Drug Information| Drug ID: | NPD9642 |
| Drug Name: | |
| Molecular Formula: | C9H15N5O |
| Canonical SMILES: | Nc1cc(nc(=N)n1O)N1CCCCC1 |
| Standard InCHI: | InChI=1S/C9H15N5O/c10-7-6-8(12-9(11)14(7)15)13-4-2-1-3-5-13/h6,11,15H,1-5,10H2 |
| Standard InCHIKey: | ZIMGGGWCDYVHOY-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD9642Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6349 | NPC212436 |
| Remote Similarity | 0.619 | NPC230087 |
| Remote Similarity | 0.5714 | NPC472735 |
| Remote Similarity | 0.5647 | NPC229249 |