NPASS drugs

Drug Information

Drug ID:	NPD5205
Drug Name:	Etonogestrel
Molecular Formula:	C22H28O2
Canonical SMILES:	C#C[C@]1(O)CC[C@@H]2[C@]1(CC)CC(=C)[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12
Standard InCHI:	InChI=1S/C22H28O2/c1-4-21-13-14(3)20-17-9-7-16(23)12-15(17)6-8-18(20)19(21)10-11-22(21,24)5-2/h2,12,17-20,24H,3-4,6-11,13H2,1H3/t17-,18-,19-,20+,21-,22-/m0/s1
Standard InCHIKey:	GCKFUYQCUCGESZ-BPIQYHPVSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD5205

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	120
0.1-0.2	906
0.2-0.3	4002
0.3-0.4	11289
0.4-0.5	5891
0.5-0.6	4760
0.6-0.7	2863
0.7-0.8	960
0.8-0.85	77
0.85-0.9	19
0.9-0.95	2
0.95-1	1

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.95	NPC193347
High Similarity	0.9268	NPC144258
High Similarity	0.9136	NPC150506
High Similarity	0.8837	NPC320665
High Similarity	0.881	NPC321187
High Similarity	0.881	NPC329043
High Similarity	0.881	NPC161423
High Similarity	0.881	NPC58841
High Similarity	0.881	NPC227064
High Similarity	0.8736	NPC326627

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD5205 OpenBabel08211706322D 25 28 0 0 1 0 0 0 0 0999 V2000 -1.7304 0.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7226 1.6216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4000 0.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8424 0.4857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0003 0.9716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5271 -3.4036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0530 -1.9446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6848 -2.9173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2112 -1.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8412 -1.4584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8412 -0.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2113 -3.4036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6847 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5271 -0.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3695 -2.9173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0530 -2.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3695 -1.9446 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6848 -1.9447 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8424 -1.4583 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5271 -1.4583 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8424 -0.4863 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9211 -3.4180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8415 0.4858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7656 0.1855 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 4 1 0 0 0 0 2 5 3 0 0 0 0 3 14 2 0 0 0 0 4 21 1 0 0 0 0 6 8 1 0 0 0 0 6 15 1 0 0 0 0 7 9 1 0 0 0 0 7 16 1 0 0 0 0 10 11 1 0 0 0 0 10 19 1 0 0 0 0 11 22 1 0 0 0 0 12 15 2 0 0 0 0 12 16 1 0 0 0 0 13 14 1 0 0 0 0 13 21 1 0 0 0 0 15 17 1 0 0 0 0 16 23 2 0 0 0 0 17 9 1 6 0 0 0 17 20 1 0 0 0 0 18 8 1 6 0 0 0 18 19 1 0 0 0 0 18 20 1 0 0 0 0 19 21 1 1 0 0 0 20 14 1 1 0 0 0 21 22 1 6 0 0 0 22 5 1 6 0 0 0 22 24 1 0 0 0 0 24 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000855
DrugBank	DB00294
ChEMBL	CHEMBL1531
IUPHAR/BPS	7590
PharmaGKB	PA164771231
KEGG Drug
PubChem CID	6917715
ChEBI	50777
CAS Number	54048-10-1

Drug Properties

Molecular Weight	324.21
ALogP	1.4406
MLogP	3.66
XLogP	3.4
HDA	2
HBD	1
Rotatable Bonds	3
TPSA	37.3
RO5 Violation	0