NPASS drugs

Drug Information

Drug ID:	NPD5135
Drug Name:	fluticasone
Molecular Formula:	C22H27F3O4S
Canonical SMILES:	FCSC(=O)[C@@]1(O)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)F)F
Standard InCHI:	InChI=1S/C22H27F3O4S/c1-11-6-13-14-8-16(24)15-7-12(26)4-5-19(15,2)21(14,25)17(27)9-20(13,3)22(11,29)18(28)30-10-23/h4-5,7,11,13-14,16-17,27,29H,6,8-10H2,1-3H3/t11-,13+,14+,16+,17+,19+,20+,21+,22+/m1/s1
Standard InCHIKey:	MGNNYOODZCAHBA-GQKYHHCASA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD5135

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	141
0.1-0.2	887
0.2-0.3	3796
0.3-0.4	9208
0.4-0.5	7899
0.5-0.6	4881
0.6-0.7	3399
0.7-0.8	662
0.8-0.85	13
0.85-0.9	4
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.8922	NPC144956
High Similarity	0.8725	NPC18509
High Similarity	0.8611	NPC2766
High Similarity	0.8532	NPC235077
Intermediate Similarity	0.8426	NPC44063
Intermediate Similarity	0.8416	NPC168027
Intermediate Similarity	0.8416	NPC185936
Intermediate Similarity	0.8148	NPC311612
Intermediate Similarity	0.8119	NPC328539
Intermediate Similarity	0.8108	NPC214644

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD5135 OpenBabel08211706322D 32 35 0 0 1 0 0 0 0 0999 V2000 -1.7170 0.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3751 -0.9372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8435 0.5227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0616 -1.9463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2183 -1.4595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8421 -1.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2189 -3.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6882 -2.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6874 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5216 2.5761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8424 -0.4873 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0618 -2.9205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8441 -1.4604 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6879 -1.9473 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3756 -2.9210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5321 -3.4083 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5312 -0.4864 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0003 0.9732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3753 -1.9468 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8438 -0.4868 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5315 -1.4600 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4038 2.8771 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 2.5324 -4.4179 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 3.3988 -0.9589 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 5.9364 -3.4249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3742 0.0007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9252 1.2742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8429 0.4863 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7237 1.6242 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 3.3739 0.9743 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4939 -0.2371 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 11 1 0 0 0 0 2 19 1 0 0 0 0 3 20 1 0 0 0 0 4 5 2 0 0 0 0 4 12 1 0 0 0 0 5 19 1 0 0 0 0 6 11 1 0 0 0 0 6 13 1 0 0 0 0 7 12 1 0 0 0 0 7 15 2 0 0 0 0 8 14 1 0 0 0 0 8 16 1 0 0 0 0 9 17 1 0 0 0 0 9 20 1 0 0 0 0 10 23 1 0 0 0 0 10 30 1 0 0 0 0 11 22 1 1 0 0 0 12 26 2 0 0 0 0 13 14 1 0 0 0 0 13 20 1 6 0 0 0 14 21 1 1 0 0 0 15 16 1 0 0 0 0 15 19 1 0 0 0 0 16 24 1 1 0 0 0 17 21 1 6 0 0 0 17 27 1 0 0 0 0 18 28 2 0 0 0 0 18 30 1 0 0 0 0 19 21 1 1 0 0 0 20 22 1 1 0 0 0 21 25 1 1 0 0 0 22 18 1 6 0 0 0 22 29 1 0 0 0 0 27 31 1 0 0 0 0 29 32 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001380
DrugBank
ChEMBL
IUPHAR/BPS	6699
PharmaGKB
KEGG Drug
PubChem CID	5311101
ChEBI
CAS Number

Drug Properties

Molecular Weight	444.16
ALogP	1.0572
MLogP	3
XLogP	2.396
HDA	4
HBD	2
Rotatable Bonds	11
TPSA	99.9
RO5 Violation	0