Drug Information| Drug ID: | NPD8844 |
| Drug Name: | Amifampridine |
| Molecular Formula: | C5H7N3 |
| Canonical SMILES: | N=c1cc[nH]cc1N |
| Standard InCHI: | InChI=1S/C5H7N3/c6-4-1-2-8-3-5(4)7/h1-3H,7H2,(H2,6,8) |
| Standard InCHIKey: | OYTKINVCDFNREN-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL; IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD8844Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.9744 | NPC57565 |
| Remote Similarity | 0.6667 | NPC230087 |
| Remote Similarity | 0.6327 | NPC305607 |
| Remote Similarity | 0.5926 | NPC212436 |
| TTD | |
| DrugBank | |
| ChEMBL | |
| IUPHAR/BPS | 8032 |
| PharmaGKB | |
| KEGG Drug | |
| PubChem CID | |
| ChEBI | |
| CAS Number |
| Molecular Weight | 109.06 |
| ALogP | -1.9358 |
| MLogP | 1.68 |
| XLogP | 0.347 |
| HDA | 3 |
| HBD | 3 |
| Rotatable Bonds | 1 |
| TPSA | 61.9 |
| RO5 Violation | 0 |