Drug Information| Drug ID: | NPD9762 |
| Drug Name: | Hydroxyurea |
| Molecular Formula: | CH4N2O2 |
| Canonical SMILES: | ONC(=N)O |
| Standard InCHI: | InChI=1S/CH4N2O2/c2-1(4)3-5/h5H,(H3,2,3,4) |
| Standard InCHIKey: | VSNHCAURESNICA-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD; ChEMBL; IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD9762Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.8333 | NPC142330 |
| Molecular Weight | 76.03 |
| ALogP | -0.5348 |
| MLogP | 1.13 |
| XLogP | -0.104 |
| HDA | 2 |
| HBD | 4 |
| Rotatable Bonds | 3 |
| TPSA | 76.34 |
| RO5 Violation | 0 |