NPASS drugs

Drug Information

Drug ID:	NPD4790
Drug Name:	ataprost
Molecular Formula:	C21H32O4
Canonical SMILES:	OC(=O)CCC/C=C/1C[C@@H]2[C@H](C1)[C@H]([C@@H](C2)O)/C=C/[C@H](C1CCCC1)O
Standard InCHI:	InChI=1S/C21H32O4/c22-19(15-6-2-3-7-15)10-9-17-18-12-14(5-1-4-8-21(24)25)11-16(18)13-20(17)23/h5,9-10,15-20,22-23H,1-4,6-8,11-13H2,(H,24,25)/b10-9+,14-5+/t16-,17+,18-,19+,20+/m0/s1
Standard InCHIKey:	DKLGLHQHLFISGJ-YLBFUXKPSA-N
Max Developmental Stage:	Discontinued
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD4790

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	118
0.1-0.2	634
0.2-0.3	3678
0.3-0.4	11479
0.4-0.5	6349
0.5-0.6	5573
0.6-0.7	2917
0.7-0.8	131
0.8-0.85	5
0.85-0.9	6
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.8608	NPC27949
High Similarity	0.8608	NPC323249
High Similarity	0.8608	NPC260814
High Similarity	0.8608	NPC39547
High Similarity	0.8519	NPC88735
High Similarity	0.8519	NPC316844
Intermediate Similarity	0.8415	NPC7414
Intermediate Similarity	0.8354	NPC279537
Intermediate Similarity	0.8293	NPC47031
Intermediate Similarity	0.8272	NPC201225

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD4790 OpenBabel08211705272D 28 30 0 0 1 0 0 0 0 0999 V2000 1.1660 -3.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1581 4.6010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1092 4.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6660 -2.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1660 -3.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4297 3.7919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1092 3.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1660 -2.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2092 0.3377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5182 1.2887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3286 -2.8618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0727 -2.0528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2796 -1.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3340 -2.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1581 2.9829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5365 -1.8836 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8784 -0.4055 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6704 -1.3836 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1509 2.0319 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8729 -0.3009 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6660 -1.2343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1290 1.8240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1660 -0.3682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6660 -1.2343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7982 2.5671 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1660 -0.3682 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 4 1 0 0 0 0 1 5 1 0 0 0 0 2 3 1 0 0 0 0 2 6 1 0 0 0 0 3 7 1 0 0 0 0 4 8 1 0 0 0 0 5 14 2 0 0 0 0 6 15 1 0 0 0 0 7 15 1 0 0 0 0 8 21 1 0 0 0 0 9 10 2 0 0 0 0 11 14 1 0 0 0 0 12 14 1 0 0 0 0 13 16 1 0 0 0 0 13 20 1 0 0 0 0 15 19 1 0 0 0 0 16 11 1 1 0 0 0 16 18 1 0 0 0 0 17 9 1 6 0 0 0 17 18 1 0 0 0 0 17 20 1 0 0 0 0 18 12 1 1 0 0 0 19 10 1 6 0 0 0 19 22 1 0 0 0 0 20 23 1 1 0 0 0 21 24 2 0 0 0 0 21 25 1 0 0 0 0 22 26 1 0 0 0 0 23 27 1 0 0 0 0 25 28 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB015773
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	348.23
ALogP	-0.91
MLogP	3.33
XLogP	3.388
HDA	4
HBD	3
Rotatable Bonds	10
TPSA	77.76
RO5 Violation	0