Drug Information| Drug ID: | NPD8843 |
| Drug Name: | Amifampridine Phosphate |
| Molecular Formula: | C5H7N3.H3O4P |
| Canonical SMILES: | OP(=O)(O)O.N=c1cc[nH]cc1N |
| Standard InCHI: | InChI=1S/C5H7N3.H3O4P/c6-4-1-2-8-3-5(4)7;1-5(2,3)4/h1-3H,7H2,(H2,6,8);(H3,1,2,3,4) |
| Standard InCHIKey: | KAICRBBQCRKMPO-UHFFFAOYSA-N |
| Max Developmental Stage: | Phase 3 |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8843Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.9744 | NPC57565 |
| Remote Similarity | 0.6667 | NPC230087 |
| Remote Similarity | 0.6327 | NPC305607 |
| Remote Similarity | 0.5926 | NPC212436 |