Drug Information| Drug ID: | NPD8213 |
| Drug Name: | Dimethylcarbate |
| Molecular Formula: | C3H7NO2 |
| Canonical SMILES: | CN(C(=O)O)C |
| Standard InCHI: | InChI=1S/C3H7NO2/c1-4(2)3(5)6/h1-2H3,(H,5,6) |
| Standard InCHIKey: | DWLVWMUCHSLGSU-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8213Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6818 | NPC66757 |