Drug Information| Drug ID: | NPD9082 |
| Drug Name: | Acipimox |
| Molecular Formula: | C6H6N2O3 |
| Canonical SMILES: | Cc1cnc(cn1=O)C(=O)O |
| Standard InCHI: | InChI=1S/C6H6N2O3/c1-4-2-7-5(6(9)10)3-8(4)11/h2-3H,1H3,(H,9,10) |
| Standard InCHIKey: | DJQOOSBJCLSSEY-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD; ChEMBL; IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD9082Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.9126 | NPC317307 |
| Intermediate Similarity | 0.8349 | NPC180417 |
| Intermediate Similarity | 0.7581 | NPC144223 |
| Remote Similarity | 0.6505 | NPC204104 |
| Remote Similarity | 0.6505 | NPC100312 |
| Remote Similarity | 0.6442 | NPC270637 |
| Remote Similarity | 0.6299 | NPC63433 |
| Remote Similarity | 0.6077 | NPC240084 |
| Remote Similarity | 0.5776 | NPC277608 |
| Remote Similarity | 0.5766 | NPC180493 |
| Remote Similarity | 0.5739 | NPC76536 |
| Remote Similarity | 0.5641 | NPC262236 |