Drug Information| Drug ID: | NPD7369 |
| Drug Name: | Acetohydroxamic Acid |
| Molecular Formula: | C2H5NO2 |
| Canonical SMILES: | ON=C(O)C |
| Standard InCHI: | InChI=1S/C2H5NO2/c1-2(4)3-5/h5H,1H3,(H,3,4) |
| Standard InCHIKey: | RRUDCFGSUDOHDG-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD7369Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC319972 |
| Intermediate Similarity | 0.7727 | NPC85447 |
| Intermediate Similarity | 0.7391 | NPC318463 |
| Remote Similarity | 0.6667 | NPC165568 |
| Remote Similarity | 0.6667 | NPC290188 |
| Remote Similarity | 0.64 | NPC326378 |
| Remote Similarity | 0.6333 | NPC60250 |
| Remote Similarity | 0.5862 | NPC254685 |
| Remote Similarity | 0.5714 | NPC199978 |
| Remote Similarity | 0.5625 | NPC260324 |
| Molecular Weight | 75.03 |
| ALogP | -0.188 |
| MLogP | 1.35 |
| XLogP | 0.163 |
| HDA | 1 |
| HBD | 2 |
| Rotatable Bonds | 3 |
| TPSA | 52.82 |
| RO5 Violation | 0 |