NPASS Compound

Natural Product: NPC224719

Natural Product ID	NPC224719
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	OLETUPJEQJHKIN-XYMOGAPJSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	11028762
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0000011] Carbohydrates and carbohydrate conjugates [CHEMONTID:0002105] Glycosyl compounds [CHEMONTID:0004165] Phenolic glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 88 91 0 0 0 0 0 0 0 0999 V2000 4.2269 -2.8922 2.0169 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2218 -2.0148 1.5240 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9039 -0.7268 1.1283 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5790 -0.2925 1.2197 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2272 0.9747 0.8380 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2541 1.7967 0.3585 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5572 1.3542 0.2738 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9093 0.0821 0.6573 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1920 -0.4068 0.5926 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3368 0.2390 0.1486 C 0 0 1 0 0 0 0 0 0 0 0 0 9.3955 0.3149 1.2600 C 0 0 1 0 0 0 0 0 0 0 0 0 10.7831 0.1080 0.6935 C 0 0 2 0 0 0 0 0 0 0 0 0 10.8933 0.8943 -0.5915 C 0 0 1 0 0 0 0 0 0 0 0 0 9.8277 0.3680 -1.5274 C 0 0 1 0 0 0 0 0 0 0 0 0 10.5514 -0.2940 -2.6818 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6896 -0.7661 -3.6509 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9654 -0.4912 -0.8873 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6494 2.2303 -0.2985 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9512 -1.2576 0.4504 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3261 1.5578 1.9169 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8622 1.4877 0.9105 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8322 0.7932 1.3395 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5169 1.3561 1.3922 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4865 0.6475 1.8139 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.4146 -0.7139 2.2698 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7712 -1.6432 1.1220 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1415 -1.3023 0.7108 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1898 -1.9757 1.3191 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4861 -1.7300 1.0133 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8018 -0.7560 0.0419 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7844 -0.0732 -0.5773 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4678 -0.3565 -0.2335 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0295 0.9139 -1.5576 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9914 1.6144 -2.1900 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1075 -0.5442 -0.2310 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8319 0.2679 -1.0548 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6239 -0.6233 -2.0065 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6495 -1.3927 -1.2406 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.6241 -0.4030 -0.6629 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.0133 0.9906 -0.6565 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.8060 1.7580 0.4140 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6466 1.1175 1.6407 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7075 1.0136 -0.2451 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.7323 -0.3426 -1.4946 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9837 -2.1204 -0.2437 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1682 0.0545 -3.0679 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7388 2.6476 0.9876 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3468 -2.9388 1.3478 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8800 -2.4958 3.0093 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6311 -3.9148 2.1179 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8313 -0.9811 1.6007 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9716 2.7920 0.0597 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3338 2.0194 -0.1041 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2036 1.2698 -0.2227 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2191 -0.5001 1.9887 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5378 0.4912 1.3915 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9042 0.8127 -0.9910 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2556 1.2161 -1.9513 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1491 -1.1718 -2.3203 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2785 0.4039 -3.1418 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1422 -1.4888 -3.2538 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4163 2.6664 0.1268 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2440 -1.6779 1.2926 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6463 2.0939 1.4419 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6761 2.5104 0.5907 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9942 -0.2189 1.6585 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2483 -0.8332 3.0174 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5004 -0.9870 2.7930 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0492 -1.5300 0.2775 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7497 -2.6952 1.4581 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9710 -2.7336 2.0746 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3227 -2.2591 1.4905 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6677 0.1838 -0.7249 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4066 2.5450 -2.6642 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2266 1.9887 -1.4640 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5148 1.0369 -3.0087 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2014 0.9285 -1.6586 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8635 -1.3366 -2.4383 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2011 -2.1002 -1.8650 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8701 -0.7394 0.3563 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1836 1.5414 -1.5908 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4786 2.7932 0.5055 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8992 1.6908 0.1814 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2279 1.7145 2.2868 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9391 -1.2242 -1.9076 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6302 -2.7642 0.1751 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2524 -0.4571 -3.8873 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6777 2.8852 0.6544 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 2 0 6 7 1 0 7 8 2 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 14 17 1 0 13 18 1 0 12 19 1 0 11 20 1 0 5 21 1 0 21 22 2 0 22 23 1 0 23 24 2 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 28 29 1 0 29 30 2 0 30 31 1 0 31 32 2 0 31 33 1 0 33 34 1 0 30 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 39 44 1 0 38 45 1 0 37 46 1 0 23 47 1 0 8 3 1 0 17 10 1 0 32 27 1 0 43 36 1 0 1 48 1 0 1 49 1 0 1 50 1 0 4 51 1 0 6 52 1 0 7 53 1 0 10 54 1 6 11 55 1 1 12 56 1 1 13 57 1 6 14 58 1 6 15 59 1 0 15 60 1 0 16 61 1 0 18 62 1 0 19 63 1 0 20 64 1 0 21 65 1 0 22 66 1 0 25 67 1 0 25 68 1 0 26 69 1 0 26 70 1 0 28 71 1 0 29 72 1 0 32 73 1 0 34 74 1 0 34 75 1 0 34 76 1 0 36 77 1 6 37 78 1 6 38 79 1 6 39 80 1 1 40 81 1 6 41 82 1 0 41 83 1 0 42 84 1 0 44 85 1 0 45 86 1 0 46 87 1 0 47 88 1 0 M END

Standard InCHIKey	OLETUPJEQJHKIN-XYMOGAPJSA-N
Standard InCHI	InChI=1S/C31H41NO15/c1-42-19-11-15(3-6-17(19)44-30-28(40)26(38)24(36)21(13-33)46-30)5-8-23(35)32-10-9-16-4-7-18(20(12-16)43-2)45-31-29(41)27(39)25(37)22(14-34)47-31/h3-8,11-12,21-22,24-31,33-34,36-41H,9-10,13-14H2,1-2H3,(H,32,35)/b8-5+/t21-,22-,24-,25-,26+,27+,28-,29-,30-,31-/m1/s1
SMILES	COc1cc(ccc1O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)/C=C/C(=NCCc1ccc(c(c1)OC)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	667.25	Volume:	632.265 ? Van der Waals volume.
Dense:	1.055	LogP:	-0.083 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.862 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.138 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	26.0
TPSA:	249.81 ? Topological Polar Surface Area.	H-Bond Acceptor:	16.0
H-Bond Donor:	9.0	Rings:	4.0
Heavy Atoms:	16.0

MedChem Properties

QED Drug-Likeness Score:	0.085	GASA:	0.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.794	Fsp³:	0.516
MCE-18:	99.34 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.717	Fluc inhibitor:	0.658 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.221 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.598 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.007	Promiscuous compounds:	0.05

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.877	MDCK Permeability:	-5.186
Pgp-inhibitor:	0.0	Pgp-substrate:	0.48
PAMPA:	0.984 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.988
20% Bioavailability (F20%):	0.767	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.0
Plasma Protein Binding (PPB):	79.293%	Volume Distribution (VD):	-0.35
Fu:	17.543% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.021
BSEP inhibitor:	0.009

ADMET: Metabolism

CYP1A2-inhibitor:	0.003	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.006	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.966
HLM stability:	0.009 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.477

Half-life (T1/2):

4.534

ADMET: Toxicity

hERG Blockers:	0.021	hERG Blockers (10um):	0.016
Human Hepatotoxicity (H-HT):	0.968	Drug-induced Liver Injury (DILI):	0.994
AMES Toxicity:	0.985	Rat Oral Acute Toxicity:	0.004
Maximum Recommended Daily Dose:	0.004	Skin Sensitization:	1.0
Carcinogencity:	0.126	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.999
Hematotoxicity:	0.516	Drug-induced Nephrotoxicity:	0.983
Genotoxicity:	0.47	RPMI-8226 Immunitoxicity:	0.059
A549 Cytotoxicity:	0.301	Hek293 Cytotoxicity:	0.181
BCF:	0.427 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.16 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.009 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.944 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO18443	Aristolochia manshuriensis	Species	Aristolochiaceae	Eukaryota	Stems	n.a.	n.a.	PMID[12880323]
NPO18443	Aristolochia manshuriensis	Species	Aristolochiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[20097074]
NPO18443	Aristolochia manshuriensis	Species	Aristolochiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21353775]
NPO18443	Aristolochia manshuriensis	Species	Aristolochiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO18443	Aristolochia manshuriensis	Species	Aristolochiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO18443	Aristolochia manshuriensis	Species	Aristolochiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO18443	Aristolochia manshuriensis	Species	Aristolochiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC224719 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	13466
0.1-0.2	31457
0.2-0.3	4064
0.3-0.4	703
0.4-0.5	130
0.5-0.6	30
0.6-0.7	7
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.6479	Remote Similarity	NPC302378
0.6429	Remote Similarity	NPC248355
0.6338	Remote Similarity	NPC55040
0.6143	Remote Similarity	NPC270849
0.6023	Remote Similarity	NPC114659
0.6023	Remote Similarity	NPC139699
0.6	Remote Similarity	NPC37468
0.5955	Remote Similarity	NPC140915
0.5955	Remote Similarity	NPC187028
0.5915	Remote Similarity	NPC472024
0.5833	Remote Similarity	NPC26653
0.5833	Remote Similarity	NPC80600
0.5634	Remote Similarity	NPC9912
0.5584	Remote Similarity	NPC604095
0.5556	Remote Similarity	NPC301713
0.5464	Remote Similarity	NPC18249
0.5464	Remote Similarity	NPC305700
0.5366	Remote Similarity	NPC158635
0.5366	Remote Similarity	NPC229882
0.5357	Remote Similarity	NPC471063
0.5349	Remote Similarity	NPC93924
0.5333	Remote Similarity	NPC479029
0.5281	Remote Similarity	NPC470950
0.5278	Remote Similarity	NPC166040
0.5263	Remote Similarity	NPC44507
0.5227	Remote Similarity	NPC39657
0.5213	Remote Similarity	NPC469654
0.5158	Remote Similarity	NPC223335
0.5158	Remote Similarity	NPC40920
0.5116	Remote Similarity	NPC63628
0.5116	Remote Similarity	NPC178466
0.5067	Remote Similarity	NPC162093
0.5059	Remote Similarity	NPC227902
0.5056	Remote Similarity	NPC299706
0.5056	Remote Similarity	NPC245615
0.5056	Remote Similarity	NPC115466
0.5056	Remote Similarity	NPC61604

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC224719 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3120
0.1-0.2	5801
0.2-0.3	213
0.3-0.4	15
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data