NPASS Compound

Natural Product: NPC22469

Natural Product ID	NPC22469
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	KMZZTLKNPDAWBH-AJKJBRKTSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0003569] Pregnane steroids [CHEMONTID:0001468] Gluco/mineralocorticoids, progestogins and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 77 80 0 0 0 0 0 0 0 0999 V2000 -7.4809 -1.4978 -0.8515 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4508 -0.0998 -0.2970 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5790 0.7158 -0.8864 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1127 0.5523 -0.5768 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.8395 0.6332 -2.0458 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9845 -0.2371 0.1011 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7221 0.4826 -0.2341 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5156 -0.2044 0.3766 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7240 -1.2827 1.0676 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2451 0.4467 0.1112 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.2081 1.8854 0.6705 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2635 2.1969 0.8379 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9517 1.0281 0.2634 C 0 0 1 0 0 0 0 0 0 0 0 0 2.3406 0.7807 0.7264 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1751 1.9984 0.4738 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5939 1.6683 0.9523 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1051 0.5881 0.0251 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5668 0.3015 0.2564 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0568 -0.5709 -0.8542 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9577 -0.9790 -1.7890 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7521 -1.5438 -1.0917 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2898 -0.6631 0.0639 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5251 -1.4649 1.3301 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8407 -0.4059 -0.1104 C 0 0 1 0 0 0 0 0 0 0 0 0 1.9853 -1.5783 0.3299 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5377 -1.3235 -0.0210 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0032 -0.1260 0.6737 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0895 -0.2158 2.1623 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6544 -1.7554 -0.3822 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2018 -2.2219 -0.0597 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7486 -1.5591 -1.6786 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4564 -1.7870 -1.2561 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6367 -0.1809 0.7931 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1684 0.0757 -1.5591 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2788 1.0689 -0.0947 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2055 1.6364 -1.3816 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1575 1.5787 -0.1597 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7855 0.5330 -2.6287 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2794 1.5504 -2.3138 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1974 -0.2257 -2.3981 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0226 -1.2658 -0.3093 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1319 -0.2255 1.2021 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5518 0.4866 -1.3383 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7963 1.5266 0.0878 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7214 -1.6798 1.2051 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9314 -1.8323 1.5293 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0880 0.5164 -1.0189 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6979 1.9136 1.6523 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6177 2.5862 -0.0605 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5241 2.3016 1.9070 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5584 3.0933 0.2459 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9434 0.9984 -0.8474 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4664 0.4867 1.7657 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7444 2.8433 1.0097 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2565 2.1529 -0.6224 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5907 1.3313 2.0031 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2186 2.5654 0.7759 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0250 1.0047 -1.0091 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7689 -0.1277 1.2569 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0895 1.2957 0.2494 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8112 -0.0128 -1.4444 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6935 -0.1790 -2.5299 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3716 -1.8126 -2.4228 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9875 -2.5701 -0.7720 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9503 -1.6397 -1.8718 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9429 -2.4192 1.2030 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1087 -0.9593 2.2008 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5796 -1.7810 1.4326 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5809 -0.1591 -1.1603 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0557 -1.6826 1.4413 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2969 -2.5313 -0.1127 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0272 -2.2309 0.2151 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4882 -1.0989 -1.1274 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1024 -1.2374 2.5436 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6515 0.4372 2.6812 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0718 0.1089 2.5574 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3256 -2.0162 -1.0628 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 4 6 1 0 6 7 1 0 7 8 1 0 8 9 2 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 1 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 1 19 29 1 0 27 10 1 0 27 13 1 0 24 14 1 0 22 17 1 0 1 30 1 0 1 31 1 0 1 32 1 0 2 33 1 0 3 34 1 0 3 35 1 0 3 36 1 0 4 37 1 1 5 38 1 0 5 39 1 0 5 40 1 0 6 41 1 0 6 42 1 0 7 43 1 0 7 44 1 0 9 45 1 0 9 46 1 0 10 47 1 6 11 48 1 0 11 49 1 0 12 50 1 0 12 51 1 0 13 52 1 6 14 53 1 1 15 54 1 0 15 55 1 0 16 56 1 0 16 57 1 0 17 58 1 6 18 59 1 0 18 60 1 0 19 61 1 6 20 62 1 0 20 63 1 0 21 64 1 0 21 65 1 0 23 66 1 0 23 67 1 0 23 68 1 0 24 69 1 6 25 70 1 0 25 71 1 0 26 72 1 0 26 73 1 0 28 74 1 0 28 75 1 0 28 76 1 0 29 77 1 0 M END

Standard InCHIKey	KMZZTLKNPDAWBH-AJKJBRKTSA-N
Standard InCHI	InChI=1S/C28H48O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h18-19,21-26,29H,4,7-17H2,1-3,5-6H3/t19-,21+,22+,23+,24-,25+,26+,27+,28-/m1/s1
SMILES	CC(C)[C@H](C)CCC(=C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	400.37	Volume:	464.772 ? Van der Waals volume.
Dense:	0.861	LogP:	7.355 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	5.117 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-7.224 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	5.0	Rigid Bonds:	21.0
TPSA:	20.23 ? Topological Polar Surface Area.	H-Bond Acceptor:	1.0
H-Bond Donor:	1.0	Rings:	4.0
Heavy Atoms:	1.0

MedChem Properties

QED Drug-Likeness Score:	0.47	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.478	Fsp³:	0.929
MCE-18:	71.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.749	Fluc inhibitor:	0.006 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.013 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.757	Promiscuous compounds:	0.195

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.15	MDCK Permeability:	-4.913
Pgp-inhibitor:	0.031	Pgp-substrate:	0.013
PAMPA:	0.035 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.004	30% Bioavailability (F30%):	0.018
50% Bioavailability (F50%):	0.937

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.953	MRP1:	0.03
Plasma Protein Binding (PPB):	93.266%	Volume Distribution (VD):	-0.015
Fu:	6.624% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.998	BCRP inhibitor:	0.913
BSEP inhibitor:	0.237

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.215
CYP2C19-inhibitor:	0.835	CYP2C19-substrate:	0.645
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.99
CYP2D6-inhibitor:	0.317	CYP2D6-substrate:	0.612
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.996
HLM stability:	0.994 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

15.215

Half-life (T1/2):

1.126

ADMET: Toxicity

hERG Blockers:	0.271	hERG Blockers (10um):	0.362
Human Hepatotoxicity (H-HT):	0.639	Drug-induced Liver Injury (DILI):	0.134
AMES Toxicity:	0.066	Rat Oral Acute Toxicity:	0.031
Maximum Recommended Daily Dose:	0.847	Skin Sensitization:	0.994
Carcinogencity:	0.959	Eye Corrosion:	0.911
Eye Irritation:	0.999	Respiratory Toxicity:	0.965
Drug-induced Neurotoxicity:	0.016	Ototoxicity:	0.397
Hematotoxicity:	0.557	Drug-induced Nephrotoxicity:	0.699
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.029
A549 Cytotoxicity:	0.16	Hek293 Cytotoxicity:	0.687
BCF:	3.176 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	5.048 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.55 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.839 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO6414	Eupatorium cannabinum	Species	Asteraceae	Eukaryota	n.a.	aerial part	n.a.	PMID[21391659]
NPO6414	Eupatorium cannabinum	Species	Asteraceae	Eukaryota	Aerial Parts	n.a.	n.a.	PMID[30653318]
NPO6414	Eupatorium cannabinum	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6414	Eupatorium cannabinum	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO6414	Eupatorium cannabinum	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO6414	Eupatorium cannabinum	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO6414	Eupatorium cannabinum	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC22469 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	26333
0.1-0.2	20575
0.2-0.3	2571
0.3-0.4	313
0.4-0.5	41
0.5-0.6	15
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.6471	Remote Similarity	NPC148174
0.6275	Remote Similarity	NPC71460
0.6275	Remote Similarity	NPC218585
0.6122	Remote Similarity	NPC114891
0.5893	Remote Similarity	NPC167702
0.5893	Remote Similarity	NPC280026
0.5769	Remote Similarity	NPC320549
0.5769	Remote Similarity	NPC156277
0.5769	Remote Similarity	NPC58057
0.5769	Remote Similarity	NPC151018
0.569	Remote Similarity	NPC477819
0.5455	Remote Similarity	NPC254340
0.5385	Remote Similarity	NPC281540
0.5385	Remote Similarity	NPC159654
0.5385	Remote Similarity	NPC167995
0.5385	Remote Similarity	NPC118937
0.5345	Remote Similarity	NPC192456
0.5283	Remote Similarity	NPC111234
0.5079	Remote Similarity	NPC323180

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC22469 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7893
0.1-0.2	1118
0.2-0.3	96
0.3-0.4	31
0.4-0.5	7
0.5-0.6	3
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5893	Remote Similarity	NPD6113	Clinical (unspecified phase)
0.5769	Remote Similarity	NPD4808	Phase 2
0.5769	Remote Similarity	NPD4809	Phase 4

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data