NPASS drugs

Drug Information

Drug ID:	NPD5763
Drug Name:	Treprostinil
Molecular Formula:	C23H34O5
Canonical SMILES:	CCCCC[C@@H](CC[C@H]1[C@H](O)C[C@H]2[C@@H]1Cc1cccc(c1C2)OCC(=O)O)O
Standard InCHI:	InChI=1S/C23H34O5/c1-2-3-4-7-17(24)9-10-18-19-11-15-6-5-8-22(28-14-23(26)27)20(15)12-16(19)13-21(18)25/h5-6,8,16-19,21,24-25H,2-4,7,9-14H2,1H3,(H,26,27)/t16-,17-,18+,19-,21+/m0/s1
Standard InCHIKey:	PAJMKGZZBBTTOY-ZFORQUDYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD5763

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	206
0.1-0.2	931
0.2-0.3	1941
0.3-0.4	3756
0.4-0.5	8252
0.5-0.6	4626
0.6-0.7	8580
0.7-0.8	2589
0.8-0.85	9
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.8435	NPC95990
Intermediate Similarity	0.8158	NPC469699
Intermediate Similarity	0.8153	NPC327694
Intermediate Similarity	0.8143	NPC249425
Intermediate Similarity	0.8101	NPC318472
Intermediate Similarity	0.8058	NPC469386
Intermediate Similarity	0.8027	NPC131971
Intermediate Similarity	0.8014	NPC11089
Intermediate Similarity	0.8	NPC20360
Intermediate Similarity	0.7987	NPC163898

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD5763 OpenBabel08211708292D 31 33 0 0 1 0 0 0 0 0999 V2000 -9.4180 -3.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4399 -2.8486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7707 -3.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7926 -3.3838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1235 -4.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8363 -2.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8581 -2.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5491 -0.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -0.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1453 -3.9190 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.5491 -1.8090 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5981 -1.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1369 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4762 -4.6622 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1369 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7852 -5.6132 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6369 -1.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 7 1 0 0 0 0 5 6 2 0 0 0 0 5 8 1 0 0 0 0 6 15 1 0 0 0 0 8 22 2 0 0 0 0 9 10 1 0 0 0 0 9 17 1 0 0 0 0 11 15 1 0 0 0 0 12 20 1 0 0 0 0 13 16 1 0 0 0 0 13 21 1 0 0 0 0 14 23 1 0 0 0 0 14 28 1 0 0 0 0 15 20 2 0 0 0 0 16 12 1 6 0 0 0 16 19 1 0 0 0 0 17 7 1 1 0 0 0 17 24 1 0 0 0 0 18 10 1 1 0 0 0 18 19 1 0 0 0 0 18 21 1 0 0 0 0 19 11 1 6 0 0 0 20 22 1 0 0 0 0 21 25 1 6 0 0 0 22 28 1 0 0 0 0 23 26 2 0 0 0 0 23 27 1 0 0 0 0 24 29 1 0 0 0 0 25 30 1 0 0 0 0 27 31 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001214
DrugBank	DB00374
ChEMBL	CHEMBL1237119
IUPHAR/BPS	5820
PharmaGKB	PA164768801
KEGG Drug
PubChem CID	6918140
ChEBI	50861
CAS Number	81846-19-7

Drug Properties

Molecular Weight	390.24
ALogP	-2.7705
MLogP	3.44
XLogP	4.744
HDA	4
HBD	3
Rotatable Bonds	14
TPSA	86.99
RO5 Violation	0