Drug Information| Drug ID: | NPD9077 |
| Drug Name: | Dichlorphenamide; Diclofenamide |
| Molecular Formula: | C6H6Cl2N2O4S2 |
| Canonical SMILES: | Clc1cc(cc(c1Cl)S(=O)(=O)N)S(=O)(=O)N |
| Standard InCHI: | InChI=1S/C6H6Cl2N2O4S2/c7-4-1-3(15(9,11)12)2-5(6(4)8)16(10,13)14/h1-2H,(H2,9,11,12)(H2,10,13,14) |
| Standard InCHIKey: | GJQPMPFPNINLKP-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD; ChEMBL; IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD9077Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7222 | NPC67863 |
| Intermediate Similarity | 0.7021 | NPC125549 |
| Remote Similarity | 0.6667 | NPC134584 |
| Remote Similarity | 0.6105 | NPC302129 |
| Remote Similarity | 0.6105 | NPC35599 |
| Remote Similarity | 0.6047 | NPC18259 |
| Remote Similarity | 0.6047 | NPC119076 |
| Remote Similarity | 0.5859 | NPC321053 |
| Molecular Weight | 303.91 |
| ALogP | -0.3844 |
| MLogP | 1.02 |
| XLogP | -0.844 |
| HDA | 6 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| TPSA | 137.08 |
| RO5 Violation | 0 |