Drug Information| Drug ID: | NPD8197 |
| Drug Name: | L-cycloserine |
| Molecular Formula: | C3H6N2O2 |
| Canonical SMILES: | N[C@H]1CON=C1O |
| Standard InCHI: | InChI=1S/C3H6N2O2/c4-2-1-7-5-3(2)6/h2H,1,4H2,(H,5,6)/t2-/m0/s1 |
| Standard InCHIKey: | DYDCUQKUCUHJBH-REOHCLBHSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD8197Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC105488 |
| Remote Similarity | 0.6341 | NPC84444 |
| Remote Similarity | 0.6341 | NPC145217 |
| Remote Similarity | 0.623 | NPC118524 |
| Remote Similarity | 0.6226 | NPC329495 |
| Remote Similarity | 0.6 | NPC297220 |
| Remote Similarity | 0.6 | NPC470666 |
| Remote Similarity | 0.5833 | NPC219143 |
| Remote Similarity | 0.5833 | NPC226265 |
| Remote Similarity | 0.5769 | NPC153370 |
| Remote Similarity | 0.5652 | NPC25237 |
| Remote Similarity | 0.5641 | NPC262962 |
| TTD | |
| DrugBank | |
| ChEMBL | |
| IUPHAR/BPS | 9488 |
| PharmaGKB | |
| KEGG Drug | |
| PubChem CID | |
| ChEBI | |
| CAS Number |
| Molecular Weight | 102.04 |
| ALogP | -1.1311 |
| MLogP | 1.35 |
| XLogP | -0.024 |
| HDA | 2 |
| HBD | 2 |
| Rotatable Bonds | 2 |
| TPSA | 67.84 |
| RO5 Violation | 0 |