Drug Information| Drug ID: | NPD9422 |
| Drug Name: | |
| Molecular Formula: | C8H14N2O |
| Canonical SMILES: | CO/N=C/C1=CCCN(C1)C |
| Standard InCHI: | InChI=1S/C8H14N2O/c1-10-5-3-4-8(7-10)6-9-11-2/h4,6H,3,5,7H2,1-2H3/b9-6+ |
| Standard InCHIKey: | YMMXHEYLRHNXAB-RMKNXTFCSA-N |
| Max Developmental Stage: | Clinical (unspecified phase) |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD9422Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5909 | NPC270412 |
| Remote Similarity | 0.5909 | NPC14437 |
| Remote Similarity | 0.5789 | NPC299114 |