NPASS Compound

Natural Product: NPC137493

Natural Product ID	NPC137493
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Aglaiabbreviatin D
IUPAC Name	(5R,8R,9R,10R,13R,14R,17S)-4,4,8,10,14-pentamethyl-17-[(2S)-2,6,6-trimethyl-3H-pyran-2-yl]-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
Synonyms	Aglaiabbreviatin D
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1651317
PubChem CID	50908217
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 80 84 0 0 0 0 0 0 0 0999 V2000 -6.5593 -1.2549 0.7690 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6033 -0.5698 1.0258 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8307 -0.7368 2.2724 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3536 -0.4029 2.0891 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9372 -0.5785 0.6182 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6869 0.5462 -0.1129 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1613 0.4869 0.0778 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5999 1.8192 0.7051 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9379 0.3800 -1.2193 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3080 0.5662 -1.5881 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8544 0.9718 -1.6329 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9786 0.0387 -0.8524 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.4957 -0.2753 0.5287 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5998 -1.2887 1.1641 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8521 -1.0217 1.0420 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3218 -0.4586 -0.2427 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3561 0.6714 -0.6333 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3507 1.7625 0.3997 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0276 1.2121 -1.8400 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4760 1.2712 -1.3820 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6079 0.2387 -0.2537 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8251 -0.5581 -0.5867 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7248 -1.1697 -1.9730 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1357 -1.6660 0.3689 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2575 -1.0587 1.7221 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0494 0.0225 1.7488 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6593 0.4283 0.4633 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8712 0.3498 -0.6287 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9765 -0.2949 0.2112 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0269 1.9127 0.6437 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8173 -1.2110 -1.6907 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3761 -1.9192 0.1935 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9765 -1.7772 2.6347 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2458 -0.0891 3.0980 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8033 -1.0621 2.7581 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1693 0.6482 2.4032 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2361 1.4920 0.3114 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2046 1.9464 1.7146 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1305 2.6022 0.0562 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6883 1.9629 0.6117 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9885 1.3438 -1.7646 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5607 -0.3766 -1.9021 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9738 0.0608 -0.9262 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9104 1.3645 -2.0491 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5310 -0.3652 -2.1039 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5433 0.8684 -2.7137 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7548 2.0241 -1.3877 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3509 0.6757 1.1275 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8443 -2.3468 0.8619 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8397 -1.2778 2.2703 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2223 -0.4048 1.9148 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3550 -2.0196 1.2340 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3022 -1.2076 -1.0543 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5972 2.3550 0.2567 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5133 1.4390 1.4228 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1607 2.5235 0.1872 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8799 0.6818 -2.7698 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6965 2.2851 -1.9588 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0917 1.0319 -2.2496 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7704 2.2826 -1.0394 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8174 0.7989 0.6914 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8330 -2.2806 -1.9503 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5113 -0.8056 -2.6588 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7584 -0.9687 -2.4617 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1751 -2.0219 0.1053 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5031 -2.5370 0.3087 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7786 -1.4189 2.6047 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2214 0.5647 2.6945 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1835 -1.0589 0.9972 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8504 0.3885 0.2241 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9905 -0.7551 -0.8200 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9977 1.9217 1.1908 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2919 2.4127 1.3077 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1830 2.4128 -0.3122 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1188 -1.0763 -2.5220 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8109 -1.4587 -2.1694 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5243 -2.0966 -1.1346 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6170 -2.6322 -0.1035 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0082 -2.4451 0.9690 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0775 -1.8178 -0.6860 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 6 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 1 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 6 22 24 1 0 24 25 1 0 25 26 2 0 26 27 1 0 27 28 1 0 27 29 1 0 27 30 1 0 12 31 1 6 5 32 1 6 7 2 1 0 17 12 1 0 28 22 1 0 13 5 1 0 21 16 1 0 3 33 1 0 3 34 1 0 4 35 1 0 4 36 1 0 6 37 1 1 8 38 1 0 8 39 1 0 8 40 1 0 9 41 1 0 9 42 1 0 9 43 1 0 10 44 1 0 10 45 1 0 11 46 1 0 11 47 1 0 13 48 1 1 14 49 1 0 14 50 1 0 15 51 1 0 15 52 1 0 16 53 1 6 18 54 1 0 18 55 1 0 18 56 1 0 19 57 1 0 19 58 1 0 20 59 1 0 20 60 1 0 21 61 1 1 23 62 1 0 23 63 1 0 23 64 1 0 24 65 1 0 24 66 1 0 25 67 1 0 26 68 1 0 29 69 1 0 29 70 1 0 29 71 1 0 30 72 1 0 30 73 1 0 30 74 1 0 31 75 1 0 31 76 1 0 31 77 1 0 32 78 1 0 32 79 1 0 32 80 1 0 M END

Standard InCHIKey	WVWUAJRNIVNQJF-MRULXVATSA-N
Standard InCHI	InChI=1S/C30H48O2/c1-25(2)15-9-16-30(8,32-25)21-12-18-28(6)20(21)10-11-23-27(5)17-14-24(31)26(3,4)22(27)13-19-29(23,28)7/h9,15,20-23H,10-14,16-19H2,1-8H3/t20-,21+,22+,23-,27+,28-,29-,30+/m1/s1
SMILES	O=C1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC[C@H]2[C@@]1(C)CC[C@@H]2[C@]1(C)CC=CC(O1)(C)C)C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	440.37	Volume:	496.961 ? Van der Waals volume.
Dense:	0.886	LogP:	5.31 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.504 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-6.66 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	1.0	Rigid Bonds:	27.0
TPSA:	26.3 ? Topological Polar Surface Area.	H-Bond Acceptor:	2.0
H-Bond Donor:	0.0	Rings:	5.0
Heavy Atoms:	2.0

MedChem Properties

QED Drug-Likeness Score:	0.389	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.865	Fsp³:	0.9
MCE-18:	101.333 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.802	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.767	Promiscuous compounds:	0.299

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.678	MDCK Permeability:	-4.716
Pgp-inhibitor:	0.998	Pgp-substrate:	0.001
PAMPA:	0.022 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.025	30% Bioavailability (F30%):	0.048
50% Bioavailability (F50%):	0.781

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.942	MRP1:	0.99
Plasma Protein Binding (PPB):	97.628%	Volume Distribution (VD):	0.532
Fu:	3.239% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.994	BCRP inhibitor:	0.154
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.999	CYP1A2-substrate:	0.003
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.005
CYP2C9-inhibitor:	0.04	CYP2C9-substrate:	0.001
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.122
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.929
CYP2B6-substrate:	0.323	CYP2C8-inhibitor:	0.973
HLM stability:	0.976 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

9.849

Half-life (T1/2):

0.174

ADMET: Toxicity

hERG Blockers:	0.08	hERG Blockers (10um):	0.294
Human Hepatotoxicity (H-HT):	0.37	Drug-induced Liver Injury (DILI):	0.343
AMES Toxicity:	0.197	Rat Oral Acute Toxicity:	0.617
Maximum Recommended Daily Dose:	0.673	Skin Sensitization:	0.925
Carcinogencity:	0.766	Eye Corrosion:	0.799
Eye Irritation:	0.808	Respiratory Toxicity:	0.52
Drug-induced Neurotoxicity:	0.323	Ototoxicity:	0.247
Hematotoxicity:	0.241	Drug-induced Nephrotoxicity:	0.731
Genotoxicity:	0.489	RPMI-8226 Immunitoxicity:	0.074
A549 Cytotoxicity:	0.077	Hek293 Cytotoxicity:	0.432
BCF:	2.081 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.736 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.684 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.306 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO7602	Aglaia abbreviata	Species	Meliaceae	Eukaryota	n.a.	stem	n.a.	PMID[21087017]
NPO7602	Aglaia abbreviata	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21087017]
NPO7602	Aglaia abbreviata	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	6

Activity Type	# Activity
Cell line	4
Others	1
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT83	Cell line	MCF7	Homo sapiens	IC50	>	10000.0	nM	PMID[21087017]
NPT91	Cell line	KB	Homo sapiens	IC50	=	1200.0	nM	PMID[21087017]
NPT659	Cell line	SMMC-7721	Homo sapiens	IC50	=	2100.0	nM	PMID[21087017]
NPT111	Cell line	K562	Homo sapiens	IC50	=	1200.0	nM	PMID[21087017]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	960.0	nM	PMID[21087017]
NPT2	Others	Unspecified	n.a.	IC50	>	10000	nM	PMID[21087017]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC137493 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	26364
0.1-0.2	21951
0.2-0.3	1292
0.3-0.4	197
0.4-0.5	45
0.5-0.6	4
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.6607	Remote Similarity	NPC197701
0.6552	Remote Similarity	NPC92139
0.6491	Remote Similarity	NPC285982
0.6333	Remote Similarity	NPC245029
0.6333	Remote Similarity	NPC31302
0.55	Remote Similarity	NPC470557
0.5231	Remote Similarity	NPC292458
0.5231	Remote Similarity	NPC217559
0.5231	Remote Similarity	NPC268578

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC137493 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7363
0.1-0.2	1717
0.2-0.3	70
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data