Drug Information| Drug ID: | NPD8607 |
| Drug Name: | Creatinine |
| Molecular Formula: | C4H7N3O |
| Canonical SMILES: | OC1=NC(=N)N(C1)C |
| Standard InCHI: | InChI=1S/C4H7N3O/c1-7-2-3(8)6-4(7)5/h2H2,1H3,(H2,5,6,8) |
| Standard InCHIKey: | DDRJAANPRJIHGJ-UHFFFAOYSA-N |
| Max Developmental Stage: | Phase 3 |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8607Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC27836 |
| Intermediate Similarity | 0.8 | NPC141953 |
| Intermediate Similarity | 0.8 | NPC153556 |
| Remote Similarity | 0.6875 | NPC195448 |
| Remote Similarity | 0.6122 | NPC40511 |
| Remote Similarity | 0.5769 | NPC314598 |
| Remote Similarity | 0.5769 | NPC182969 |
| Remote Similarity | 0.5682 | NPC328698 |