Drug Information| Drug ID: | NPD8191 |
| Drug Name: | |
| Molecular Formula: | C3H4O4 |
| Canonical SMILES: | [O-]C(=O)CC(=O)[O-] |
| Standard InCHI: | InChI=1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/p-2 |
| Standard InCHIKey: | OFOBLEOULBTSOW-UHFFFAOYSA-L |
| Max Developmental Stage: | Clinical (unspecified phase) |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD8191Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.8333 | NPC3343 |
| Intermediate Similarity | 0.7692 | NPC55956 |
| Intermediate Similarity | 0.7143 | NPC241404 |
| Intermediate Similarity | 0.7143 | NPC265882 |
| Remote Similarity | 0.6897 | NPC328569 |
| Remote Similarity | 0.6061 | NPC159089 |
| Remote Similarity | 0.6 | NPC302611 |
| Remote Similarity | 0.6 | NPC181153 |
| Remote Similarity | 0.6 | NPC320981 |
| Remote Similarity | 0.5769 | NPC8187 |
| Remote Similarity | 0.5769 | NPC203105 |