Drug Information| Drug ID: | NPD9104 |
| Drug Name: | Clomethiazole |
| Molecular Formula: | C6H8ClNS |
| Canonical SMILES: | Cc1ncsc1CCCl |
| Standard InCHI: | InChI=1S/C6H8ClNS/c1-5-6(2-3-7)9-4-8-5/h4H,2-3H2,1H3 |
| Standard InCHIKey: | PCLITLDOTJTVDJ-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD9104Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7921 | NPC162460 |
| Remote Similarity | 0.6667 | NPC148983 |
| Remote Similarity | 0.6107 | NPC189436 |
| Remote Similarity | 0.6107 | NPC150950 |
| Remote Similarity | 0.6107 | NPC125076 |
| Remote Similarity | 0.6 | NPC287895 |
| Remote Similarity | 0.5882 | NPC329165 |
| Remote Similarity | 0.5839 | NPC320833 |
| Remote Similarity | 0.5839 | NPC317197 |
| Remote Similarity | 0.5673 | NPC261708 |