NPASS Compound

Natural Product: NPC316989

Natural Product ID	NPC316989
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Ananolignan N
IUPAC Name	n.a.
Synonyms	Ananolignan N
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1782122
PubChem CID	53355574
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000238] Tannins [CHEMONTID:0001710] Hydrolyzable tannins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 82 85 0 0 0 0 0 0 0 0999 V2000 6.4601 2.2030 -0.8019 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5941 3.3587 -0.3646 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2565 2.9098 0.1532 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5053 2.1727 -0.8891 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0366 2.0328 -2.0167 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2598 1.6298 -0.7014 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4986 0.9278 -1.6289 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1234 1.4345 -1.8923 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2625 2.3721 -3.1129 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6904 2.0861 -0.8999 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1096 2.9635 0.0260 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6943 1.3373 -0.0828 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.4997 0.5979 -0.9785 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8615 0.7280 -1.1217 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4525 1.5617 -0.4031 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5541 -0.1025 -2.0961 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8586 -0.0521 -2.3071 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6872 0.8905 -1.5245 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7458 -1.0725 -2.9229 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1377 0.4490 0.9574 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1435 -0.5363 0.9060 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6177 -1.0993 -0.2034 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3525 -0.5091 -1.2401 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0193 -1.3135 -2.0776 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9743 -2.6900 -1.9136 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5629 -3.7453 -2.6229 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4098 -4.9130 -1.8248 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3502 -4.6230 -0.9332 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2292 -3.2452 -0.8731 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5277 -2.4538 0.0076 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2546 -2.8980 1.0476 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6286 -3.2186 0.9089 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3038 -1.2579 1.9904 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3103 -2.1754 1.7812 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6872 -1.8911 1.8770 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3024 -0.9677 3.1937 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2996 0.0057 3.2810 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7004 0.6987 2.1653 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8740 0.2593 4.5038 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8804 1.2041 4.7320 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1197 -1.6811 4.3055 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5331 -2.8888 4.6270 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5980 2.1472 -1.8903 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4800 2.2938 -0.3407 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0289 1.2188 -0.4959 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4720 4.0234 -1.2516 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1351 3.9491 0.3862 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4726 2.1614 0.9676 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7029 3.7436 0.5802 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0905 0.8917 -2.5825 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4795 0.5797 -2.3381 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0114 3.1586 -2.9007 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7066 2.8709 -3.3154 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6090 1.8036 -3.9914 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3449 2.8407 -1.4722 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5329 3.8116 0.4318 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9462 3.4999 -0.4710 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5004 2.4662 0.9164 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3801 2.0309 0.4430 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3372 -0.7013 -3.0533 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6007 0.6713 -0.4351 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3325 1.9092 -1.6902 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7663 0.7971 -1.8354 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3230 -1.4565 -3.7664 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3931 -1.8509 -2.2184 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8592 -0.5336 -3.3482 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5868 -0.8580 -2.8758 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1243 -5.7248 -2.5439 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3002 -5.1580 -1.2360 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8631 -4.0851 1.5774 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7413 -3.5821 -0.1331 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2113 -2.3285 1.1304 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2873 -2.7768 2.0912 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0439 -1.3723 0.9469 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7976 -1.1703 2.7110 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4850 1.4753 2.2108 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4141 2.2348 4.7675 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2658 1.0386 5.7777 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7332 1.1545 4.0506 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0021 -3.7904 4.3043 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5394 -2.9365 4.1393 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6481 -2.9355 5.7233 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 2 0 4 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 14 16 1 0 16 17 2 0 17 18 1 0 16 19 1 0 12 20 1 0 20 21 2 0 21 22 1 0 22 23 2 0 23 24 1 0 24 25 2 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 2 0 30 31 1 0 31 32 1 0 21 33 1 0 33 34 1 0 34 35 1 0 33 36 2 0 36 37 1 0 37 38 2 0 37 39 1 0 39 40 1 0 36 41 1 0 41 42 1 0 23 7 1 0 29 25 1 0 38 20 1 0 30 22 1 0 1 43 1 0 1 44 1 0 1 45 1 0 2 46 1 0 2 47 1 0 3 48 1 0 3 49 1 0 7 50 1 6 8 51 1 6 9 52 1 0 9 53 1 0 9 54 1 0 10 55 1 6 11 56 1 0 11 57 1 0 11 58 1 0 12 59 1 1 17 60 1 0 18 61 1 0 18 62 1 0 18 63 1 0 19 64 1 0 19 65 1 0 19 66 1 0 24 67 1 0 27 68 1 0 27 69 1 0 32 70 1 0 32 71 1 0 32 72 1 0 35 73 1 0 35 74 1 0 35 75 1 0 38 76 1 0 40 77 1 0 40 78 1 0 40 79 1 0 42 80 1 0 42 81 1 0 42 82 1 0 M END

Standard InCHIKey	YWOQCMUIZIFGSH-NWTVNDALSA-N
Standard InCHI	InChI=1S/C32H40O10/c1-10-12-23(33)41-26-17(4)18(5)27(42-32(34)16(3)11-2)19-13-21(35-6)28(36-7)30(37-8)24(19)25-20(26)14-22-29(31(25)38-9)40-15-39-22/h11,13-14,17-18,26-27H,10,12,15H2,1-9H3/b16-11-/t17-,18+,26-,27-/m1/s1
SMILES	CCCC(=O)O[C@@H]1[C@H](C)[C@H](C)[C@@H](OC(=O)/C(=CC)/C)c2c(c3c1cc1OCOc1c3OC)c(OC)c(c(c2)OC)OC

Calculated Properties

Physi-Chem Properties

Molecular Weight:	584.26	Volume:	591.976 ? Van der Waals volume.
Dense:	0.987	LogP:	4.615 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.983 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-6.069 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	25.0
TPSA:	107.98 ? Topological Polar Surface Area.	H-Bond Acceptor:	10.0
H-Bond Donor:	0.0	Rings:	4.0
Heavy Atoms:	10.0

MedChem Properties

QED Drug-Likeness Score:	0.245	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.399	Fsp³:	0.5
MCE-18:	93.042 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.748	Fluc inhibitor:	0.006 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.532 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.58 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.297	Promiscuous compounds:	0.188

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.093	MDCK Permeability:	-4.831
Pgp-inhibitor:	0.737	Pgp-substrate:	0.13
PAMPA:	0.112 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.003
20% Bioavailability (F20%):	0.502	30% Bioavailability (F30%):	0.008
50% Bioavailability (F50%):	0.989

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.827	MRP1:	0.995
Plasma Protein Binding (PPB):	98.652%	Volume Distribution (VD):	-0.157
Fu:	1.315% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.945
OATP1B3 inhibitor:	0.971	BCRP inhibitor:	0.056
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.862	CYP1A2-substrate:	1.0
CYP2C19-inhibitor:	0.997	CYP2C19-substrate:	0.998
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.167
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.981
CYP3A4-inhibitor:	0.996	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.995
HLM stability:	0.999 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.916

Half-life (T1/2):

0.636

ADMET: Toxicity

hERG Blockers:	0.191	hERG Blockers (10um):	0.532
Human Hepatotoxicity (H-HT):	0.644	Drug-induced Liver Injury (DILI):	0.958
AMES Toxicity:	0.828	Rat Oral Acute Toxicity:	0.603
Maximum Recommended Daily Dose:	0.92	Skin Sensitization:	0.94
Carcinogencity:	0.939	Eye Corrosion:	0.001
Eye Irritation:	0.066	Respiratory Toxicity:	0.654
Drug-induced Neurotoxicity:	0.876	Ototoxicity:	0.575
Hematotoxicity:	0.811	Drug-induced Nephrotoxicity:	0.96
Genotoxicity:	0.78	RPMI-8226 Immunitoxicity:	0.505
A549 Cytotoxicity:	0.762	Hek293 Cytotoxicity:	0.662
BCF:	1.644 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.873 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.703 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.834 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27599	Kadsura ananosma	Species	Schisandraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[15165154]
NPO27599	Kadsura ananosma	Species	Schisandraceae	Eukaryota	Stems	n.a.	n.a.	PMID[20025236]
NPO27599	Kadsura ananosma	Species	Schisandraceae	Eukaryota	n.a.	seed	n.a.	PMID[21381710]
NPO27599	Kadsura ananosma	Species	Schisandraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO27599	Kadsura ananosma	Species	Schisandraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO27599	Kadsura ananosma	Species	Schisandraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT519	Cell line	SH-SY5Y	Homo sapiens	Activity	=	75.0	%	PMID[21381710]
NPT519	Cell line	SH-SY5Y	Homo sapiens	Activity	=	66.8	%	PMID[21381710]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC316989 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	14352
0.1-0.2	33374
0.2-0.3	1864
0.3-0.4	166
0.4-0.5	56
0.5-0.6	25
0.6-0.7	12
0.7-0.8	0
0.8-0.85	1
0.85-0.9	4
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8519	High Similarity	NPC321958
0.8519	High Similarity	NPC327352
0.8519	High Similarity	NPC198129
0.8519	High Similarity	NPC252281
0.8214	Intermediate Similarity	NPC322426
0.75	Intermediate Similarity	NPC318286
0.7222	Intermediate Similarity	NPC326144
0.7031	Intermediate Similarity	NPC24562
0.6935	Remote Similarity	NPC85141
0.6818	Remote Similarity	NPC477885
0.6724	Remote Similarity	NPC327651
0.6719	Remote Similarity	NPC312763
0.6667	Remote Similarity	NPC321696
0.6364	Remote Similarity	NPC216434
0.6364	Remote Similarity	NPC103448
0.6364	Remote Similarity	NPC308739
0.6364	Remote Similarity	NPC606558
0.6176	Remote Similarity	NPC477380
0.6061	Remote Similarity	NPC319749
0.6	Remote Similarity	NPC474295
0.5938	Remote Similarity	NPC76415
0.5938	Remote Similarity	NPC325122
0.5938	Remote Similarity	NPC218510
0.5857	Remote Similarity	NPC126405
0.5857	Remote Similarity	NPC53669
0.5857	Remote Similarity	NPC77237
0.5857	Remote Similarity	NPC297271
0.5857	Remote Similarity	NPC16791
0.5857	Remote Similarity	NPC217708
0.5833	Remote Similarity	NPC476065
0.5758	Remote Similarity	NPC325720
0.5758	Remote Similarity	NPC316676
0.5758	Remote Similarity	NPC474393
0.5758	Remote Similarity	NPC474347
0.5571	Remote Similarity	NPC198461
0.5455	Remote Similarity	NPC473989
0.5405	Remote Similarity	NPC475592
0.5333	Remote Similarity	NPC483406
0.5325	Remote Similarity	NPC238834
0.5185	Remote Similarity	NPC477881
0.5132	Remote Similarity	NPC475229
0.5128	Remote Similarity	NPC348849
0.5128	Remote Similarity	NPC178195
0.5091	Remote Similarity	NPC475856
0.5067	Remote Similarity	NPC475756

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC316989 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4479
0.1-0.2	4577
0.2-0.3	93
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data