NPASS Compound

Natural Product: NPC233581

Natural Product ID	NPC233581
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	JEJIRRUCWWRJQY-PUZDGFOXSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2375490
PubChem CID	71712661
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001551] Diterpenoids [CHEMONTID:0002875] Tigliane and ingenane diterpenoids [CHEMONTID:0002906] Phorbol esters

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 91 95 0 0 0 0 0 0 0 0999 V2000 10.1761 -1.4148 -0.7313 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7788 -0.9984 -0.2566 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0559 -0.3559 -1.4258 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6591 0.0981 -1.0649 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8035 -1.0559 -0.5902 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4308 -0.5584 -0.2442 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7043 0.0556 -1.4171 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3659 0.4885 -0.8839 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0642 1.6931 -0.7609 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4913 -0.5015 -0.5372 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1716 -0.2295 -0.0255 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7438 0.4831 -0.9453 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.1909 1.7531 -0.5229 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9799 2.9375 -1.2115 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3323 2.8304 -2.2956 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4441 4.2455 -0.7726 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1395 5.3379 -1.5574 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5400 6.6160 -1.2346 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2774 6.8230 -0.0795 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5771 5.7344 0.6978 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1665 4.4601 0.3569 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8984 -0.3691 -1.4316 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4218 -1.2058 -2.6268 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6060 -1.1803 -0.3952 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8860 -1.3892 0.9070 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3925 -1.2471 0.8314 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2013 0.0475 1.4394 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6920 1.0113 2.1211 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5282 -0.1212 2.1942 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1451 -2.7733 1.4893 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8502 -2.8134 2.8420 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8754 -3.6481 3.0552 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5306 -3.2712 1.2632 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6532 -2.6190 1.0160 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7727 -1.1912 0.9076 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0040 -0.7692 -0.3203 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4196 0.6044 -0.4704 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6666 0.6857 -0.0293 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0967 -0.6636 0.4332 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2143 -1.1694 0.4189 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5312 1.9207 -0.0052 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4952 -0.4716 2.0535 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6296 -4.7714 1.3339 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9537 -5.1094 1.1069 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6157 -2.5120 -0.9284 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3999 -0.9063 -1.6960 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1744 -2.5110 -0.8982 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9350 -1.1112 -0.0001 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8877 -0.2857 0.5832 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2609 -1.8933 0.1283 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6231 0.5877 -1.6760 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0474 -1.0223 -2.2899 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7439 0.8808 -0.2794 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2061 0.5702 -1.9565 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2772 -1.5516 0.2726 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6894 -1.8106 -1.4022 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8238 -1.4526 0.0480 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4254 0.0973 0.6405 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2250 0.9349 -1.8506 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5451 -0.6848 -2.2045 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1930 0.7197 -1.9090 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5584 5.2531 -2.4882 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2973 7.4735 -1.8548 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5799 7.8421 0.1506 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1537 5.8946 1.5995 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4040 3.5877 0.9747 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6002 0.3636 -1.8976 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7737 -2.0378 -2.3072 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9397 -0.4813 -3.3172 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3014 -1.6652 -3.1305 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2238 -0.6957 1.7169 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2329 -2.1592 1.0460 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8999 0.7158 3.1962 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6503 1.2405 1.6842 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1229 1.9854 2.1946 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4027 -0.1420 3.2716 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1425 0.7655 1.9382 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0311 -1.0591 1.8873 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4502 -3.4638 0.9573 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4876 -3.4908 3.9561 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5237 -3.2226 0.8926 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5650 -1.3113 -1.1626 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9161 1.4953 -0.8523 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9304 2.7054 0.5209 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4588 1.7810 0.5579 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7120 2.2887 -1.0389 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3605 -1.0263 2.8486 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0487 -5.1550 0.4472 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2224 -5.1591 2.2889 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0863 -5.7027 0.3206 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3025 -2.5978 -1.6136 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 2 0 8 10 1 0 11 10 1 6 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 14 16 1 0 16 17 2 0 17 18 1 0 18 19 2 0 19 20 1 0 20 21 2 0 12 22 1 0 22 23 1 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 25 30 1 0 30 31 1 0 31 32 1 0 30 33 1 0 33 34 2 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 2 0 38 39 1 0 39 40 2 0 38 41 1 0 35 42 1 1 33 43 1 0 43 44 1 0 24 45 1 6 26 11 1 0 39 35 1 0 27 11 1 0 21 16 1 0 36 24 1 0 1 46 1 0 1 47 1 0 1 48 1 0 2 49 1 0 2 50 1 0 3 51 1 0 3 52 1 0 4 53 1 0 4 54 1 0 5 55 1 0 5 56 1 0 6 57 1 0 6 58 1 0 7 59 1 0 7 60 1 0 12 61 1 6 17 62 1 0 18 63 1 0 19 64 1 0 20 65 1 0 21 66 1 0 22 67 1 6 23 68 1 0 23 69 1 0 23 70 1 0 25 71 1 1 26 72 1 1 28 73 1 0 28 74 1 0 28 75 1 0 29 76 1 0 29 77 1 0 29 78 1 0 30 79 1 6 32 80 1 0 34 81 1 0 36 82 1 6 37 83 1 0 41 84 1 0 41 85 1 0 41 86 1 0 42 87 1 0 43 88 1 0 43 89 1 0 44 90 1 0 45 91 1 0 M END

Standard InCHIKey	JEJIRRUCWWRJQY-PUZDGFOXSA-N
Standard InCHI	InChI=1S/C35H46O10/c1-6-7-8-9-13-16-25(37)44-35-28(32(35,4)5)26-27(45-42)23(19-36)18-33(40)24(17-20(2)29(33)38)34(26,41)21(3)30(35)43-31(39)22-14-11-10-12-15-22/h10-12,14-15,17-18,21,24,26-28,30,36,40-42H,6-9,13,16,19H2,1-5H3/t21-,24-,26+,27+,28-,30-,33-,34+,35-/m1/s1
SMILES	CCCCCCCC(=O)O[C@@]12[C@H](OC(=O)c3ccccc3)[C@@H](C)[C@]3([C@H]([C@@H]1C2(C)C)[C@@H](OO)C(=C[C@]1([C@H]3C=C(C1=O)C)O)CO)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	626.31	Volume:	637.944 ? Van der Waals volume.
Dense:	0.982	LogP:	3.633 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.552 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.775 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	27.0
TPSA:	159.82 ? Topological Polar Surface Area.	H-Bond Acceptor:	10.0
H-Bond Donor:	4.0	Rings:	5.0
Heavy Atoms:	10.0

MedChem Properties

QED Drug-Likeness Score:	0.092	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.3	Fsp³:	0.629
MCE-18:	130.684 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.547	Fluc inhibitor:	0.028 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.009 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.07	Promiscuous compounds:	0.266

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.188	MDCK Permeability:	-4.936
Pgp-inhibitor:	0.26	Pgp-substrate:	0.96
PAMPA:	0.979 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.018
20% Bioavailability (F20%):	0.993	30% Bioavailability (F30%):	0.997
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.006	MRP1:	0.987
Plasma Protein Binding (PPB):	92.548%	Volume Distribution (VD):	-0.298
Fu:	7.818% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.989
OATP1B3 inhibitor:	0.966	BCRP inhibitor:	0.003
BSEP inhibitor:	0.658

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.867
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.005
CYP2C9-inhibitor:	0.64	CYP2C9-substrate:	0.005
CYP2D6-inhibitor:	0.009	CYP2D6-substrate:	0.692
CYP3A4-inhibitor:	0.006	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.751 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.152

Half-life (T1/2):

1.273

ADMET: Toxicity

hERG Blockers:	0.089	hERG Blockers (10um):	0.379
Human Hepatotoxicity (H-HT):	0.365	Drug-induced Liver Injury (DILI):	0.948
AMES Toxicity:	0.636	Rat Oral Acute Toxicity:	0.13
Maximum Recommended Daily Dose:	0.05	Skin Sensitization:	1.0
Carcinogencity:	0.568	Eye Corrosion:	0.006
Eye Irritation:	0.474	Respiratory Toxicity:	0.117
Drug-induced Neurotoxicity:	0.089	Ototoxicity:	0.576
Hematotoxicity:	0.305	Drug-induced Nephrotoxicity:	0.669
Genotoxicity:	0.044	RPMI-8226 Immunitoxicity:	0.101
A549 Cytotoxicity:	0.529	Hek293 Cytotoxicity:	0.322
BCF:	0.742 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.984 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.81 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.79 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO7067	Stellera chamaejasme	Species	Thymelaeaceae	Eukaryota	n.a.	root	n.a.	PMID[15997133]
NPO7067	Stellera chamaejasme	Species	Thymelaeaceae	Eukaryota	n.a.	root	n.a.	PMID[16141313]
NPO7067	Stellera chamaejasme	Species	Thymelaeaceae	Eukaryota	n.a.	callus	n.a.	PMID[22368856]
NPO7067	Stellera chamaejasme	Species	Thymelaeaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[23611151]
NPO7067	Stellera chamaejasme	Species	Thymelaeaceae	Eukaryota	roots	n.a.	n.a.	PMID[24931277]
NPO7067	Stellera chamaejasme	Species	Thymelaeaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26562066]
NPO40396	Wikstroemia scytophylla	Species	Thymelaeaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[33172265]
NPO7067	Stellera chamaejasme	Species	Thymelaeaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[34770847]
NPO7067	Stellera chamaejasme	Species	Thymelaeaceae	Eukaryota	n.a.	root	n.a.	Database[Article]
NPO7067	Stellera chamaejasme	Species	Thymelaeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7067	Stellera chamaejasme	Species	Thymelaeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO7067	Stellera chamaejasme	Species	Thymelaeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO7067	Stellera chamaejasme	Species	Thymelaeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO7067	Stellera chamaejasme	Species	Thymelaeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1
EC90	1

Activity Type	# Activity
Cell line	1
Organism	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT25	Cell line	MT4	Homo sapiens	IC50	=	15800.0	nM	PMID[20624681]
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	EC90	=	1.52	uM	DrugMatrix in vitro pharmacology data

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC233581 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8755
0.1-0.2	38705
0.2-0.3	2106
0.3-0.4	234
0.4-0.5	32
0.5-0.6	16
0.6-0.7	7
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC145649
0.7683	Intermediate Similarity	NPC486562
0.75	Intermediate Similarity	NPC486559
0.686	Remote Similarity	NPC138641
0.686	Remote Similarity	NPC611243
0.6782	Remote Similarity	NPC11410
0.6782	Remote Similarity	NPC600144
0.6322	Remote Similarity	NPC484334
0.619	Remote Similarity	NPC603912
0.6129	Remote Similarity	NPC283875
0.5889	Remote Similarity	NPC472398
0.5889	Remote Similarity	NPC600915
0.5851	Remote Similarity	NPC601559
0.5806	Remote Similarity	NPC486560
0.5789	Remote Similarity	NPC600480
0.5745	Remote Similarity	NPC601392
0.5698	Remote Similarity	NPC486561
0.5652	Remote Similarity	NPC469647
0.5652	Remote Similarity	NPC469648
0.5625	Remote Similarity	NPC22571
0.5625	Remote Similarity	NPC603807
0.5618	Remote Similarity	NPC607335
0.5618	Remote Similarity	NPC610849
0.5341	Remote Similarity	NPC19464
0.5161	Remote Similarity	NPC481523
0.5155	Remote Similarity	NPC609007

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC233581 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3774
0.1-0.2	5229
0.2-0.3	147
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data