NPASS Compound

Natural Product: NPC316625

Natural Product ID	NPC316625
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Yungensin D
IUPAC Name	n.a.
Synonyms	Yungensin D
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1631976
PubChem CID	NA
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0001831] Carbonyl compounds [CHEMONTID:0000118] Ketones [CHEMONTID:0003670] Aryl ketones [CHEMONTID:0004296] Phenylketones [CHEMONTID:0004298] Alkyl-phenylketones

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 89 90 0 0 0 0 0 0 0 0999 V2000 -5.7815 -5.5123 0.0210 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8075 -4.6287 0.6962 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3754 -3.1830 0.4134 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0414 -2.9333 0.9560 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4755 -3.9056 1.5635 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3178 -1.6933 0.8642 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0391 -1.5293 1.4079 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4628 -2.5905 2.0517 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3587 -0.3116 1.3116 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9769 -0.1323 1.7868 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0264 -0.2545 0.7024 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9424 0.7157 0.6232 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9013 1.7815 1.5587 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0059 0.7515 -0.3824 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9585 -0.3447 -1.3491 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0609 -1.3172 -1.3153 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0343 -1.3208 -0.2637 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7903 -2.2674 -0.2697 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1427 -2.3387 -2.3347 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0510 -2.3012 -3.2327 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1564 -3.4490 -2.3388 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9209 -0.3614 -2.3741 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8212 2.0786 -1.1463 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3384 0.8304 0.3786 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4923 0.8709 -0.5173 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3303 1.9176 -0.5911 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4674 1.8414 -1.5410 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7478 1.9650 -0.7386 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8721 0.8854 0.2645 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8930 0.0573 0.2065 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9080 0.2090 -0.8572 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0223 -1.0245 1.2052 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0928 3.1047 0.2709 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0107 0.7425 0.6516 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2598 0.6063 0.1135 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8973 -0.6172 0.2283 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1542 -0.7725 -0.3096 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9157 1.7653 -0.5827 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4285 2.7488 0.3816 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7038 3.0674 0.3973 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6914 2.4641 -0.5444 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2323 4.0664 1.3848 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3175 1.9357 0.5736 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2481 -6.0703 0.8375 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2385 -6.2062 -0.7218 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9949 -4.9416 -0.5032 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8152 -4.7347 0.2473 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8211 -4.7485 1.7966 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0803 -2.4825 0.9490 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4912 -3.0492 -0.6603 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2326 -3.4731 1.6499 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8854 0.8731 2.2435 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7637 -0.8782 2.5950 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0491 1.4635 2.5291 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3568 -4.1511 -3.1943 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2142 -4.0076 -1.3895 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8709 -3.0386 -2.4259 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0175 0.4850 -2.9397 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6986 2.8631 -0.3665 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8507 1.9974 -1.6657 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6711 2.2955 -1.7952 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3124 1.6600 1.1037 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4027 -0.0999 1.0134 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7173 0.0173 -1.1518 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4316 2.6479 -2.3026 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4965 0.8537 -2.0280 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7612 2.9309 -0.1607 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6245 1.9441 -1.4038 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1206 0.7609 1.0646 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4055 1.1916 -0.7367 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6552 -0.6226 -0.7980 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3905 0.1106 -1.8504 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6600 -1.8556 0.8499 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4307 -0.5750 2.1426 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9924 -1.3886 1.4745 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8655 3.8678 0.0098 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2553 2.7928 1.3261 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0758 3.5284 0.1319 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4007 -0.7234 -1.2730 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2340 2.2073 -1.3390 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7691 1.3379 -1.1453 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7694 3.2388 1.1079 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2952 2.6046 -1.5913 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8235 1.3868 -0.4040 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6781 2.9661 -0.4645 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6754 5.0041 1.2333 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3000 4.2503 1.2574 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0733 3.7153 2.4234 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1431 2.4349 -0.2830 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 2 0 4 6 1 0 6 7 2 0 7 8 1 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 2 0 12 13 1 0 12 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 2 0 16 19 1 0 19 20 2 0 19 21 1 0 15 22 1 0 14 23 1 0 14 24 1 0 24 25 1 0 25 26 2 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 2 3 30 31 1 0 30 32 1 0 26 33 1 0 9 34 2 0 34 35 1 0 35 36 2 0 36 37 1 0 35 38 1 0 38 39 1 0 39 40 2 3 40 41 1 0 40 42 1 0 34 43 1 0 36 6 1 0 17 11 1 0 1 44 1 0 1 45 1 0 1 46 1 0 2 47 1 0 2 48 1 0 3 49 1 0 3 50 1 0 8 51 1 0 10 52 1 0 10 53 1 0 13 54 1 0 21 55 1 0 21 56 1 0 21 57 1 0 22 58 1 0 23 59 1 0 23 60 1 0 23 61 1 0 24 62 1 0 24 63 1 0 25 64 1 0 27 65 1 0 27 66 1 0 28 67 1 0 28 68 1 0 29 69 1 0 31 70 1 0 31 71 1 0 31 72 1 0 32 73 1 0 32 74 1 0 32 75 1 0 33 76 1 0 33 77 1 0 33 78 1 0 37 79 1 0 38 80 1 0 38 81 1 0 39 82 1 0 41 83 1 0 41 84 1 0 41 85 1 0 42 86 1 0 42 87 1 0 42 88 1 0 43 89 1 0 M END

Standard InCHIKey	DPDVRLNGFWFYRI-LTGZKZEYSA-N
Standard InCHI	InChI=1S/C35H46O8/c1-9-11-26(37)28-30(39)23(15-14-20(4)5)29(38)24(31(28)40)18-25-32(41)27(22(7)36)34(43)35(8,33(25)42)17-16-21(6)13-10-12-19(2)3/h12,14,16,38-40,42-43H,9-11,13,15,17-18H2,1-8H3/b21-16+
SMILES	CCCC(=O)c1c(O)c(CC2=C(O)C(C(=C(C2=O)C(=O)C)O)(C)C/C=C(/CCC=C(C)C)C)c(c(c1O)CC=C(C)C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	594.32	Volume:	638.124 ? Van der Waals volume.
Dense:	0.931	LogP:	5.872 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.958 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.64 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	18.0
TPSA:	152.36 ? Topological Polar Surface Area.	H-Bond Acceptor:	8.0
H-Bond Donor:	5.0	Rings:	2.0
Heavy Atoms:	8.0

MedChem Properties

QED Drug-Likeness Score:	0.088	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.29	Fsp³:	0.457
MCE-18:	75.98 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.959	Fluc inhibitor:	0.147 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.625 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.715 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.63	Promiscuous compounds:	0.219

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.047	MDCK Permeability:	-4.756
Pgp-inhibitor:	0.991	Pgp-substrate:	0.0
PAMPA:	0.363 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.006
20% Bioavailability (F20%):	0.154	30% Bioavailability (F30%):	0.455
50% Bioavailability (F50%):	0.993

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.996
Plasma Protein Binding (PPB):	96.876%	Volume Distribution (VD):	0.178
Fu:	3.184% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.02
BSEP inhibitor:	0.998

ADMET: Metabolism

CYP1A2-inhibitor:	0.002	CYP1A2-substrate:	1.0
CYP2C19-inhibitor:	0.993	CYP2C19-substrate:	1.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.003
CYP3A4-inhibitor:	0.938	CYP3A4-substrate:	0.202
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	1.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

3.633

Half-life (T1/2):

1.044

ADMET: Toxicity

hERG Blockers:	0.006	hERG Blockers (10um):	0.06
Human Hepatotoxicity (H-HT):	0.738	Drug-induced Liver Injury (DILI):	0.921
AMES Toxicity:	0.049	Rat Oral Acute Toxicity:	0.828
Maximum Recommended Daily Dose:	0.186	Skin Sensitization:	0.941
Carcinogencity:	0.051	Eye Corrosion:	0.0
Eye Irritation:	0.115	Respiratory Toxicity:	0.983
Drug-induced Neurotoxicity:	0.064	Ototoxicity:	0.881
Hematotoxicity:	0.707	Drug-induced Nephrotoxicity:	0.908
Genotoxicity:	0.919	RPMI-8226 Immunitoxicity:	0.108
A549 Cytotoxicity:	0.421	Hek293 Cytotoxicity:	0.068
BCF:	1.606 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	5.513 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	7.274 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	7.105 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO17538	Elaphoglossum yungense	Species	Dryopteridaceae	Eukaryota	rhizomes and roots	Yacuchina, Tucumn, Argentina	2008-DEC	PMID[21043474]
NPO17538	Elaphoglossum yungense	Species	Dryopteridaceae	Eukaryota	n.a.	rhizome	n.a.	PMID[21043474]
NPO17538	Elaphoglossum yungense	Species	Dryopteridaceae	Eukaryota	n.a.	root	n.a.	PMID[21043474]
NPO17538	Elaphoglossum yungense	Species	Dryopteridaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	2
GI	2
MBC	2

Activity Type	# Activity
Organism	6

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	100.0	ug.mL-1	PMID[21043474]
NPT18	Organism	Pseudomonas aeruginosa	Pseudomonas aeruginosa	MIC	=	50.0	ug.mL-1	PMID[21043474]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	GI	=	83.0	%	PMID[21043474]
NPT18	Organism	Pseudomonas aeruginosa	Pseudomonas aeruginosa	GI	=	86.0	%	PMID[21043474]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MBC	>	200.0	ug ml-1	PMID[21043474]
NPT18	Organism	Pseudomonas aeruginosa	Pseudomonas aeruginosa	MBC	=	100.0	ug ml-1	PMID[21043474]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC316625 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	15734
0.1-0.2	32530
0.2-0.3	1466
0.3-0.4	106
0.4-0.5	7
0.5-0.6	4
0.6-0.7	7
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9524	High Similarity	NPC329205
0.746	Intermediate Similarity	NPC328983
0.72	Intermediate Similarity	NPC481991
0.6711	Remote Similarity	NPC481990
0.6667	Remote Similarity	NPC481989
0.65	Remote Similarity	NPC321148
0.6429	Remote Similarity	NPC481988
0.642	Remote Similarity	NPC321629
0.6341	Remote Similarity	NPC326193
0.6071	Remote Similarity	NPC323884
0.5789	Remote Similarity	NPC254284
0.5735	Remote Similarity	NPC290466
0.5641	Remote Similarity	NPC483024
0.5059	Remote Similarity	NPC481987

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC316625 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6078
0.1-0.2	3055
0.2-0.3	17
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data