Drug Information| Drug ID: | NPD9389 |
| Drug Name: | Sulbactam |
| Molecular Formula: | C8H11NO5S |
| Canonical SMILES: | OC(=O)[C@@H]1N2C(=O)C[C@H]2S(=O)(=O)C1(C)C |
| Standard InCHI: | InChI=1S/C8H11NO5S/c1-8(2)6(7(11)12)9-4(10)3-5(9)15(8,13)14/h5-6H,3H2,1-2H3,(H,11,12)/t5-,6+/m1/s1 |
| Standard InCHIKey: | FKENQMMABCRJMK-RITPCOANSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD9389Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6989 | NPC117829 |
| Remote Similarity | 0.6224 | NPC144780 |
| Remote Similarity | 0.6216 | NPC102815 |
| Remote Similarity | 0.5946 | NPC317815 |
| Remote Similarity | 0.5682 | NPC327272 |
| Remote Similarity | 0.5647 | NPC322274 |
| Remote Similarity | 0.5641 | NPC283786 |
| Remote Similarity | 0.5636 | NPC59249 |
| Molecular Weight | 233.04 |
| ALogP | -0.6958 |
| MLogP | 1.57 |
| XLogP | -1.132 |
| HDA | 6 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| TPSA | 100.13 |
| RO5 Violation | 0 |