Drug Information| Drug ID: | NPD8177 |
| Drug Name: | Pamidronate Disodium |
| Molecular Formula: | C3H11NO7P2.2Na |
| Canonical SMILES: | NCCC(P(=O)(O)O)(P(=O)([O-])[O-])O.[Na+].[Na+] |
| Standard InCHI: | InChI=1S/C3H11NO7P2.2Na/c4-2-1-3(5,12(6,7)8)13(9,10)11;;/h5H,1-2,4H2,(H2,6,7,8)(H2,9,10,11);;/q;2*+1/p-2 |
| Standard InCHIKey: | CEYUIFJWVHOCPP-UHFFFAOYSA-L |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8177Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7273 | NPC258912 |
| Intermediate Similarity | 0.7222 | NPC292422 |
| Remote Similarity | 0.625 | NPC315977 |
| Remote Similarity | 0.6042 | NPC286989 |
| Remote Similarity | 0.5897 | NPC114517 |
| Remote Similarity | 0.5641 | NPC84444 |
| Remote Similarity | 0.5641 | NPC145217 |