Drug Information| Drug ID: | NPD8545 |
| Drug Name: | Fosfocreatine |
| Molecular Formula: | C4H10N3O5P |
| Canonical SMILES: | OC(=O)CN(C(=N)NP(=O)(O)O)C |
| Standard InCHI: | InChI=1S/C4H10N3O5P/c1-7(2-3(8)9)4(5)6-13(10,11)12/h2H2,1H3,(H,8,9)(H4,5,6,10,11,12) |
| Standard InCHIKey: | DRBBFCLWYRJSJZ-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8545Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.8571 | NPC195448 |
| Intermediate Similarity | 0.7451 | NPC40511 |
| Remote Similarity | 0.6 | NPC27836 |
| Remote Similarity | 0.5962 | NPC216443 |
| Remote Similarity | 0.5918 | NPC59650 |
| Remote Similarity | 0.5909 | NPC322206 |
| Remote Similarity | 0.5902 | NPC245768 |
| Remote Similarity | 0.5882 | NPC134570 |
| Remote Similarity | 0.5714 | NPC10915 |
| Remote Similarity | 0.566 | NPC69179 |
| Remote Similarity | 0.5614 | NPC198301 |