Drug Information| Drug ID: | NPD7387 |
| Drug Name: | Trichloroethylene |
| Molecular Formula: | C2HCl3 |
| Canonical SMILES: | ClC=C(Cl)Cl |
| Standard InCHI: | InChI=1S/C2HCl3/c3-1-2(4)5/h1H |
| Standard InCHIKey: | XSTXAVWGXDQKEL-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD7387Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC318820 |
| Intermediate Similarity | 0.8462 | NPC323700 |
| Intermediate Similarity | 0.7333 | NPC243894 |
| Remote Similarity | 0.6667 | NPC182606 |
| Remote Similarity | 0.6316 | NPC223400 |
| Remote Similarity | 0.5714 | NPC90974 |