NPASS Compound

Natural Product: NPC131104

Natural Product ID	NPC131104
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(4As,4Br,6S,6As,7S,8S,9S,10As,10Br,12As)-8-Acetyl-7-Formyl-9-Hydroxy-1,1,4A,6A,10B-Pentamethyloctadecahydrochrysen-6-Yl Acetate
IUPAC Name	[(4aS,4bR,6S,6aS,7S,8S,9S,10aS,10bR,12aS)-8-acetyl-7-formyl-9-hydroxy-1,1,4a,6a,10b-pentamethyl-2,3,4,4b,5,6,7,8,9,10,10a,11,12,12a-tetradecahydrochrysen-6-yl] acetate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL517640
PubChem CID	637470
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001552] Sesterterpenoids [CHEMONTID:0002883] Scalarane sesterterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 77 80 0 0 0 0 0 0 0 0999 V2000 5.9933 -0.7606 -1.1957 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4891 -0.9005 0.1944 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3100 -1.0139 1.0803 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0652 -0.9046 0.5105 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3594 0.3784 0.0912 C 0 0 2 0 0 0 0 0 0 0 0 0 4.1888 1.5545 0.3489 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2825 1.4010 0.8477 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0287 0.3953 0.8509 C 0 0 2 0 0 0 0 0 0 0 0 0 2.3893 0.3250 2.3012 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2781 -0.8112 0.3479 C 0 0 1 0 0 0 0 0 0 0 0 0 1.9734 -2.1042 0.5448 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3164 -2.0376 -0.1979 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9501 -3.2526 0.0618 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1764 -0.8675 0.8208 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3067 -1.2555 2.2530 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7776 -2.0450 0.0338 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3070 -1.9970 0.0869 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7155 -0.6756 -0.4798 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1207 -0.6104 -0.9323 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8184 -1.9473 -0.6403 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2295 -0.4445 -2.4563 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9596 0.4569 -0.3212 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2999 1.7850 -0.2262 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7864 1.7290 -0.2028 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2986 0.4517 0.4608 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9220 0.3661 1.8052 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7949 0.4348 0.4526 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1351 1.5188 1.2270 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2793 1.6494 0.5959 C 0 0 2 0 0 0 0 0 0 0 0 0 1.1154 1.9992 -0.7606 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4119 3.2813 -1.1815 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8266 4.2089 -0.4428 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2337 3.6216 -2.6303 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1878 -0.5523 -1.9259 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7006 0.1005 -1.2578 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5789 -1.6793 -1.4911 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9301 -1.1064 1.5916 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0919 0.2477 -0.9793 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8664 2.5391 0.1140 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8078 1.0270 2.9311 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4549 0.6722 2.4672 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2867 -0.6842 2.7438 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1893 -0.6565 -0.7706 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4106 -2.8952 0.0073 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2229 -2.3567 1.5785 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1783 -1.8370 -1.2670 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9479 -3.3436 1.0621 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0840 -0.5096 2.9987 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3184 -1.6665 2.4421 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3895 -2.1193 2.4308 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5286 -2.9947 0.5937 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4379 -2.0707 -0.9984 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6467 -2.7843 -0.6171 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7092 -2.2360 1.0660 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0608 -0.5194 -1.3914 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6254 -2.3044 0.3693 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5380 -2.6666 -1.4446 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9159 -1.7978 -0.7431 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0295 -1.0525 -2.8794 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2656 -0.7723 -2.8873 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4172 0.6315 -2.6768 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4106 0.1013 0.6440 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8591 0.5869 -0.9954 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7106 2.3598 0.6451 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5606 2.4258 -1.1191 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3908 1.8183 -1.2488 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4634 2.6438 0.3332 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7108 1.1622 1.9591 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1367 0.6451 2.5685 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4201 -0.5825 2.0395 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5160 0.6107 -0.6332 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5711 2.5414 1.0544 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0592 1.3990 2.2989 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7131 2.4881 1.1597 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3919 4.3579 -2.7045 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1472 4.1765 -2.9260 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0479 2.7242 -3.2403 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 5 8 1 0 8 9 1 1 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 10 14 1 0 14 15 1 1 14 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 19 21 1 0 19 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 25 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 2 0 31 33 1 0 12 4 1 0 27 14 1 0 29 8 1 0 25 18 1 0 1 34 1 0 1 35 1 0 1 36 1 0 4 37 1 1 5 38 1 6 6 39 1 0 9 40 1 0 9 41 1 0 9 42 1 0 10 43 1 6 11 44 1 0 11 45 1 0 12 46 1 6 13 47 1 0 15 48 1 0 15 49 1 0 15 50 1 0 16 51 1 0 16 52 1 0 17 53 1 0 17 54 1 0 18 55 1 6 20 56 1 0 20 57 1 0 20 58 1 0 21 59 1 0 21 60 1 0 21 61 1 0 22 62 1 0 22 63 1 0 23 64 1 0 23 65 1 0 24 66 1 0 24 67 1 0 26 68 1 0 26 69 1 0 26 70 1 0 27 71 1 6 28 72 1 0 28 73 1 0 29 74 1 1 33 75 1 0 33 76 1 0 33 77 1 0 M END

Standard InCHIKey	UFBZWPSQIJARTK-QMHVTLFBSA-N
Standard InCHI	InChI=1S/C28H44O5/c1-16(30)24-18(15-29)28(7)22(13-19(24)32)27(6)12-9-20-25(3,4)10-8-11-26(20,5)21(27)14-23(28)33-17(2)31/h15,18-24,32H,8-14H2,1-7H3/t18-,19-,20-,21+,22-,23-,24-,26-,27+,28+/m0/s1
SMILES	CC(=O)[C@H]1[C@H](C=O)[C@]2(C)[C@@H](C[C@@H]1O)[C@]1(C)CC[C@H]3C(C)(C)CCC[C@]3(C)[C@H]1C[C@@H]2OC(=O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	460.32	Volume:	494.66 ? Van der Waals volume.
Dense:	0.931	LogP:	3.676 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.588 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.531 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	4.0	Rigid Bonds:	24.0
TPSA:	80.67 ? Topological Polar Surface Area.	H-Bond Acceptor:	5.0
H-Bond Donor:	1.0	Rings:	4.0
Heavy Atoms:	5.0

MedChem Properties

QED Drug-Likeness Score:	0.475	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.994	Fsp³:	0.893
MCE-18:	88.415 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.71	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.191	Promiscuous compounds:	0.412

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.386	MDCK Permeability:	-5.073
Pgp-inhibitor:	0.995	Pgp-substrate:	0.002
PAMPA:	0.533 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.031	30% Bioavailability (F30%):	0.046
50% Bioavailability (F50%):	0.736

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.2	MRP1:	0.627
Plasma Protein Binding (PPB):	85.252%	Volume Distribution (VD):	-0.032
Fu:	10.924% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.992	BCRP inhibitor:	0.162
BSEP inhibitor:	0.998

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.161
CYP2C19-inhibitor:	0.967	CYP2C19-substrate:	0.028
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.001
CYP2D6-inhibitor:	0.003	CYP2D6-substrate:	0.002
CYP3A4-inhibitor:	0.184	CYP3A4-substrate:	0.999
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.312
HLM stability:	0.683 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

6.291

Half-life (T1/2):

0.795

ADMET: Toxicity

hERG Blockers:	0.016	hERG Blockers (10um):	0.047
Human Hepatotoxicity (H-HT):	0.447	Drug-induced Liver Injury (DILI):	0.738
AMES Toxicity:	0.749	Rat Oral Acute Toxicity:	0.297
Maximum Recommended Daily Dose:	0.546	Skin Sensitization:	0.986
Carcinogencity:	0.916	Eye Corrosion:	0.229
Eye Irritation:	0.808	Respiratory Toxicity:	0.764
Drug-induced Neurotoxicity:	0.065	Ototoxicity:	0.359
Hematotoxicity:	0.863	Drug-induced Nephrotoxicity:	0.971
Genotoxicity:	0.894	RPMI-8226 Immunitoxicity:	0.08
A549 Cytotoxicity:	0.405	Hek293 Cytotoxicity:	0.291
BCF:	1.226 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.072 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.593 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.038 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33404	phyllospongia sp.	Species	Thorectidae	Eukaryota	n.a.	Indonesian	n.a.	PMID[12502324]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell line	KB	Homo sapiens	Inhibition	=	30.0	%	PMID[11473412]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC131104 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	18871
0.1-0.2	26070
0.2-0.3	4484
0.3-0.4	351
0.4-0.5	46
0.5-0.6	23
0.6-0.7	7
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8333	Intermediate Similarity	NPC3032
0.6842	Remote Similarity	NPC181871
0.6667	Remote Similarity	NPC208912
0.6667	Remote Similarity	NPC83242
0.6552	Remote Similarity	NPC219535
0.6094	Remote Similarity	NPC474253
0.6094	Remote Similarity	NPC474346
0.6	Remote Similarity	NPC213737
0.5909	Remote Similarity	NPC67653
0.5902	Remote Similarity	NPC269729
0.5902	Remote Similarity	NPC606340
0.5758	Remote Similarity	NPC88337
0.5714	Remote Similarity	NPC95899
0.5714	Remote Similarity	NPC473319
0.5645	Remote Similarity	NPC9060
0.5625	Remote Similarity	NPC194951
0.5625	Remote Similarity	NPC608115
0.5625	Remote Similarity	NPC611248
0.5538	Remote Similarity	NPC325229
0.5538	Remote Similarity	NPC2096
0.5507	Remote Similarity	NPC475211
0.5397	Remote Similarity	NPC237938
0.5385	Remote Similarity	NPC474572
0.5373	Remote Similarity	NPC228251
0.5373	Remote Similarity	NPC477972
0.5303	Remote Similarity	NPC606805
0.5303	Remote Similarity	NPC607360
0.5147	Remote Similarity	NPC282233
0.5072	Remote Similarity	NPC474284
0.5065	Remote Similarity	NPC473677
0.5065	Remote Similarity	NPC475404

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC131104 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6513
0.1-0.2	2540
0.2-0.3	97
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data