NPASS Compound

Natural Product: NPC18630

Natural Product ID	NPC18630
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	JKJNEIZIUZSCIE-NXMCMFMLSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	23304469
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0000011] Carbohydrates and carbohydrate conjugates [CHEMONTID:0000198] Oligosaccharides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 108112 0 0 0 0 0 0 0 0999 V2000 -11.0998 1.9228 -0.1081 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0454 1.1105 0.5810 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.8925 1.6571 1.9889 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8996 0.7753 2.7132 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.6458 0.6036 1.9176 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9311 0.2691 0.4763 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7537 0.2121 -0.2469 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5221 -1.0502 -0.7808 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2188 -1.0675 -1.5697 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0083 -2.4583 -2.1558 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8335 -2.4086 -3.1268 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0406 -1.1644 -2.9381 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.9620 -0.6803 -1.4892 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.9964 -1.3200 -0.8083 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9015 -0.8105 -0.2821 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8384 0.1302 0.8323 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5350 1.4216 0.8660 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8808 2.4665 0.0337 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4637 2.0957 -0.5273 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2202 1.1239 0.3022 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9373 0.2438 -0.5035 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2857 0.3617 -0.2863 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0515 -0.6086 -1.1667 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4895 -2.0047 -1.0886 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8092 -2.5740 0.2506 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0805 -2.0810 0.8443 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9818 -1.3684 -0.1017 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9075 -0.6422 0.6478 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2081 -1.0887 0.4654 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1663 -0.2737 1.2922 C 0 0 2 0 0 0 0 0 0 0 0 0 8.9749 1.1857 0.9585 C 0 0 2 0 0 0 0 0 0 0 0 0 10.2304 1.9915 1.2186 C 0 0 1 0 0 0 0 0 0 0 0 0 11.4497 1.3984 0.5948 C 0 0 2 0 0 0 0 0 0 0 0 0 11.1654 -0.0044 0.1683 C 0 0 2 0 0 0 0 0 0 0 0 0 10.5925 -0.1004 -1.0991 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4767 -0.6885 1.1368 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4963 1.3840 1.5155 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0105 3.2627 0.6600 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9810 1.6841 1.7999 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3980 -0.5339 -0.9914 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7837 -3.2085 1.3212 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7484 -2.2667 1.1283 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1201 -1.9243 -1.3345 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5013 0.4121 1.2055 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2139 3.2989 -0.5688 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7151 2.8211 -1.0172 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9053 1.4342 0.8350 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1394 -0.7568 -0.8029 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5064 -0.1428 -3.7355 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0340 -3.5300 -3.0406 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6304 -3.2898 -1.1078 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7989 1.2408 -0.0233 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8860 -0.4096 2.5302 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5440 -0.4220 3.0132 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4625 2.9725 1.9526 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2861 1.5690 -1.4416 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.0577 1.7813 0.4188 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7880 2.9825 -0.0516 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3871 0.0748 0.6321 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8697 1.6235 2.4779 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6109 1.3225 3.6492 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0515 1.5378 2.0111 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4122 -0.7434 0.4516 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5346 -1.8353 -0.0223 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3329 -1.2754 -1.5028 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3565 -0.3687 -2.4247 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9335 -2.8307 -2.5928 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2857 -2.3863 -4.1424 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9792 -1.4238 -3.2421 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7169 0.4269 -1.5666 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2783 -1.7339 0.0803 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1745 -0.4410 -1.1006 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2076 -0.4473 1.7577 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3255 1.7970 1.9643 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7944 3.4278 0.6441 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4139 1.7773 -1.5834 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0020 1.6881 0.9094 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4805 0.2097 0.7941 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6608 1.3873 -0.5314 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8432 -0.2634 -2.2237 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9584 -2.5863 -1.9079 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7658 -3.6993 0.1479 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9234 -1.4404 1.7567 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5859 -2.1424 -0.6619 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3194 -2.1718 0.6728 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4650 -0.9431 -0.6181 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9146 -0.4081 2.3634 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6150 1.3267 -0.0678 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3892 2.1709 2.3028 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7770 2.0095 -0.2856 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1652 -0.5207 0.0739 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4381 0.7679 -1.5121 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2588 0.7461 2.2303 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8242 3.6280 0.2482 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8735 1.0999 2.6123 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1752 -3.7290 0.5709 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9228 -2.6005 2.0382 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6303 -2.7600 -1.1367 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6161 3.4417 0.3380 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8893 3.7860 -1.0997 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2292 0.7337 1.4705 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3874 0.7639 -3.3324 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3561 -4.2037 -3.6700 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4033 -3.4526 -0.5105 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9301 -0.2237 2.3510 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1066 -0.3065 3.8272 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9614 3.1925 1.1349 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4884 1.0639 -1.7273 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 34 36 1 0 33 37 1 0 32 38 1 0 31 39 1 0 27 40 1 0 26 41 1 0 25 42 1 0 24 43 1 0 20 44 1 0 19 45 1 0 18 46 1 0 17 47 1 0 13 48 1 0 12 49 1 0 11 50 1 0 10 51 1 0 6 52 1 0 5 53 1 0 4 54 1 0 3 55 1 0 1 56 1 0 52 2 1 0 48 9 1 0 44 16 1 0 40 23 1 0 36 30 1 0 1 57 1 0 1 58 1 0 2 59 1 1 3 60 1 1 4 61 1 1 5 62 1 6 6 63 1 1 8 64 1 0 8 65 1 0 9 66 1 6 10 67 1 6 11 68 1 6 12 69 1 6 13 70 1 6 15 71 1 0 15 72 1 0 16 73 1 1 17 74 1 1 18 75 1 1 19 76 1 6 20 77 1 1 22 78 1 0 22 79 1 0 23 80 1 6 24 81 1 6 25 82 1 6 26 83 1 1 27 84 1 6 29 85 1 0 29 86 1 0 30 87 1 1 31 88 1 6 32 89 1 1 33 90 1 6 34 91 1 6 35 92 1 0 37 93 1 0 38 94 1 0 39 95 1 0 41 96 1 0 42 97 1 0 43 98 1 0 45 99 1 0 46100 1 0 47101 1 0 49102 1 0 50103 1 0 51104 1 0 53105 1 0 54106 1 0 55107 1 0 56108 1 0 M END

Standard InCHIKey	JKJNEIZIUZSCIE-NXMCMFMLSA-N
Standard InCHI	InChI=1S/C30H52O26/c31-1-6-11(32)17(38)22(43)27(53-6)49-3-8-13(34)19(40)24(45)29(55-8)51-5-10-15(36)20(41)25(46)30(56-10)50-4-9-14(35)18(39)23(44)28(54-9)48-2-7-12(33)16(37)21(42)26(47)52-7/h6-47H,1-5H2/t6-,7-,8-,9-,10-,11+,12-,13+,14+,15+,16+,17-,18+,19+,20+,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-/m1/s1
SMILES	C([C@@H]1[C@@H]([C@H]([C@H]([C@H](OC[C@@H]2[C@@H]([C@@H]([C@H]([C@H](OC[C@@H]3[C@@H]([C@@H]([C@H]([C@H](OC[C@@H]4[C@@H]([C@@H]([C@H]([C@H](OC[C@@H]5[C@H]([C@@H]([C@H]([C@H](O)O5)O)O)O)O4)O)O)O)O3)O)O)O)O2)O)O)O)O1)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	828.27	Volume:	713.2 ? Van der Waals volume.
Dense:	1.161	LogP:	-5.064 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	-3.628 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	0.407 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	30.0
TPSA:	426.98 ? Topological Polar Surface Area.	H-Bond Acceptor:	26.0
H-Bond Donor:	17.0	Rings:	5.0
Heavy Atoms:	26.0

MedChem Properties

QED Drug-Likeness Score:	0.082	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.412	Fsp³:	1.0
MCE-18:	113.333 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.334	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.015 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.704	Promiscuous compounds:	0.014

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.509	MDCK Permeability:	-4.712
Pgp-inhibitor:	0.0	Pgp-substrate:	0.999
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	0.901	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.0
Plasma Protein Binding (PPB):	5.381%	Volume Distribution (VD):	-0.52
Fu:	76.251% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.958
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-1.271

Half-life (T1/2):

5.413

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.058
Human Hepatotoxicity (H-HT):	0.123	Drug-induced Liver Injury (DILI):	0.059
AMES Toxicity:	0.602	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	0.986
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.011	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.022	Drug-induced Nephrotoxicity:	0.988
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.255
A549 Cytotoxicity:	0.002	Hek293 Cytotoxicity:	0.003
BCF:	-0.025 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	1.311 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	2.862 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	2.143 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	aerial parts	n.a.	n.a.	PMID[10869197]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[1812212]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[33780581]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[36270431]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[38257257]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[38893531]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[39104562]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	leaves	n.a.	n.a.	PMID[9834145]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC18630 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	33257
0.1-0.2	12798
0.2-0.3	3065
0.3-0.4	624
0.4-0.5	83
0.5-0.6	21
0.6-0.7	3
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	4
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9487	High Similarity	NPC89145
0.9487	High Similarity	NPC157514
0.9487	High Similarity	NPC322314
0.9487	High Similarity	NPC269166
0.6977	Remote Similarity	NPC145112
0.641	Remote Similarity	NPC323574
0.6122	Remote Similarity	NPC147292
0.5882	Remote Similarity	NPC34877
0.566	Remote Similarity	NPC12040
0.5556	Remote Similarity	NPC285003
0.5476	Remote Similarity	NPC124963
0.5439	Remote Similarity	NPC57751
0.5349	Remote Similarity	NPC326533
0.5263	Remote Similarity	NPC143446
0.5254	Remote Similarity	NPC208769
0.5238	Remote Similarity	NPC14144
0.5208	Remote Similarity	NPC246558
0.5208	Remote Similarity	NPC303727
0.5208	Remote Similarity	NPC67660
0.5208	Remote Similarity	NPC165198
0.5208	Remote Similarity	NPC209753
0.5208	Remote Similarity	NPC58629
0.5172	Remote Similarity	NPC266389
0.5172	Remote Similarity	NPC122245
0.5172	Remote Similarity	NPC216605
0.5098	Remote Similarity	NPC219040
0.5085	Remote Similarity	NPC189589
0.5082	Remote Similarity	NPC278506

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC18630 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7983
0.1-0.2	1054
0.2-0.3	81
0.3-0.4	16
0.4-0.5	9
0.5-0.6	5
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6038	Remote Similarity	NPD6123	Approved
0.6	Remote Similarity	NPD3181	Phase 3
0.5208	Remote Similarity	NPD888	Phase 3
0.5208	Remote Similarity	NPD890	Clinical (unspecified phase)
0.5208	Remote Similarity	NPD891	Phase 3
0.5208	Remote Similarity	NPD892	Phase 3
0.5208	Remote Similarity	NPD893	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data