NPASS drugs

Drug Information

Drug ID:	NPD4270
Drug Name:	Alprostadil
Molecular Formula:	C20H34O5
Canonical SMILES:	CCCCC[C@@H](C=C[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)O)O
Standard InCHI:	InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-17,19,21,23H,2-11,14H2,1H3,(H,24,25)/t15-,16+,17+,19+/m0/s1
Standard InCHIKey:	GMVPRGQOIOIIMI-DODZYUBVSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	DrugBank

Structural Similarity Between NPASS Natural Products and NPD4270

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	103
0.1-0.2	681
0.2-0.3	3298
0.3-0.4	9156
0.4-0.5	8001
0.5-0.6	5153
0.6-0.7	3927
0.7-0.8	555
0.8-0.85	4
0.85-0.9	6
0.9-0.95	2
0.95-1	4

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC7414
High Similarity	0.9868	NPC47031
High Similarity	0.9737	NPC115418
High Similarity	0.9605	NPC201225
High Similarity	0.9211	NPC279537
High Similarity	0.9114	NPC88735
High Similarity	0.8861	NPC164308
High Similarity	0.8734	NPC27949
High Similarity	0.8734	NPC260814
High Similarity	0.8734	NPC323249

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD4270 OpenBabel08211704332D 28 28 0 0 1 0 0 0 0 0999 V2000 -4.2731 6.5878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4071 6.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4071 5.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1043 -1.3383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8475 -2.0074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5411 4.5878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3122 -0.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6396 -2.9855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5411 3.5878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5691 0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3827 -3.6547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6750 2.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8090 1.5878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3090 -0.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6750 3.0878 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6180 0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8090 0.5878 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.3090 -0.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1748 -4.6328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8090 3.5878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8968 -1.7601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9511 0.3090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2237 -4.9418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9179 -5.3019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0570 3.0878 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6942 -0.3601 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7100 -6.2801 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 6 1 0 0 0 0 4 5 1 0 0 0 0 4 7 1 0 0 0 0 5 8 1 0 0 0 0 6 9 1 0 0 0 0 7 10 1 0 0 0 0 8 11 1 0 0 0 0 11 20 1 0 0 0 0 12 13 2 3 0 0 0 12 15 1 0 0 0 0 14 18 1 0 0 0 0 14 19 1 0 0 0 0 15 9 1 6 0 0 0 15 21 1 0 0 0 0 16 10 1 6 0 0 0 16 17 1 0 0 0 0 16 18 1 0 0 0 0 17 13 1 1 0 0 0 17 19 1 0 0 0 0 18 22 2 0 0 0 0 19 23 1 6 0 0 0 20 24 2 0 0 0 0 20 25 1 0 0 0 0 21 26 1 0 0 0 0 23 27 1 0 0 0 0 25 28 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001490
DrugBank	DB00770
ChEMBL	CHEMBL495
IUPHAR/BPS
PharmaGKB	PA448334
KEGG Drug	D00180
PubChem CID
ChEBI	15544
CAS Number	745-65-3

Drug Properties

Molecular Weight	354.24
ALogP	-3.4355
MLogP	3.11
XLogP	3.306
HDA	5
HBD	3
Rotatable Bonds	17
TPSA	94.83
RO5 Violation	1