Drug Information| Drug ID: | NPD9223 |
| Drug Name: | Perfosfamide |
| Molecular Formula: | C7H15Cl2N2O4P |
| Canonical SMILES: | ClCCN(P1(=O)OCCC(N1)OO)CCCl |
| Standard InCHI: | InChI=1S/C7H15Cl2N2O4P/c8-2-4-11(5-3-9)16(13)10-7(15-12)1-6-14-16/h7,12H,1-6H2,(H,10,13) |
| Standard InCHIKey: | VPAWVRUHMJVRHU-UHFFFAOYSA-N |
| Max Developmental Stage: | Phase 2 |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD9223Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5686 | NPC292422 |
| TTD | DIB008398 |
| DrugBank | |
| ChEMBL | |
| IUPHAR/BPS | |
| PharmaGKB | |
| KEGG Drug | |
| PubChem CID | |
| ChEBI | |
| CAS Number |
| Molecular Weight | 292.01 |
| ALogP | 0.1609 |
| MLogP | 1.24 |
| XLogP | 0.35 |
| HDA | 6 |
| HBD | 2 |
| Rotatable Bonds | 9 |
| TPSA | 80.84 |
| RO5 Violation | 0 |