Drug Information| Drug ID: | NPD596 |
| Drug Name: | Methoxamine Hydrochloride |
| Molecular Formula: | C11H17NO3.ClH |
| Canonical SMILES: | COc1ccc(c(c1)C(C(N)C)O)OC.Cl |
| Standard InCHI: | InChI=1S/C11H17NO3.ClH/c1-7(12)11(13)9-6-8(14-2)4-5-10(9)15-3;/h4-7,11,13H,12H2,1-3H3;1H |
| Standard InCHIKey: | YGRFXPCHZBRUKP-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD596Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7