NPASS Compound

Natural Product: NPC156842

Natural Product ID	NPC156842
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	GEZHEQNLKAOMCA-LPYMAVHISA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	5380091
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000002] Organoheterocyclic compounds [CHEMONTID:0000123] Benzopyrans [CHEMONTID:0003410] 1-benzopyrans [CHEMONTID:0002817] Dibenzopyrans [CHEMONTID:0000200] Xanthenes [CHEMONTID:0000204] Xanthones [CHEMONTID:0003521] Pyranoxanthones

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 90 95 0 0 0 0 0 0 0 0999 V2000 8.0288 -4.0479 2.2510 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5555 -2.8207 1.5679 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5298 -2.8618 0.7466 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0454 -1.6391 0.0557 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6236 -1.3208 0.3923 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1865 -0.0548 -0.3249 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1054 1.1130 0.1260 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3360 -0.1297 -1.7659 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3710 0.0943 -2.6144 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0281 0.4497 -2.1874 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9808 0.6913 -3.0464 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2796 1.0266 -2.5540 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3982 1.2946 -3.4510 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2643 1.2242 -4.6956 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6942 1.6500 -2.9013 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7559 1.9242 -3.6530 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9125 2.4772 -2.8859 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3536 3.6544 -2.0738 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4078 3.1188 -1.0323 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1002 2.7551 0.2616 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3268 3.5733 0.5225 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1290 3.0357 1.4142 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3277 1.3893 0.2693 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1184 0.9320 -1.0259 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9360 -0.5291 -1.1495 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1327 -1.2478 -0.6504 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1191 -2.0979 0.3690 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8250 -2.3405 1.0473 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3115 -2.7777 0.8227 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4030 -2.5755 0.2532 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2593 -3.6529 1.8837 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2555 1.4489 -1.8304 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4019 1.0850 -1.6700 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8912 1.7262 -1.4402 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7542 1.4555 -0.6799 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4980 1.1216 -1.1941 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5765 0.8725 -0.3665 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3852 0.9666 1.1029 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3342 -0.2268 1.6258 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1671 -1.0419 2.5267 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6132 -2.2152 3.0006 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5193 -0.8419 3.1162 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8520 0.5347 -0.8145 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8892 0.2964 0.0589 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1877 0.5987 -4.4144 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2502 -1.5461 1.8174 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1313 -4.0685 2.3276 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5341 -4.1552 3.2491 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7324 -4.9729 1.6940 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0307 -3.7986 0.5706 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7474 -0.8195 0.2901 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1271 -1.7671 -1.0661 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4882 -1.1975 1.4853 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9767 -2.1394 0.0738 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3628 1.0274 1.1804 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4985 2.0398 0.0001 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9656 1.2099 -0.5595 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3039 -0.3804 -2.2185 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5048 0.0306 -3.7024 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7863 1.7638 -4.7222 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7634 2.7511 -3.5011 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8461 4.3784 -2.7630 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2259 4.1846 -1.6613 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5547 3.8042 -0.8449 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0194 4.6433 0.4824 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1941 3.3278 -0.0882 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6183 3.4069 1.5983 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1284 3.3298 1.0221 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4745 3.8566 2.0542 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9753 2.1532 2.0504 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0169 -0.8951 -0.6615 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8834 -0.7797 -2.2509 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1081 -1.1170 -1.1091 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9541 -3.0342 1.9276 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4931 -1.3783 1.5181 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0428 -2.7452 0.3741 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1119 -3.9885 2.3186 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3453 1.1488 1.6096 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2592 1.8507 1.3246 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3226 -0.4178 1.2304 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1962 -2.6337 3.9462 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6602 -3.0186 2.2160 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6705 -1.9548 3.2122 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6954 0.2344 3.3980 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6580 -1.4459 4.0353 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2525 -1.1911 2.3637 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7224 -0.1826 -4.7870 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0553 -1.6373 2.5760 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7506 -1.2479 0.8600 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6074 -0.7162 2.1369 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 2 0 9 10 1 0 10 11 1 0 11 12 2 0 12 13 1 0 13 14 2 0 13 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 20 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 27 28 1 0 27 29 1 0 29 30 2 0 29 31 1 0 24 32 1 0 32 33 2 0 24 34 1 0 34 35 1 0 35 36 1 0 36 37 2 0 37 38 1 0 38 39 1 0 39 40 2 3 40 41 1 0 40 42 1 0 37 43 1 0 43 44 1 0 11 45 1 0 2 46 1 0 44 6 1 0 43 10 2 0 36 12 1 0 34 15 1 0 32 17 1 0 34 19 1 0 1 47 1 0 1 48 1 0 1 49 1 0 3 50 1 0 4 51 1 0 4 52 1 0 5 53 1 0 5 54 1 0 7 55 1 0 7 56 1 0 7 57 1 0 8 58 1 0 9 59 1 0 16 60 1 0 17 61 1 0 18 62 1 0 18 63 1 0 19 64 1 0 21 65 1 0 21 66 1 0 21 67 1 0 22 68 1 0 22 69 1 0 22 70 1 0 25 71 1 0 25 72 1 0 26 73 1 0 28 74 1 0 28 75 1 0 28 76 1 0 31 77 1 0 38 78 1 0 38 79 1 0 39 80 1 0 41 81 1 0 41 82 1 0 41 83 1 0 42 84 1 0 42 85 1 0 42 86 1 0 45 87 1 0 46 88 1 0 46 89 1 0 46 90 1 0 M END

Standard InCHIKey	GEZHEQNLKAOMCA-LPYMAVHISA-N
Standard InCHI	InChI=1S/C38H44O8/c1-20(2)10-9-15-36(8)16-14-24-29(39)28-30(40)26-18-23-19-27-35(6,7)46-37(33(23)41,17-13-22(5)34(42)43)38(26,27)45-32(28)25(31(24)44-36)12-11-21(3)4/h10-11,13-14,16,18,23,27,39H,9,12,15,17,19H2,1-8H3,(H,42,43)/b22-13+
SMILES	CC(=CCCC1(C)C=Cc2c(c3C(=O)C4=CC5CC6C(C)(C)OC(C/C=C(C)/C(=O)O)(C5=O)C46Oc3c(CC=C(C)C)c2O1)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	628.3	Volume:	655.786 ? Van der Waals volume.
Dense:	0.958	LogP:	6.882 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.577 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.432 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	33.0
TPSA:	119.36 ? Topological Polar Surface Area.	H-Bond Acceptor:	8.0
H-Bond Donor:	2.0	Rings:	7.0
Heavy Atoms:	8.0

MedChem Properties

QED Drug-Likeness Score:	0.228	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.659	Fsp³:	0.5
MCE-18:	191.053 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.945	Fluc inhibitor:	0.173 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.68 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.963 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.128	Promiscuous compounds:	0.078

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.06	MDCK Permeability:	-4.699
Pgp-inhibitor:	0.584	Pgp-substrate:	0.0
PAMPA:	0.99 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.048
20% Bioavailability (F20%):	0.898	30% Bioavailability (F30%):	0.94
50% Bioavailability (F50%):	0.996

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.998
Plasma Protein Binding (PPB):	96.899%	Volume Distribution (VD):	0.029
Fu:	2.686% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.506	BCRP inhibitor:	0.009
BSEP inhibitor:	0.98

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.998
CYP2C19-inhibitor:	0.053	CYP2C19-substrate:	1.0
CYP2C9-inhibitor:	0.195	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.015
CYP3A4-inhibitor:	0.025	CYP3A4-substrate:	0.694
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	1.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.013

Half-life (T1/2):

1.295

ADMET: Toxicity

hERG Blockers:	0.149	hERG Blockers (10um):	0.266
Human Hepatotoxicity (H-HT):	0.897	Drug-induced Liver Injury (DILI):	0.695
AMES Toxicity:	0.4	Rat Oral Acute Toxicity:	0.908
Maximum Recommended Daily Dose:	0.842	Skin Sensitization:	0.769
Carcinogencity:	0.173	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.884
Drug-induced Neurotoxicity:	0.176	Ototoxicity:	0.971
Hematotoxicity:	0.425	Drug-induced Nephrotoxicity:	0.759
Genotoxicity:	0.998	RPMI-8226 Immunitoxicity:	0.122
A549 Cytotoxicity:	0.234	Hek293 Cytotoxicity:	0.504
BCF:	1.691 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	5.198 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	7.289 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	6.787 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO13310	Garcinia hanburyi	Species	Clusiaceae	Eukaryota	n.a.	latex	n.a.	PMID[17117343]
NPO13310	Garcinia hanburyi	Species	Clusiaceae	Eukaryota	n.a.	fruit	n.a.	PMID[17117343]
NPO13310	Garcinia hanburyi	Species	Clusiaceae	Eukaryota	resin	n.a.	n.a.	PMID[19072548]
NPO13310	Garcinia hanburyi	Species	Clusiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21486005]
NPO13310	Garcinia hanburyi	Species	Clusiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO13310	Garcinia hanburyi	Species	Clusiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO13310	Garcinia hanburyi	Species	Clusiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO13310	Garcinia hanburyi	Species	Clusiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC156842 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	11365
0.1-0.2	37031
0.2-0.3	1326
0.3-0.4	83
0.4-0.5	23
0.5-0.6	12
0.6-0.7	6
0.7-0.8	0
0.8-0.85	0
0.85-0.9	2
0.9-0.95	1
0.95-1	3

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC158329
1.0	High Similarity	NPC55422
1.0	High Similarity	NPC75141
0.9	High Similarity	NPC476146
0.8621	High Similarity	NPC40089
0.8621	High Similarity	NPC47634
0.7708	Intermediate Similarity	NPC476229
0.7708	Intermediate Similarity	NPC476152
0.75	Intermediate Similarity	NPC189689
0.7191	Intermediate Similarity	NPC131578
0.7191	Intermediate Similarity	NPC611483
0.71	Intermediate Similarity	NPC41598
0.701	Intermediate Similarity	NPC611384
0.6979	Remote Similarity	NPC610447
0.697	Remote Similarity	NPC476210
0.6832	Remote Similarity	NPC476216
0.6809	Remote Similarity	NPC223413
0.6571	Remote Similarity	NPC162248
0.6337	Remote Similarity	NPC102810
0.5922	Remote Similarity	NPC476199
0.5657	Remote Similarity	NPC286422
0.5657	Remote Similarity	NPC603867
0.5644	Remote Similarity	NPC476255
0.5591	Remote Similarity	NPC94796
0.5591	Remote Similarity	NPC611777
0.5556	Remote Similarity	NPC601073
0.5556	Remote Similarity	NPC609328
0.5357	Remote Similarity	NPC476139
0.5306	Remote Similarity	NPC608101
0.5155	Remote Similarity	NPC607281
0.5047	Remote Similarity	NPC476159

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC156842 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3789
0.1-0.2	5338
0.2-0.3	23
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data