NPASS Compound

Natural Product: NPC472090

Natural Product ID	NPC472090
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	UGXICHSLUREHPI-UHFFFAOYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3337988
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000253] Stilbenes

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 77 80 0 0 0 0 0 0 0 0999 V2000 1.1449 -3.6265 -2.6061 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5498 -2.8575 -1.5835 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2354 -1.7644 -1.8297 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4196 -1.4428 -3.1718 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1809 -0.3748 -3.5200 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3702 -0.0423 -4.8752 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7509 0.3581 -2.5177 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5739 0.0419 -1.1515 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8022 -1.0351 -0.7940 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6196 -1.4330 0.5993 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7576 -1.5935 1.0971 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6510 -0.5928 1.3434 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4243 0.8191 1.0427 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7313 1.2801 -0.3347 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1612 1.0737 -0.7107 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5399 -0.1092 -1.3041 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8488 -0.3364 -1.6635 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8118 0.6245 -1.4339 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4537 1.8266 -0.8362 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1337 2.0232 -0.4879 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4515 2.7772 -0.6180 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1811 4.0274 -0.0158 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1523 0.4372 -1.7822 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8957 -0.9315 1.8838 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2360 -2.2302 2.1676 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3493 -3.2500 1.9253 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1350 -2.9198 1.3995 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2537 -3.9754 1.1692 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5614 -5.3196 1.4459 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4953 -2.5192 2.7076 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3408 0.8655 -0.1882 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6383 0.1474 0.1402 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4598 0.8977 1.1027 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3276 0.6998 2.4585 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1280 1.4349 3.3407 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0521 2.3583 2.8934 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1766 2.5499 1.5192 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3842 1.8218 0.6480 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1110 3.4822 1.0974 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2953 3.7326 -0.2729 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8204 3.0601 3.8132 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3469 -4.0622 -3.2693 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7210 -4.4745 -2.2299 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7562 -2.9501 -3.2475 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0339 -2.0289 -3.9615 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9658 -0.6601 -5.4076 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3694 1.2254 -2.7882 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1972 -0.7409 1.2887 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1933 -2.3907 0.7218 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1077 1.4092 1.7399 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3680 1.1142 1.2637 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6207 2.4118 -0.3265 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1160 0.9393 -1.1412 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7956 -0.8600 -1.4851 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1812 -1.2556 -2.1321 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8541 2.9606 -0.0223 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1149 4.4237 0.4830 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9203 4.8148 -0.7656 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4192 3.9919 0.7699 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8531 0.4956 -1.0464 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6421 -0.1743 2.0997 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6681 -4.2540 2.1657 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4195 -5.8711 1.4127 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2032 -5.6983 0.5970 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0565 -5.4631 2.4250 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2870 -2.6707 2.0958 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8110 1.0332 0.7330 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6137 1.8342 -0.6762 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3926 -0.8332 0.5651 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2522 0.0203 -0.7840 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6145 -0.0146 2.8348 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0460 1.2997 4.4248 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4824 1.9718 -0.4196 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9494 2.9660 -0.7058 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8440 4.7128 -0.3541 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3087 3.7994 -0.7802 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8390 2.9933 3.8259 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 1 0 5 7 2 0 7 8 1 0 8 9 2 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 2 0 19 21 1 0 21 22 1 0 18 23 1 0 12 24 2 0 24 25 1 0 25 26 2 0 26 27 1 0 27 28 1 0 28 29 1 0 25 30 1 0 8 31 1 0 31 32 1 0 32 33 1 0 33 34 2 0 34 35 1 0 35 36 2 0 36 37 1 0 37 38 2 0 37 39 1 0 39 40 1 0 36 41 1 0 9 3 1 0 27 11 2 0 38 33 1 0 20 15 1 0 1 42 1 0 1 43 1 0 1 44 1 0 4 45 1 0 6 46 1 0 7 47 1 0 10 48 1 0 10 49 1 0 13 50 1 0 13 51 1 0 14 52 1 0 14 53 1 0 16 54 1 0 17 55 1 0 20 56 1 0 22 57 1 0 22 58 1 0 22 59 1 0 23 60 1 0 24 61 1 0 26 62 1 0 29 63 1 0 29 64 1 0 29 65 1 0 30 66 1 0 31 67 1 0 31 68 1 0 32 69 1 0 32 70 1 0 34 71 1 0 35 72 1 0 38 73 1 0 40 74 1 0 40 75 1 0 40 76 1 0 41 77 1 0 M END

Standard InCHIKey	UGXICHSLUREHPI-UHFFFAOYSA-N
Standard InCHI	InChI=1S/C33H36O8/c1-38-30-17-24(34)15-22(9-5-20-7-11-28(36)32(13-20)40-3)26(30)19-27-23(16-25(35)18-31(27)39-2)10-6-21-8-12-29(37)33(14-21)41-4/h7-8,11-18,34-37H,5-6,9-10,19H2,1-4H3
SMILES	COc1cc(O)cc(c1Cc1c(CCc2ccc(c(c2)OC)O)cc(cc1OC)O)CCc1ccc(c(c1)OC)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	560.24	Volume:	583.782 ? Van der Waals volume.
Dense:	0.96	LogP:	4.041 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.289 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.372 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	24.0
TPSA:	117.84 ? Topological Polar Surface Area.	H-Bond Acceptor:	8.0
H-Bond Donor:	4.0	Rings:	4.0
Heavy Atoms:	8.0

MedChem Properties

QED Drug-Likeness Score:	0.174	GASA:	0.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	2.752	Fsp³:	0.273
MCE-18:	26.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	1	PAINS Alert:	0
Colloidal aggregators:	0.996	Fluc inhibitor:	0.33 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.536 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.547 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.353	Promiscuous compounds:	0.19

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.012	MDCK Permeability:	-4.762
Pgp-inhibitor:	0.125	Pgp-substrate:	0.054
PAMPA:	0.003 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.69	30% Bioavailability (F30%):	0.236
50% Bioavailability (F50%):	0.998

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	0.998
Plasma Protein Binding (PPB):	96.048%	Volume Distribution (VD):	0.081
Fu:	5.172% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.021
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	1.0	CYP1A2-substrate:	1.0
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	1.0
CYP2C9-inhibitor:	1.0	CYP2C9-substrate:	0.979
CYP2D6-inhibitor:	0.415	CYP2D6-substrate:	1.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.001	CYP2C8-inhibitor:	1.0
HLM stability:	0.995 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

6.2

Half-life (T1/2):

2.11

ADMET: Toxicity

hERG Blockers:	0.873	hERG Blockers (10um):	0.958
Human Hepatotoxicity (H-HT):	0.671	Drug-induced Liver Injury (DILI):	0.034
AMES Toxicity:	0.436	Rat Oral Acute Toxicity:	0.067
Maximum Recommended Daily Dose:	0.919	Skin Sensitization:	0.848
Carcinogencity:	0.131	Eye Corrosion:	0.0
Eye Irritation:	0.176	Respiratory Toxicity:	0.84
Drug-induced Neurotoxicity:	0.197	Ototoxicity:	0.725
Hematotoxicity:	0.138	Drug-induced Nephrotoxicity:	0.522
Genotoxicity:	0.424	RPMI-8226 Immunitoxicity:	0.207
A549 Cytotoxicity:	0.912	Hek293 Cytotoxicity:	0.979
BCF:	1.982 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	5.376 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.076 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.73 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO23332	Dendrobium fimbriatum	Species	Orchidaceae	Eukaryota	stems	n.a.	n.a.	PMID[25316316]
NPO23332	Dendrobium fimbriatum	Species	Orchidaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO23332	Dendrobium fimbriatum	Species	Orchidaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO23332	Dendrobium fimbriatum	Species	Orchidaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	5

Activity Type	# Activity
Cell line	4
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT81	Cell line	A549	Homo sapiens	IC50	=	14490.0	nM	PMID[12502331]
NPT659	Cell line	SMMC-7721	Homo sapiens	IC50	=	16940.0	nM	PMID[16933872]
NPT83	Cell line	MCF7	Homo sapiens	IC50	=	5850.0	nM	PMID[10924160]
NPT660	Cell line	SW480	Homo sapiens	IC50	=	18790.0	nM	Open TG-GATES in vivo data: Biochemistry
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	13940.0	nM	PMID[25316316]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC472090 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27484
0.1-0.2	17535
0.2-0.3	4126
0.3-0.4	564
0.4-0.5	127
0.5-0.6	13
0.6-0.7	3
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8039	Intermediate Similarity	NPC472088
0.7885	Intermediate Similarity	NPC472092
0.7193	Intermediate Similarity	NPC472089
0.6458	Remote Similarity	NPC117214
0.617	Remote Similarity	NPC197757
0.6111	Remote Similarity	NPC113495
0.5962	Remote Similarity	NPC472091
0.5957	Remote Similarity	NPC57490
0.587	Remote Similarity	NPC193544
0.5625	Remote Similarity	NPC603989
0.56	Remote Similarity	NPC203133
0.5593	Remote Similarity	NPC472087
0.5435	Remote Similarity	NPC257124
0.5385	Remote Similarity	NPC82679
0.5333	Remote Similarity	NPC156840
0.5319	Remote Similarity	NPC8547
0.5208	Remote Similarity	NPC471693
0.5102	Remote Similarity	NPC255675
0.5085	Remote Similarity	NPC8731

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC472090 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5323
0.1-0.2	3650
0.2-0.3	166
0.3-0.4	10
0.4-0.5	0
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5435	Remote Similarity	NPD228	Phase 0

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data