Drug Information| Drug ID: | NPD8229 |
| Drug Name: | Eprodisate Disodium |
| Molecular Formula: | C3H8O6S2.2Na |
| Canonical SMILES: | [O-]S(=O)(=O)CCCS(=O)(=O)[O-].[Na+].[Na+] |
| Standard InCHI: | InChI=1S/C3H8O6S2.2Na/c4-10(5,6)2-1-3-11(7,8)9;;/h1-3H2,(H,4,5,6)(H,7,8,9);;/q;2*+1/p-2 |
| Standard InCHIKey: | DKGJFKPIUSHDIT-UHFFFAOYSA-L |
| Max Developmental Stage: | Phase 3 |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8229Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6957 | NPC326758 |
| Remote Similarity | 0.6957 | NPC476548 |
| Remote Similarity | 0.6522 | NPC476549 |
| Remote Similarity | 0.64 | NPC476550 |
| Remote Similarity | 0.5806 | NPC202651 |
| Remote Similarity | 0.5714 | NPC2088 |