarity	NPC199831
0.6087	Remote Similarity	NPC474828
0.6087	Remote Similarity	NPC474827
0.5753	Remote Similarity	NPC474099
0.5676	Remote Similarity	NPC474244
0.5479	Remote Similarity	NPC329922
0.5479	Remote Similarity	NPC81912
0.5479	Remote Similarity	NPC329694
0.5479	Remote Similarity	NPC474260
0.5479	Remote Similarity	NPC611156
0.525	Remote Similarity	NPC165726
0.525	Remote Similarity	NPC213969

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC475995 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6642
0.1-0.2	2480
0.2-0.3	28
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data