NPASS Compound

Natural Product: NPC472388

Natural Product ID	NPC472388
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	GCNWQFAJNDDIJT-ZEZBHZMHSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL339813
PubChem CID	44351340
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001551] Diterpenoids [CHEMONTID:0000676] Taxanes and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 81 84 0 0 0 0 0 0 0 0999 V2000 -2.5480 2.5922 1.7548 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5810 2.3558 0.6875 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9611 1.6811 -0.4120 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0761 0.8353 0.0070 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5822 -0.4939 0.5018 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6179 -1.2429 -0.3298 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6713 -2.6709 0.3584 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6127 -3.5781 -0.1960 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7311 -3.1361 0.4061 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4126 -1.6992 0.7486 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6157 -1.3011 1.9667 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1959 -0.8421 -0.3519 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4146 0.4429 -0.2512 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2338 1.5563 -1.2317 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1562 1.9610 -1.6101 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6191 1.4188 -2.9110 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2351 3.4776 -1.8663 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7184 2.7986 -0.4456 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1718 2.8174 0.7410 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2605 3.2311 1.8273 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8386 0.1955 -0.4625 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8525 0.4150 0.3681 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7024 0.8925 1.5051 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2196 0.0842 -0.0601 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2162 0.3083 0.7798 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6074 0.0323 0.4938 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5895 0.2908 1.4206 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9272 0.0549 1.2175 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2818 -0.4766 -0.0048 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3223 -0.7458 -0.9519 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9657 -0.4965 -0.7212 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9528 -3.9041 1.5139 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1355 -1.6583 -1.6945 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6199 -1.2866 1.0504 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8285 -1.5797 2.3615 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0330 -1.1077 3.1783 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9534 -2.4301 2.8547 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9582 0.7636 -1.0946 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2733 1.1356 -1.0570 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7129 1.5693 0.0406 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1877 1.0525 -2.2293 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4862 3.1299 1.4188 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0628 3.4104 2.3907 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7183 1.7987 2.4758 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7029 1.2413 0.8292 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0070 -0.2187 1.4419 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4947 -2.5139 1.4147 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6477 -3.1347 0.1469 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8569 -4.5979 0.1353 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4907 -3.5713 -1.2687 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5401 -3.1156 -0.3233 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0118 -2.0003 2.7250 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4303 -0.3118 2.3845 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2136 -1.3606 -1.3053 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4455 0.8322 0.7835 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8523 1.5190 -2.1362 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3796 2.1076 -3.7753 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6820 1.1217 -2.9687 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0130 0.5124 -3.1455 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3018 4.0793 -0.9722 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5201 3.8036 -2.6463 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2432 3.6586 -2.3809 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7569 2.6584 -0.1099 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6475 3.7215 -1.0520 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3737 -0.3240 -1.0272 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0062 0.7356 1.7783 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3279 0.7125 2.3962 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6811 0.2749 1.9835 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3397 -0.6602 -0.1584 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6115 -1.1620 -1.9059 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2603 -0.7365 -1.5224 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6521 -4.5647 1.3545 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2280 -1.7175 -2.3717 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5237 -2.6951 -1.7366 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9297 -1.0339 -2.0907 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0165 -3.2885 2.1550 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9141 -1.8862 2.8697 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6967 -2.8257 3.8525 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2184 1.2750 -1.8922 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9246 1.7997 -3.0045 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2234 0.0141 -2.6444 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 2 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 15 17 1 0 14 18 1 0 18 19 1 0 19 20 2 0 13 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 24 25 2 3 25 26 1 0 26 27 2 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 2 0 9 32 1 0 6 33 1 0 5 34 1 0 34 35 1 0 35 36 2 0 35 37 1 0 4 38 1 0 38 39 1 0 39 40 2 0 39 41 1 0 19 2 1 0 15 3 1 0 12 6 1 0 31 26 1 0 1 42 1 0 1 43 1 0 1 44 1 0 4 45 1 0 5 46 1 0 7 47 1 0 7 48 1 0 8 49 1 0 8 50 1 0 9 51 1 0 11 52 1 0 11 53 1 0 12 54 1 0 13 55 1 0 14 56 1 0 16 57 1 0 16 58 1 0 16 59 1 0 17 60 1 0 17 61 1 0 17 62 1 0 18 63 1 0 18 64 1 0 24 65 1 0 25 66 1 0 27 67 1 0 28 68 1 0 29 69 1 0 30 70 1 0 31 71 1 0 32 72 1 0 33 73 1 0 33 74 1 0 33 75 1 0 37 76 1 0 37 77 1 0 37 78 1 0 41 79 1 0 41 80 1 0 41 81 1 0 M END

Standard InCHIKey	GCNWQFAJNDDIJT-ZEZBHZMHSA-N
Standard InCHI	InChI=1S/C33H40O8/c1-18-24(36)15-16-33(7)28(18)29(41-26(38)14-13-22-11-9-8-10-12-22)23-17-25(37)19(2)27(32(23,5)6)30(39-20(3)34)31(33)40-21(4)35/h8-14,23-24,28-31,36H,1,15-17H2,2-7H3/b14-13+/t23-,24-,28-,29+,30+,31-,33+/m0/s1
SMILES	CC1=C2C(C(C3(CCC(C(=C)C3C(C(C2(C)C)CC1=O)OC(=O)C=CC4=CC=CC=C4)O)C)OC(=O)C)OC(=O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	564.27	Volume:	589.055 ? Van der Waals volume.
Dense:	0.958	LogP:	3.525 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.309 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.25 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	29.0
TPSA:	116.2 ? Topological Polar Surface Area.	H-Bond Acceptor:	8.0
H-Bond Donor:	1.0	Rings:	4.0
Heavy Atoms:	8.0

MedChem Properties

QED Drug-Likeness Score:	0.236	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.402	Fsp³:	0.515
MCE-18:	110.08 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.864	Fluc inhibitor:	0.098 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.062 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.548 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.094	Promiscuous compounds:	0.003

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.939	MDCK Permeability:	-4.664
Pgp-inhibitor:	0.932	Pgp-substrate:	0.71
PAMPA:	0.967 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.278
20% Bioavailability (F20%):	0.424	30% Bioavailability (F30%):	0.973
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.003	MRP1:	0.994
Plasma Protein Binding (PPB):	91.71%	Volume Distribution (VD):	-0.042
Fu:	6.813% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.206
OATP1B3 inhibitor:	0.992	BCRP inhibitor:	0.004
BSEP inhibitor:	0.988

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.084
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.001
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.004
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.003
CYP3A4-inhibitor:	0.018	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.276 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.329

Half-life (T1/2):

1.199

ADMET: Toxicity

hERG Blockers:	0.041	hERG Blockers (10um):	0.4
Human Hepatotoxicity (H-HT):	0.661	Drug-induced Liver Injury (DILI):	0.7
AMES Toxicity:	0.436	Rat Oral Acute Toxicity:	0.359
Maximum Recommended Daily Dose:	0.854	Skin Sensitization:	0.839
Carcinogencity:	0.223	Eye Corrosion:	0.0
Eye Irritation:	0.017	Respiratory Toxicity:	0.031
Drug-induced Neurotoxicity:	0.77	Ototoxicity:	0.833
Hematotoxicity:	0.149	Drug-induced Nephrotoxicity:	0.717
Genotoxicity:	0.67	RPMI-8226 Immunitoxicity:	0.072
A549 Cytotoxicity:	0.179	Hek293 Cytotoxicity:	0.532
BCF:	0.763 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.786 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.928 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.183 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO24820	Taxus cuspidata	Species	Taxaceae	Eukaryota	n.a.	Japan	n.a.	PMID[14987066]
NPO24820	Taxus cuspidata	Species	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[15844936]
NPO24820	Taxus cuspidata	Species	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[15974623]
NPO24820	Taxus cuspidata	Species	Taxaceae	Eukaryota	n.a.	Japan	n.a.	PMID[15974623]
NPO24820	Taxus cuspidata	Species	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO24820	Taxus cuspidata	Species	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO24820	Taxus cuspidata	Species	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO24820	Taxus cuspidata	Species	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO24820	Taxus cuspidata	Species	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1

Activity Type	# Activity
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	n.a.	Activity	=	98.0	%	Open TG-GATES in vivo data: Biochemistry

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC472388 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8335
0.1-0.2	37083
0.2-0.3	4169
0.3-0.4	221
0.4-0.5	24
0.5-0.6	16
0.6-0.7	6
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7662	Intermediate Similarity	NPC472373
0.7273	Intermediate Similarity	NPC607515
0.7246	Intermediate Similarity	NPC8196
0.6923	Remote Similarity	NPC472437
0.6835	Remote Similarity	NPC472361
0.65	Remote Similarity	NPC195224
0.6341	Remote Similarity	NPC475493
0.6265	Remote Similarity	NPC472418
0.6145	Remote Similarity	NPC225103
0.5976	Remote Similarity	NPC472372
0.5909	Remote Similarity	NPC472371
0.589	Remote Similarity	NPC472416
0.5882	Remote Similarity	NPC473443
0.5783	Remote Similarity	NPC473749
0.5698	Remote Similarity	NPC209851
0.5495	Remote Similarity	NPC475400
0.5455	Remote Similarity	NPC471880
0.5412	Remote Similarity	NPC472394
0.5349	Remote Similarity	NPC469742
0.5325	Remote Similarity	NPC143609
0.5263	Remote Similarity	NPC137430
0.519	Remote Similarity	NPC151393
0.5172	Remote Similarity	NPC473439
0.5111	Remote Similarity	NPC473541
0.5056	Remote Similarity	NPC12016

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC472388 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3243
0.1-0.2	5755
0.2-0.3	151
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data