NPASS drugs

Drug Information

Drug ID:	NPD4110
Drug Name:	Cilomilast
Molecular Formula:	C20H25NO4
Canonical SMILES:	N#C[C@@]1(CC[C@@H](CC1)C(=O)O)c1ccc(c(c1)OC1CCCC1)OC
Standard InCHI:	InChI=1S/C20H25NO4/c1-24-17-7-6-15(12-18(17)25-16-4-2-3-5-16)20(13-21)10-8-14(9-11-20)19(22)23/h6-7,12,14,16H,2-5,8-11H2,1H3,(H,22,23)/t14-,20-
Standard InCHIKey:	CFBUZOUXXHZCFB-OYOVHJISSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4110

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	164
0.1-0.2	852
0.2-0.3	1765
0.3-0.4	4095
0.4-0.5	9057
0.5-0.6	3468
0.6-0.7	9130
0.7-0.8	2319
0.8-0.85	34
0.85-0.9	6
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.854	NPC223807
High Similarity	0.8511	NPC68779
High Similarity	0.8511	NPC5310
High Similarity	0.8511	NPC300776
High Similarity	0.8511	NPC176814
High Similarity	0.8511	NPC4982
Intermediate Similarity	0.8417	NPC241354
Intermediate Similarity	0.8288	NPC100675
Intermediate Similarity	0.8288	NPC29599
Intermediate Similarity	0.8264	NPC90431

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD4110 OpenBabel08211704332D 26 28 0 0 1 0 0 0 0 0999 V2000 0.5176 1.9319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1147 -1.1829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4076 -1.8900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6607 -0.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5166 -1.4360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9319 -0.5176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6730 0.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2156 -2.1907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3496 -3.6907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3496 -1.6907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4836 -3.1907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2588 -0.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6902 -2.7994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2156 -3.1907 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.2247 -1.2247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6730 -0.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 0.7071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0816 -3.6907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4836 -2.1907 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1031 -3.4082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.9477 -3.1907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0816 -4.6907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4483 1.6730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9659 0.2588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2156 -5.1907 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 24 1 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 3 5 1 0 0 0 0 4 16 1 0 0 0 0 5 16 1 0 0 0 0 6 7 2 0 0 0 0 6 15 1 0 0 0 0 7 17 1 0 0 0 0 8 10 1 0 0 0 0 8 14 1 0 0 0 0 9 11 1 0 0 0 0 9 14 1 0 0 0 0 10 20 1 0 0 0 0 11 20 1 0 0 0 0 12 15 2 0 0 0 0 12 18 1 0 0 0 0 13 21 3 0 0 0 0 14 19 1 1 0 0 0 15 20 1 0 0 0 0 16 25 1 0 0 0 0 17 18 2 0 0 0 0 17 24 1 0 0 0 0 18 25 1 0 0 0 0 19 22 2 0 0 0 0 19 23 1 0 0 0 0 20 13 1 1 0 0 0 23 26 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank	DB03849
ChEMBL	CHEMBL511115
IUPHAR/BPS
PharmaGKB
KEGG Drug	D01704
PubChem CID
ChEBI
CAS Number	153259-65-5

Drug Properties

Molecular Weight	343.18
ALogP	-1.4919
MLogP	3.11
XLogP	2.787
HDA	3
HBD	1
Rotatable Bonds	7
TPSA	79.55
RO5 Violation	0