NPASS drugs

Drug Information

Drug ID:	NPD5647
Drug Name:
Molecular Formula:	C23H28O6
Canonical SMILES:	COC(=O)CCC=C=CC[C@H]1C(=O)C[C@H]([C@@H]1/C=C/[C@H](COc1ccccc1)O)O
Standard InCHI:	InChI=1S/C23H28O6/c1-28-23(27)12-8-3-2-7-11-19-20(22(26)15-21(19)25)14-13-17(24)16-29-18-9-5-4-6-10-18/h3-7,9-10,13-14,17,19-20,22,24,26H,8,11-12,15-16H2,1H3/b14-13+/t2?,17-,19-,20-,22-/m1/s1
Standard InCHIKey:	PTOJVMZPWPAXER-VFJVYMGBSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD5647

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	165
0.1-0.2	715
0.2-0.3	1899
0.3-0.4	4608
0.4-0.5	8771
0.5-0.6	4388
0.6-0.7	9416
0.7-0.8	927
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.803	NPC474476
Intermediate Similarity	0.7899	NPC470990
Intermediate Similarity	0.7891	NPC293424
Intermediate Similarity	0.7863	NPC469927
Intermediate Similarity	0.7836	NPC12022
Intermediate Similarity	0.7836	NPC20404
Intermediate Similarity	0.7836	NPC20287
Intermediate Similarity	0.7836	NPC293641
Intermediate Similarity	0.7826	NPC176814
Intermediate Similarity	0.7826	NPC68779

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD5647 OpenBabel08211708292D 31 32 0 0 1 0 0 0 0 0999 V2000 -6.1880 5.8808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1759 3.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3838 4.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3007 -0.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4347 -0.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3007 0.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9680 2.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3349 4.9537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5686 -0.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4347 1.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0169 2.3794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5428 5.9319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9706 2.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9706 1.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9781 -0.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7026 2.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8366 2.9945 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.5686 0.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8090 1.4013 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1045 0.9945 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.4781 0.6581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4938 6.2409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8366 3.9945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4727 0.7626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7431 -0.6691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7017 7.2190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2370 5.5718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7026 1.4945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7026 4.4945 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5352 -1.6473 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 28 1 0 0 0 0 2 3 2 0 0 0 0 2 7 2 0 0 0 0 3 8 1 0 0 0 0 4 5 2 0 0 0 0 4 6 1 0 0 0 0 5 9 1 0 0 0 0 6 10 2 0 0 0 0 7 11 1 0 0 0 0 8 12 1 0 0 0 0 9 18 2 0 0 0 0 10 18 1 0 0 0 0 12 23 1 0 0 0 0 13 14 2 0 0 0 0 15 21 1 0 0 0 0 15 22 1 0 0 0 0 16 17 1 0 0 0 0 16 29 1 0 0 0 0 17 13 1 1 0 0 0 17 24 1 0 0 0 0 18 29 1 0 0 0 0 19 11 1 6 0 0 0 19 20 1 0 0 0 0 19 21 1 0 0 0 0 20 14 1 1 0 0 0 20 22 1 0 0 0 0 21 25 2 0 0 0 0 22 26 1 6 0 0 0 23 27 2 0 0 0 0 23 28 1 0 0 0 0 24 30 1 0 0 0 0 26 31 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNAP001544
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	5311225
ChEBI
CAS Number

Drug Properties

Molecular Weight	400.19
ALogP	-0.2489
MLogP	3.33
XLogP	3.82
HDA	5
HBD	2
Rotatable Bonds	14
TPSA	93.06
RO5 Violation	1