Drug Information| Drug ID: | NPD9060 |
| Drug Name: | Trolamine |
| Molecular Formula: | C6H15NO3 |
| Canonical SMILES: | OCCN(CCO)CCO |
| Standard InCHI: | InChI=1S/C6H15NO3/c8-4-1-7(2-5-9)3-6-10/h8-10H,1-6H2 |
| Standard InCHIKey: | GSEJCLTVZPLZKY-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD9060Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.9643 | NPC325909 |
| High Similarity | 0.8929 | NPC136014 |
| Intermediate Similarity | 0.8125 | NPC328729 |
| Remote Similarity | 0.6216 | NPC1591 |
| Remote Similarity | 0.6129 | NPC262962 |
| Remote Similarity | 0.6 | NPC59650 |
| Remote Similarity | 0.5909 | NPC81384 |
| Remote Similarity | 0.5882 | NPC304836 |
| Remote Similarity | 0.5882 | NPC326044 |
| Remote Similarity | 0.5758 | NPC322649 |
| Remote Similarity | 0.5714 | NPC141902 |
| Remote Similarity | 0.5641 | NPC216443 |