Drug Information| Drug ID: | NPD9460 |
| Drug Name: | |
| Molecular Formula: | C8H19NO6P2 |
| Canonical SMILES: | [O-]P(=O)(C(P(=O)(O)O)NC1CCCCCC1)[O-] |
| Standard InCHI: | InChI=1S/C8H19NO6P2/c10-16(11,12)8(17(13,14)15)9-7-5-3-1-2-4-6-7/h7-9H,1-6H2,(H2,10,11,12)(H2,13,14,15)/p-2 |
| Standard InCHIKey: | LWRDQHOZTAOILO-UHFFFAOYSA-L |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD9460Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6122 | NPC167301 |
| Remote Similarity | 0.5833 | NPC74599 |
| Remote Similarity | 0.5652 | NPC320889 |
| Remote Similarity | 0.56 | NPC326791 |
| Remote Similarity | 0.56 | NPC473035 |