Drug Information| Drug ID: | NPD912 |
| Drug Name: | |
| Molecular Formula: | C12H6Cl4OS |
| Canonical SMILES: | Clc1ccc(cc1)S(=O)c1cc(Cl)c(cc1Cl)Cl |
| Standard InCHI: | InChI=1S/C12H6Cl4OS/c13-7-1-3-8(4-2-7)18(17)12-6-10(15)9(14)5-11(12)16/h1-6H |
| Standard InCHIKey: | IEPUYXNXNXZXRP-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD912Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.8222 | NPC125549 |
| Intermediate Similarity | 0.7473 | NPC67863 |
| Remote Similarity | 0.6591 | NPC22627 |
| Remote Similarity | 0.6552 | NPC134584 |
| Remote Similarity | 0.6322 | NPC18259 |
| Remote Similarity | 0.6322 | NPC119076 |
| Remote Similarity | 0.5977 | NPC320749 |