NPASS Compound

Natural Product: NPC172867

Natural Product ID	NPC172867
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Argutin E
IUPAC Name	[(1S,3R,5R,6aS,7S,8S,9S,10aS)-1,3-diacetyloxy-9-hydroxy-7,8-dimethyl-7-[(2E)-3-methylpenta-2,4-dienyl]-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] (2Z,4E)-deca-2,4-dienoate
Synonyms	Argutin E
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1651116
PubChem CID	50907132
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001551] Diterpenoids [CHEMONTID:0001757] Colensane and clerodane diterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 90 92 0 0 0 0 0 0 0 0999 V2000 10.0407 0.7546 1.2176 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1329 1.0068 0.0331 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9141 0.0989 0.0736 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3192 -1.3572 0.0442 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0665 -2.2128 0.0833 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1913 -1.9208 -1.0889 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9486 -1.4736 -0.8549 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1022 -1.1904 -1.9912 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8707 -0.7513 -1.9123 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2073 -0.4968 -0.6591 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6825 -0.6521 0.4777 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8767 -0.0198 -0.6583 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1917 0.2385 0.5534 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0032 1.7149 0.6569 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1670 2.2679 0.6188 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6496 3.7026 0.6952 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6975 4.5929 0.1690 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1445 5.6122 0.9384 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5486 5.6852 2.1265 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8620 6.5697 0.4175 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7730 3.7493 -0.0929 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0194 2.4494 -0.6196 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4784 1.5192 0.4528 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.3169 0.1134 0.1110 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0487 -0.5586 0.5679 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4340 -0.8056 0.5649 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.1521 -1.4711 1.9085 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5158 -1.9246 -0.4470 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5219 -2.9446 -0.2016 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2444 -4.2592 -0.1169 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3142 -5.2130 0.1338 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1354 -6.4837 0.2300 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8521 -4.6652 -0.3047 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7575 -0.1177 0.7621 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6690 1.1110 1.5885 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3298 1.7857 1.6722 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0932 0.9141 2.9224 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5847 0.0386 -0.4846 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3439 2.2818 -1.8449 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0239 2.1414 -3.0453 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2805 2.1682 -3.0122 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3422 1.9630 -4.3537 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7080 1.6180 1.3909 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4786 0.5283 2.1315 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6925 -0.1051 0.9628 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6762 0.9013 -0.9145 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7653 2.0474 0.0915 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3111 0.2836 0.9848 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3197 0.3342 -0.8326 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9052 -1.6119 0.9468 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8999 -1.5432 -0.8757 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5058 -2.0919 1.0079 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3982 -3.2694 -0.0112 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5243 -2.0571 -2.0989 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6245 -1.3409 0.1638 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5461 -1.3640 -2.9954 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3694 -0.5872 -2.8749 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8719 -0.0057 1.4217 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8794 2.3435 0.7694 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8281 3.9794 1.7494 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7614 7.5742 0.8764 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6820 6.6922 -0.6693 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8866 6.1846 0.5270 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1176 2.4537 -0.7073 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3198 0.0428 -1.0085 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1272 -0.9736 1.6183 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8786 -1.4652 -0.0527 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5148 -2.3677 1.8314 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1329 -1.8883 2.3114 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8015 -0.8084 2.6870 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7046 -1.5124 -1.4858 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5432 -2.4477 -0.5595 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5632 -2.6994 -0.0701 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3373 -4.8235 0.2477 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0129 -7.1286 0.4221 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2001 -6.9801 0.1401 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2603 -4.3435 0.5632 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7452 -5.7685 -0.3412 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4191 -4.3173 -1.2719 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3677 -0.8480 1.3908 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4354 1.8323 1.1728 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5245 2.8808 1.6989 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7923 1.5842 2.6260 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0841 0.8920 2.9758 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0230 1.0851 -0.4140 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4952 -0.5904 -0.5245 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0025 0.0493 -1.4202 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3690 0.8554 -4.5589 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8815 2.5173 -5.1237 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2895 2.2975 -4.2048 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 2 0 9 10 1 0 10 11 2 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 18 20 1 0 16 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 26 27 1 1 26 28 1 0 28 29 1 0 29 30 2 0 30 31 1 0 31 32 2 0 30 33 1 0 26 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 34 38 1 0 22 39 1 0 39 40 1 0 40 41 2 0 40 42 1 0 25 13 1 0 23 15 1 0 23 36 1 1 1 43 1 0 1 44 1 0 1 45 1 0 2 46 1 0 2 47 1 0 3 48 1 0 3 49 1 0 4 50 1 0 4 51 1 0 5 52 1 0 5 53 1 0 6 54 1 0 7 55 1 0 8 56 1 0 9 57 1 0 13 58 1 1 14 59 1 0 16 60 1 1 20 61 1 0 20 62 1 0 20 63 1 0 22 64 1 6 24 65 1 6 25 66 1 0 25 67 1 0 27 68 1 0 27 69 1 0 27 70 1 0 28 71 1 0 28 72 1 0 29 73 1 0 31 74 1 0 32 75 1 0 32 76 1 0 33 77 1 0 33 78 1 0 33 79 1 0 34 80 1 1 35 81 1 6 36 82 1 0 36 83 1 0 37 84 1 0 38 85 1 0 38 86 1 0 38 87 1 0 42 88 1 0 42 89 1 0 42 90 1 0 M END

Standard InCHIKey	MIQKKZISSIYZBF-MXHFUZJLSA-N
Standard InCHI	InChI=1S/C34H48O8/c1-8-10-11-12-13-14-15-16-30(38)41-26-19-27-31(39-24(5)35)42-32(40-25(6)36)34(27)21-28(37)23(4)33(7,29(34)20-26)18-17-22(3)9-2/h9,13-17,19,23,26,28-29,31-32,37H,2,8,10-12,18,20-21H2,1,3-7H3/b14-13+,16-15-,22-17+/t23-,26+,28+,29+,31+,32-,33-,34-/m1/s1
SMILES	CCCCC/C=C/C=CC(=O)O[C@H]1C=C2[C@@H](OC(=O)C)O[C@H]([C@]32[C@@H](C1)[C@](C)(C/C=C(/C=C)C)[C@@H]([C@H](C3)O)C)OC(=O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	584.33	Volume:	620.181 ? Van der Waals volume.
Dense:	0.942	LogP:	4.896 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.154 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.015 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	22.0
TPSA:	108.36 ? Topological Polar Surface Area.	H-Bond Acceptor:	8.0
H-Bond Donor:	1.0	Rings:	3.0
Heavy Atoms:	8.0

MedChem Properties

QED Drug-Likeness Score:	0.072	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.928	Fsp³:	0.618
MCE-18:	87.455 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.892	Fluc inhibitor:	0.035 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.019 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.01 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.454	Promiscuous compounds:	0.411

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.092	MDCK Permeability:	-4.755
Pgp-inhibitor:	0.802	Pgp-substrate:	0.602
PAMPA:	0.204 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.013
20% Bioavailability (F20%):	0.989	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.831
Plasma Protein Binding (PPB):	97.922%	Volume Distribution (VD):	-0.443
Fu:	2.376% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.994	BCRP inhibitor:	0.128
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.797
CYP2C19-inhibitor:	0.011	CYP2C19-substrate:	0.309
CYP2C9-inhibitor:	0.01	CYP2C9-substrate:	0.057
CYP2D6-inhibitor:	0.001	CYP2D6-substrate:	0.04
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.999
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.982 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

6.767

Half-life (T1/2):

0.925

ADMET: Toxicity

hERG Blockers:	0.197	hERG Blockers (10um):	0.511
Human Hepatotoxicity (H-HT):	0.641	Drug-induced Liver Injury (DILI):	0.736
AMES Toxicity:	0.942	Rat Oral Acute Toxicity:	0.726
Maximum Recommended Daily Dose:	0.992	Skin Sensitization:	0.998
Carcinogencity:	0.283	Eye Corrosion:	0.0
Eye Irritation:	0.018	Respiratory Toxicity:	0.796
Drug-induced Neurotoxicity:	0.518	Ototoxicity:	0.638
Hematotoxicity:	0.252	Drug-induced Nephrotoxicity:	0.915
Genotoxicity:	0.558	RPMI-8226 Immunitoxicity:	0.294
A549 Cytotoxicity:	0.761	Hek293 Cytotoxicity:	0.667
BCF:	1.08 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.354 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.13 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.546 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO22840	Casearia arguta	Species	Salicaceae	Eukaryota	n.a.	leaf	n.a.	PMID[21067210]
NPO22840	Casearia arguta	Species	Salicaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21067210]
NPO22840	Casearia arguta	Species	Salicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
EC50	2
Ratio EC50	1

Activity Type	# Activity
Cell line	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT369	Cell line	ACHN	Homo sapiens	EC50	=	2200.0	nM	PMID[21067210]
NPT369	Cell line	ACHN	Homo sapiens	EC50	=	3300.0	nM	PMID[21067210]
NPT369	Cell line	ACHN	Homo sapiens	Ratio EC50	=	1.5	n.a.	PMID[21067210]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC172867 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20129
0.1-0.2	26330
0.2-0.3	3247
0.3-0.4	80
0.4-0.5	53
0.5-0.6	15
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7564	Intermediate Similarity	NPC316708
0.7125	Intermediate Similarity	NPC109376
0.631	Remote Similarity	NPC470025
0.619	Remote Similarity	NPC470024
0.5909	Remote Similarity	NPC224660
0.5909	Remote Similarity	NPC470026
0.5625	Remote Similarity	NPC311166
0.5443	Remote Similarity	NPC88507
0.5393	Remote Similarity	NPC488217
0.5393	Remote Similarity	NPC488218
0.5281	Remote Similarity	NPC317460
0.5244	Remote Similarity	NPC311223
0.5238	Remote Similarity	NPC488964
0.5238	Remote Similarity	NPC184512
0.5222	Remote Similarity	NPC328074
0.5176	Remote Similarity	NPC119550
0.5062	Remote Similarity	NPC602188
0.506	Remote Similarity	NPC201880
0.5055	Remote Similarity	NPC17791

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC172867 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7256
0.1-0.2	1862
0.2-0.3	32
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data