NPASS drugs

Drug Information

Drug ID:	NPD5369
Drug Name:	Misoprostol (Methyl Ester); Misoprostol
Molecular Formula:	C22H38O5
Canonical SMILES:	CCCCC(C/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)OC)(O)C
Standard InCHI:	InChI=1S/C22H38O5/c1-4-5-14-22(2,26)15-10-12-18-17(19(23)16-20(18)24)11-8-6-7-9-13-21(25)27-3/h10,12,17-18,20,24,26H,4-9,11,13-16H2,1-3H3/b12-10+/t17-,18-,20-,22?/m1/s1
Standard InCHIKey:	OJLOPKGSLYJEMD-URPKTTJQSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD5369

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	110
0.1-0.2	695
0.2-0.3	3571
0.3-0.4	10118
0.4-0.5	6634
0.5-0.6	5129
0.6-0.7	4092
0.7-0.8	527
0.8-0.85	7
0.85-0.9	4
0.9-0.95	3
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9359	NPC7414
High Similarity	0.9231	NPC47031
High Similarity	0.9103	NPC115418
High Similarity	0.8974	NPC164308
High Similarity	0.8974	NPC201225
High Similarity	0.859	NPC279537
High Similarity	0.8519	NPC88735
Intermediate Similarity	0.8148	NPC27949
Intermediate Similarity	0.8148	NPC260814
Intermediate Similarity	0.8148	NPC39547

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD5369 OpenBabel08211706322D 29 29 0 0 1 0 0 0 0 0999 V2000 -5.8392 -2.0464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9601 -3.3546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9195 3.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4324 -2.9600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4379 -3.0645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2981 -0.7420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2926 -0.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8913 -1.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6993 0.2761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2733 -1.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8968 -1.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2788 -1.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6938 0.3806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8501 -2.2555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8611 -2.4646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8090 0.5878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3090 -0.9511 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3090 -0.9511 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6180 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 6.1006 1.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8556 -2.3600 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 2.5691 0.3090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9511 0.3090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0951 1.3987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7511 -1.3655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5128 2.1032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1590 1.2872 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8375 -0.9588 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 4 1 0 0 0 0 2 22 1 0 0 0 0 3 27 1 0 0 0 0 4 5 1 0 0 0 0 5 14 1 0 0 0 0 6 7 1 0 0 0 0 6 8 1 0 0 0 0 7 9 1 0 0 0 0 8 11 1 0 0 0 0 9 13 1 0 0 0 0 10 12 2 0 0 0 0 10 15 1 0 0 0 0 13 21 1 0 0 0 0 14 22 1 0 0 0 0 15 22 1 0 0 0 0 16 19 1 0 0 0 0 16 20 1 0 0 0 0 17 11 1 6 0 0 0 17 18 1 0 0 0 0 17 19 1 0 0 0 0 18 12 1 1 0 0 0 18 20 1 0 0 0 0 19 23 2 0 0 0 0 20 24 1 6 0 0 0 21 25 2 0 0 0 0 21 27 1 0 0 0 0 22 26 1 0 0 0 0 24 28 1 0 0 0 0 26 29 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000358
DrugBank	DB05379
ChEMBL
IUPHAR/BPS	1936
PharmaGKB
KEGG Drug
PubChem CID	5282381
ChEBI
CAS Number

Drug Properties

Molecular Weight	382.27
ALogP	-2.0855
MLogP	3.33
XLogP	3.567
HDA	5
HBD	2
Rotatable Bonds	19
TPSA	83.83
RO5 Violation	1