NPASS Compound

Natural Product: NPC247497

Natural Product ID	NPC247497
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	VEDTYRJAYMXHSG-LQEQLURPSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	10435049
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 84 88 0 0 0 0 0 0 0 0999 V2000 5.6514 1.3659 1.9494 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7124 1.0458 0.7687 C 0 0 2 0 0 0 0 0 0 0 0 0 3.3727 0.5996 1.2321 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8982 -0.7254 0.7933 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4093 -0.7689 0.6121 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7007 -1.0491 1.7044 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7813 -1.1458 1.7529 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2749 -0.2971 0.6036 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7529 -0.1062 0.6939 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.5101 -1.3041 1.2032 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9602 0.9733 1.7728 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3537 1.4774 1.8314 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0011 1.8039 0.5449 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6801 0.9255 -0.6105 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7720 1.8304 -1.8631 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7168 -0.1412 -0.8803 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9579 0.4855 -1.1567 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2812 0.4620 -0.5656 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9072 -0.4914 -1.6804 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3958 -0.2793 -1.8799 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7254 -0.8582 -0.6460 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8884 -2.3695 -0.7700 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7734 -0.5272 -0.7115 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8583 0.8918 -1.2099 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4953 -1.3752 -1.7376 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6564 -2.1354 -1.2038 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6218 -1.3737 -0.3601 C 0 0 2 0 0 0 0 0 0 0 0 0 4.6200 -2.4526 0.1378 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5034 -0.4414 -1.1438 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4664 0.1223 -0.1100 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1879 -1.2322 -2.0766 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4024 1.7878 0.7421 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5940 2.3817 0.0338 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0570 3.3621 0.8718 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6505 0.5463 2.6694 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2578 2.3261 2.3677 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6409 1.5669 1.5094 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4002 0.6672 2.3704 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6098 1.3737 1.0013 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1569 -1.4192 1.6683 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2412 -1.2254 2.6536 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9868 -2.2453 1.5884 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1630 -0.8092 2.7314 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8045 0.7208 0.7571 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8961 -1.9684 0.4350 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4155 -0.9861 1.8053 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9367 -1.9086 1.9343 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6951 0.5422 2.7534 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2869 1.8443 1.5727 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3082 2.4300 2.4438 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0518 0.8375 2.4302 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7828 2.8857 0.2996 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7743 2.2980 -2.0641 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4548 2.6895 -1.6610 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0478 1.2579 -2.7486 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4485 -0.6591 -1.8184 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9284 -0.7997 -0.0327 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8666 1.2224 -1.7871 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6657 1.3988 -0.7563 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1291 -1.5286 -1.4029 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4625 -0.2309 -2.5825 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3230 0.8488 -1.9100 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0452 -0.7379 -2.8016 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0891 -2.6722 -1.8414 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7440 -2.7664 -0.2177 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0096 -2.9070 -0.3704 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6417 0.7988 -2.3271 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8840 1.3125 -1.2286 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1624 1.5975 -0.7400 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8224 -2.1163 -2.2288 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8860 -0.7638 -2.6056 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2386 -2.4940 -2.1035 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3835 -3.0552 -0.6513 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9278 -2.1875 1.1707 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4449 -2.5891 -0.5591 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0896 -3.4375 0.2405 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0142 0.4013 -1.6160 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0428 -0.6626 0.4071 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2113 0.7231 -0.7085 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7876 -1.0404 -2.9623 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6229 1.2140 1.5307 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0277 2.3095 -0.9002 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6091 2.7570 -0.2499 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5717 4.1998 0.8647 H 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 1 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 1 9 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 6 14 16 1 0 16 17 1 0 14 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 1 21 23 1 0 23 24 1 6 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 1 27 29 1 0 29 30 1 0 29 31 1 0 13 32 1 0 2 33 1 0 33 34 1 0 30 2 1 0 27 4 1 0 23 5 1 0 21 8 1 0 18 9 1 0 1 35 1 0 1 36 1 0 1 37 1 0 3 38 1 0 3 39 1 0 4 40 1 1 6 41 1 0 7 42 1 0 7 43 1 0 8 44 1 1 10 45 1 0 10 46 1 0 10 47 1 0 11 48 1 0 11 49 1 0 12 50 1 0 12 51 1 0 13 52 1 6 15 53 1 0 15 54 1 0 15 55 1 0 16 56 1 0 16 57 1 0 17 58 1 0 18 59 1 0 19 60 1 0 19 61 1 0 20 62 1 0 20 63 1 0 22 64 1 0 22 65 1 0 22 66 1 0 24 67 1 0 24 68 1 0 24 69 1 0 25 70 1 0 25 71 1 0 26 72 1 0 26 73 1 0 28 74 1 0 28 75 1 0 28 76 1 0 29 77 1 6 30 78 1 0 30 79 1 0 31 80 1 0 32 81 1 0 33 82 1 0 33 83 1 0 34 84 1 0 M END

Standard InCHIKey	VEDTYRJAYMXHSG-LQEQLURPSA-N
Standard InCHI	InChI=1S/C30H50O4/c1-25(17-31)15-20-19-7-8-22-27(3)11-10-23(33)28(4,18-32)21(27)9-12-30(22,6)29(19,5)14-13-26(20,2)24(34)16-25/h7,20-24,31-34H,8-18H2,1-6H3/t20-,21?,22+,23-,24+,25-,26+,27-,28+,29+,30+/m0/s1
SMILES	C[C@@]1(C[C@H]2C3=CC[C@@H]4[C@@]5(C)CC[C@@H]([C@](C)(CO)C5CC[C@@]4(C)[C@]3(C)CC[C@@]2(C)[C@@H](C1)O)O)CO

Calculated Properties

Physi-Chem Properties

Molecular Weight:	474.37	Volume:	517.178 ? Van der Waals volume.
Dense:	0.917	LogP:	3.891 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.737 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.02 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	2.0	Rigid Bonds:	26.0
TPSA:	80.92 ? Topological Polar Surface Area.	H-Bond Acceptor:	4.0
H-Bond Donor:	4.0	Rings:	5.0
Heavy Atoms:	4.0

MedChem Properties

QED Drug-Likeness Score:	0.421	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.117	Fsp³:	0.933
MCE-18:	104.897 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.463	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.025 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.391	Promiscuous compounds:	0.106

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.085	MDCK Permeability:	-4.863
Pgp-inhibitor:	0.101	Pgp-substrate:	0.694
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.003
20% Bioavailability (F20%):	0.999	30% Bioavailability (F30%):	0.905
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.995	MRP1:	0.963
Plasma Protein Binding (PPB):	76.092%	Volume Distribution (VD):	-0.271
Fu:	18.558% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.997
OATP1B3 inhibitor:	0.128	BCRP inhibitor:	0.865
BSEP inhibitor:	0.927

ADMET: Metabolism

CYP1A2-inhibitor:	0.239	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.972	CYP2C19-substrate:	0.028
CYP2C9-inhibitor:	0.285	CYP2C9-substrate:	0.001
CYP2D6-inhibitor:	0.005	CYP2D6-substrate:	0.002
CYP3A4-inhibitor:	0.639	CYP3A4-substrate:	0.002
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.384
HLM stability:	0.019 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

11.33

Half-life (T1/2):

1.084

ADMET: Toxicity

hERG Blockers:	0.039	hERG Blockers (10um):	0.175
Human Hepatotoxicity (H-HT):	0.759	Drug-induced Liver Injury (DILI):	0.016
AMES Toxicity:	0.203	Rat Oral Acute Toxicity:	0.231
Maximum Recommended Daily Dose:	0.53	Skin Sensitization:	0.985
Carcinogencity:	0.99	Eye Corrosion:	0.0
Eye Irritation:	0.314	Respiratory Toxicity:	0.4
Drug-induced Neurotoxicity:	0.018	Ototoxicity:	0.825
Hematotoxicity:	0.228	Drug-induced Nephrotoxicity:	0.909
Genotoxicity:	0.121	RPMI-8226 Immunitoxicity:	0.034
A549 Cytotoxicity:	0.438	Hek293 Cytotoxicity:	0.504
BCF:	1.21 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.559 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.085 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.348 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO25628	Abrus pulchellus	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO25628	Abrus pulchellus	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO25628	Abrus pulchellus	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC247497 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	29097
0.1-0.2	17540
0.2-0.3	2411
0.3-0.4	624
0.4-0.5	137
0.5-0.6	44
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8545	High Similarity	NPC230295
0.8545	High Similarity	NPC98386
0.6949	Remote Similarity	NPC196753
0.6452	Remote Similarity	NPC253402
0.6393	Remote Similarity	NPC34177
0.6308	Remote Similarity	NPC213412
0.597	Remote Similarity	NPC229281
0.597	Remote Similarity	NPC121798
0.597	Remote Similarity	NPC234346
0.5942	Remote Similarity	NPC263393
0.5873	Remote Similarity	NPC101475
0.5735	Remote Similarity	NPC270768
0.5735	Remote Similarity	NPC59263
0.5735	Remote Similarity	NPC210106
0.5714	Remote Similarity	NPC191412
0.5714	Remote Similarity	NPC114159
0.5714	Remote Similarity	NPC6818
0.5692	Remote Similarity	NPC53744
0.5652	Remote Similarity	NPC61543
0.5652	Remote Similarity	NPC293048
0.5652	Remote Similarity	NPC225585
0.5645	Remote Similarity	NPC290598
0.5645	Remote Similarity	NPC30590
0.5625	Remote Similarity	NPC311078
0.5556	Remote Similarity	NPC116457
0.5538	Remote Similarity	NPC253807
0.5538	Remote Similarity	NPC158662
0.5538	Remote Similarity	NPC478657
0.5507	Remote Similarity	NPC7260
0.5507	Remote Similarity	NPC210037
0.5507	Remote Similarity	NPC120968
0.5507	Remote Similarity	NPC227467
0.5507	Remote Similarity	NPC273621
0.5455	Remote Similarity	NPC159168
0.5417	Remote Similarity	NPC127689
0.5417	Remote Similarity	NPC130520
0.5397	Remote Similarity	NPC27765
0.5397	Remote Similarity	NPC122418
0.5397	Remote Similarity	NPC491014
0.5333	Remote Similarity	NPC258547
0.5303	Remote Similarity	NPC235341
0.5303	Remote Similarity	NPC40394
0.5211	Remote Similarity	NPC18872
0.5211	Remote Similarity	NPC290614
0.5152	Remote Similarity	NPC132478
0.5125	Remote Similarity	NPC237503
0.5072	Remote Similarity	NPC246708
0.507	Remote Similarity	NPC182797
0.507	Remote Similarity	NPC52169
0.507	Remote Similarity	NPC488562

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC247497 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8278
0.1-0.2	844
0.2-0.3	25
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6212	Remote Similarity	NPD7645	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data