NPASS Compound

Natural Product: NPC209092

Natural Product ID	NPC209092
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	MPELAWXSOZTBPF-ASNPJKIBSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	101093178
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 72 74 0 0 0 0 0 0 0 0999 V2000 -0.7487 -2.2853 -3.1133 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4849 -1.1392 -2.2194 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0621 -1.1715 -0.8532 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5984 -2.3425 -0.0159 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8484 -2.6162 -0.0215 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6819 -1.4741 0.4913 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1552 -0.4344 0.9338 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0539 -1.5716 0.4747 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8573 -0.5232 0.9410 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6613 0.7380 0.1351 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5682 1.7599 0.7225 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1051 2.5639 1.7280 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9252 3.5298 2.3012 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2168 3.6715 1.8451 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7055 2.8764 0.8367 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8599 1.9126 0.2773 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0057 3.0443 0.4025 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0104 4.6516 2.4445 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3585 -3.5741 -0.3270 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7057 -3.3996 -0.3259 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1206 -2.1126 -0.0410 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5687 -1.0267 -0.8145 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9016 0.0983 -0.0938 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7254 0.9842 -0.7337 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9777 1.3369 -0.0060 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.7288 1.8212 1.4011 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2894 2.2574 1.4896 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9404 2.9612 0.2095 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6075 3.6620 0.3584 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3113 4.4806 -0.7042 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9997 2.1640 -0.9086 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2317 3.2177 2.5242 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9448 0.7969 2.3225 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5760 2.4070 -0.7015 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8087 -4.8789 -0.6301 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4235 -5.0502 -0.6417 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6456 -5.9707 -0.9154 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0097 -7.2011 -1.1985 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6283 -2.8886 -2.9377 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7759 -1.9780 -4.1882 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1454 -2.9756 -3.0548 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8914 -0.2153 -2.7297 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6088 -0.9064 -2.1038 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6657 -0.2448 -0.3406 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8620 -2.1399 1.0766 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3029 -2.9278 -0.9548 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0643 -3.4296 0.7456 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9415 -0.7840 0.8340 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6669 -0.2912 2.0195 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6333 1.1199 0.1461 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9806 0.5029 -0.9210 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0933 2.4845 2.1162 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5494 4.1640 3.0990 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2138 1.2742 -0.5143 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3642 2.3635 -0.2670 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8229 4.9690 1.9198 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3259 -4.2455 -0.5384 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0028 -1.0707 -1.8141 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0038 0.6455 -1.7593 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7282 0.5426 0.0430 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3581 2.7060 1.6320 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5933 1.4689 1.7719 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6984 3.7800 0.0727 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7790 2.9597 0.5310 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6857 4.3017 1.2741 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5279 4.1226 -1.1958 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8469 2.8846 3.2362 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3961 0.0230 2.0685 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7666 2.1003 -1.6368 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4889 -7.5675 -0.2884 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7883 -7.8972 -1.5634 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3067 -7.0148 -2.0431 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 2 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 2 0 15 17 1 0 14 18 1 0 4 19 1 0 19 20 2 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 27 32 1 0 26 33 1 0 25 34 1 0 19 35 1 0 35 36 2 0 35 37 1 0 37 38 1 0 22 3 1 0 31 24 1 0 16 11 1 0 1 39 1 0 1 40 1 0 1 41 1 0 2 42 1 0 2 43 1 0 3 44 1 1 4 45 1 1 5 46 1 0 5 47 1 0 9 48 1 0 9 49 1 0 10 50 1 0 10 51 1 0 12 52 1 0 13 53 1 0 16 54 1 0 17 55 1 0 18 56 1 0 20 57 1 0 22 58 1 6 24 59 1 6 25 60 1 1 26 61 1 1 27 62 1 1 28 63 1 6 29 64 1 0 29 65 1 0 30 66 1 0 32 67 1 0 33 68 1 0 34 69 1 0 38 70 1 0 38 71 1 0 38 72 1 0 M END

Standard InCHIKey	MPELAWXSOZTBPF-ASNPJKIBSA-N
Standard InCHI	InChI=1S/C25H34O13/c1-3-13-14(9-19(29)35-7-6-12-4-5-16(27)17(28)8-12)15(23(33)34-2)11-36-24(13)38-25-22(32)21(31)20(30)18(10-26)37-25/h4-5,8,11,13-14,18,20-22,24-28,30-32H,3,6-7,9-10H2,1-2H3/t13-,14+,18-,20-,21+,22-,24+,25+/m1/s1
SMILES	CC[C@@H]1[C@H](CC(=O)OCCc2ccc(c(c2)O)O)C(=CO[C@H]1O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)C(=O)OC

Calculated Properties

Physi-Chem Properties

Molecular Weight:	542.2	Volume:	513.741 ? Van der Waals volume.
Dense:	1.055	LogP:	0.771 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.293 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.038 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	20.0
TPSA:	201.67 ? Topological Polar Surface Area.	H-Bond Acceptor:	13.0
H-Bond Donor:	6.0	Rings:	3.0
Heavy Atoms:	13.0

MedChem Properties

QED Drug-Likeness Score:	0.162	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.653	Fsp³:	0.6
MCE-18:	78.2 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	1	PAINS Alert:	1
Colloidal aggregators:	0.521	Fluc inhibitor:	0.04 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.07 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.159 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.096	Promiscuous compounds:	0.195

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.945	MDCK Permeability:	-5.259
Pgp-inhibitor:	0.0	Pgp-substrate:	0.144
PAMPA:	0.973 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.58
20% Bioavailability (F20%):	0.896	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.683
Plasma Protein Binding (PPB):	57.879%	Volume Distribution (VD):	-0.429
Fu:	37.664% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.248
BSEP inhibitor:	0.009

ADMET: Metabolism

CYP1A2-inhibitor:	0.005	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.013
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	1.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.002
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	1.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.836

Half-life (T1/2):

2.071

ADMET: Toxicity

hERG Blockers:	0.026	hERG Blockers (10um):	0.231
Human Hepatotoxicity (H-HT):	0.591	Drug-induced Liver Injury (DILI):	0.796
AMES Toxicity:	0.852	Rat Oral Acute Toxicity:	0.033
Maximum Recommended Daily Dose:	0.064	Skin Sensitization:	1.0
Carcinogencity:	0.189	Eye Corrosion:	0.0
Eye Irritation:	0.118	Respiratory Toxicity:	0.006
Drug-induced Neurotoxicity:	0.015	Ototoxicity:	0.984
Hematotoxicity:	0.265	Drug-induced Nephrotoxicity:	0.622
Genotoxicity:	0.72	RPMI-8226 Immunitoxicity:	0.021
A549 Cytotoxicity:	0.285	Hek293 Cytotoxicity:	0.088
BCF:	0.549 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.293 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.106 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.227 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO18340	Ligustrum lucidum	Species	Oleaceae	Eukaryota	n.a.	fruit	n.a.	PMID[11411539]
NPO18340	Ligustrum lucidum	Species	Oleaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO18340	Ligustrum lucidum	Species	Oleaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO18340	Ligustrum lucidum	Species	Oleaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO18340	Ligustrum lucidum	Species	Oleaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO18340	Ligustrum lucidum	Species	Oleaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO18340	Ligustrum lucidum	Species	Oleaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC209092 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7560
0.1-0.2	36995
0.2-0.3	4607
0.3-0.4	537
0.4-0.5	120
0.5-0.6	35
0.6-0.7	3
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7407	Intermediate Similarity	NPC296643
0.7407	Intermediate Similarity	NPC299576
0.6818	Remote Similarity	NPC23677
0.6484	Remote Similarity	NPC198577
0.6471	Remote Similarity	NPC169398
0.5914	Remote Similarity	NPC469364
0.5914	Remote Similarity	NPC609284
0.5743	Remote Similarity	NPC488389
0.5684	Remote Similarity	NPC65262
0.5684	Remote Similarity	NPC84429
0.5684	Remote Similarity	NPC101686
0.5604	Remote Similarity	NPC600692
0.5541	Remote Similarity	NPC266045
0.5513	Remote Similarity	NPC117596
0.5417	Remote Similarity	NPC212808
0.5385	Remote Similarity	NPC46641
0.5319	Remote Similarity	NPC202391
0.5319	Remote Similarity	NPC296659
0.525	Remote Similarity	NPC35185
0.525	Remote Similarity	NPC307699
0.525	Remote Similarity	NPC4899
0.525	Remote Similarity	NPC177013
0.5208	Remote Similarity	NPC488383
0.5143	Remote Similarity	NPC488387
0.5125	Remote Similarity	NPC474730
0.5122	Remote Similarity	NPC27687
0.5122	Remote Similarity	NPC37240
0.5119	Remote Similarity	NPC488472
0.5119	Remote Similarity	NPC257424
0.5094	Remote Similarity	NPC488386
0.5062	Remote Similarity	NPC255677
0.5062	Remote Similarity	NPC22149
0.5062	Remote Similarity	NPC306344
0.506	Remote Similarity	NPC231710
0.506	Remote Similarity	NPC470573
0.506	Remote Similarity	NPC120021
0.506	Remote Similarity	NPC216826
0.506	Remote Similarity	NPC270908
0.506	Remote Similarity	NPC65665
0.5053	Remote Similarity	NPC475484

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC209092 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3346
0.1-0.2	5668
0.2-0.3	134
0.3-0.4	1
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data